/*
*Last modified: 2021-07-12 08:48:33
*Filename: ax.js
*Description: Global JS
*Version: v1.0.3
*Website:www.axui.cn or ax.hobly.cn
*Github:https://www.github.com/axui/axui
*Gitee:https://www.gitee.com/axui/axui
*Contact:3217728223@qq.com
*Discuss:952502085(qq group)
*Author:Michael
*/
/* blind client */
var userAgentInfo = navigator.userAgent;
var mobileAgents = ["Android", "iPhone", "SymbianOS", "Windows Phone", "iPad", "iPod"];
var platformIs = 'pc';
for (var v = 0; v < mobileAgents.length; v++) {
if (userAgentInfo.indexOf(mobileAgents[v]) > 0) {
platformIs = 'mobile';
break;
}
}
var clientIs = 'pc';
var screenWidth = window.screen.width;
var screenHeight = window.screen.height;
if (screenWidth < 500) {
clientIs = 'phone';
} else if (screenWidth > 500 && screenWidth < 900) {
clientIs = 'pad';
} else if (screenWidth > 900 && screenWidth < 1200) {
clientIs = 'padflip';
} else if (screenWidth > 1200 && screenWidth < 1500) {
clientIs = 'padpro';
} else {
clientIs = 'pc';
}
/*blind box*/
(function($, window, undefined) {
var elems = $([]),
jq_resize = $.resize = $.extend($.resize, {}),
timeout_id, str_setTimeout = 'setTimeout',
str_resize = 'resize',
str_data = str_resize + '-special-event',
str_delay = 'delay',
str_throttle = 'throttleWindow';
jq_resize[str_delay] = 250;
jq_resize[str_throttle] = true;
$.event.special[str_resize] = {
setup: function() {
if (!jq_resize[str_throttle] && this[str_setTimeout]) { return false }
var elem = $(this);
elems = elems.add(elem);
$.data(this, str_data, { w: elem.width(), h: elem.height() });
if (elems.length === 1) { loopy() }
},
teardown: function() {
if (!jq_resize[str_throttle] && this[str_setTimeout]) { return false }
var elem = $(this);
elems = elems.not(elem);
elem.removeData(str_data);
if (!elems.length) { clearTimeout(timeout_id) }
},
add: function(handleObj) {
if (!jq_resize[str_throttle] && this[str_setTimeout]) { return false }
var old_handler;
function new_handler(e, w, h) {
var elem = $(this),
data = $.data(this, str_data);
data.w = w !== undefined ? w : elem.width();
data.h = h !== undefined ? h : elem.height();
old_handler.apply(this, arguments)
}
if ($.isFunction(handleObj)) { old_handler = handleObj; return new_handler } else {
old_handler = handleObj.handler;
handleObj.handler = new_handler
}
}
};
function loopy() {
timeout_id = window[str_setTimeout](function() {
elems.each(function() {
var elem = $(this),
width = elem.width(),
height = elem.height(),
data = $.data(this, str_data);
if (width !== data.w || height !== data.h) { elem.trigger(str_resize, [data.w = width, data.h = height]) }
});
loopy()
}, jq_resize[str_delay])
}
})(jQuery, this);
/* jq.cookie.js */
jQuery.cookie = function(name, value, options) {
if (typeof value != "undefined") {
options = options || {};
if (value === null) {
value = "";
options = $.extend({}, options);
options.expires = -1
}
var expires = "";
if (options.expires && (typeof options.expires == "number" || options.expires.toUTCString)) {
var date;
if (typeof options.expires == "number") {
date = new Date();
date.setTime(date.getTime() + (options.expires * 24 * 60 * 60 * 1000))
} else { date = options.expires }
expires = "; expires=" + date.toUTCString()
}
var path = options.path ? "; path=" + (options.path) : "";
var domain = options.domain ? "; domain=" + (options.domain) : "";
var secure = options.secure ? "; secure" : "";
document.cookie = [name, "=", encodeURIComponent(value), expires, path, domain, secure].join("")
} else { var cookieValue = null; if (document.cookie && document.cookie != "") { var cookies = document.cookie.split(";"); for (var i = 0; i < cookies.length; i++) { var cookie = jQuery.trim(cookies[i]); if (cookie.substring(0, name.length + 1) == (name + "=")) { cookieValue = decodeURIComponent(cookie.substring(name.length + 1)); break } } } return cookieValue }
};
/*scroll*/
(function(factory) { if (typeof define === "function" && define.amd) { define(["jquery"], factory) } else if (typeof exports === "object") { module.exports = factory(require("jquery")) } else { factory(jQuery) } })(function(jQuery) {
"use strict";
var domfocus = false,
mousefocus = false,
tabindexcounter = 0,
ascrailcounter = 2e3,
globalmaxzindex = 0;
var $ = jQuery,
_doc = document,
_win = window,
$window = $(_win);
var delegatevents = [];
function getScriptPath() { var scripts = _doc.currentScript || function() { var s = _doc.getElementsByTagName("script"); return s.length ? s[s.length - 1] : false }(); var path = scripts ? scripts.src.split("?")[0] : ""; return path.split("/").length > 0 ? path.split("/").slice(0, -1).join("/") + "/" : "" }
var setAnimationFrame = _win.requestAnimationFrame || _win.webkitRequestAnimationFrame || _win.mozRequestAnimationFrame || false;
var clearAnimationFrame = _win.cancelAnimationFrame || _win.webkitCancelAnimationFrame || _win.mozCancelAnimationFrame || false;
if (!setAnimationFrame) {
var anilasttime = 0;
setAnimationFrame = function(callback, element) {
var currTime = (new Date).getTime();
var timeToCall = Math.max(0, 16 - (currTime - anilasttime));
var id = _win.setTimeout(function() { callback(currTime + timeToCall) }, timeToCall);
anilasttime = currTime + timeToCall;
return id
};
clearAnimationFrame = function(id) { _win.clearTimeout(id) }
} else { if (!_win.cancelAnimationFrame) clearAnimationFrame = function(id) {} }
var ClsMutationObserver = _win.MutationObserver || _win.WebKitMutationObserver || false;
var now = Date.now || function() { return (new Date).getTime() };
var _globaloptions = { zindex: "auto", cursoropacitymin: 0, cursoropacitymax: 1, cursorcolor: "rgba(0,0,0,.3)", cursorcolorHover: "rgba(0,0,0,.4)", cursorwidth: "6px", cursorwidthHover: "14px", cursorborder: "0px solid #fff", cursorborderradius: "0px", scrollspeed: 40, mousescrollstep: 9 * 3, touchbehavior: false, emulatetouch: false, hwacceleration: true, usetransition: true, boxzoom: false, dblclickzoom: true, gesturezoom: true, grabcursorenabled: true, autohidemode: true, background: "rgba(0,0,0,.04)", iframeautoresize: true, cursorminheight: 32, preservenativescrolling: true, railoffset: false, railhoffset: false, bouncescroll: true, spacebarenabled: true, railpadding: { top: 0, right: 0, left: 0, bottom: 0 }, disableoutline: true, horizrailenabled: true, railalign: "right", railvalign: "bottom", enabletranslate3d: true, enablemousewheel: true, enablekeyboard: true, smoothscroll: true, sensitiverail: true, enablemouselockapi: true, cursorfixedheight: false, directionlockdeadzone: 6, hidecursordelay: 400, nativeparentscrolling: true, enablescrollonselection: true, overflowx: true, overflowy: true, cursordragspeed: .3, rtlmode: "auto", cursordragontouch: false, oneaxismousemode: "auto", scriptpath: getScriptPath(), preventmultitouchscrolling: true, disablemutationobserver: false, enableobserver: true, scrollbarid: false, scrollCLass: false };
var svgExpand = '';
var svgCollapse = '';
var browserdetected = false;
var getBrowserDetection = function() {
if (browserdetected) return browserdetected;
var _el = _doc.createElement("DIV"),
_style = _el.style,
_agent = navigator.userAgent,
_platform = navigator.platform,
d = {};
d.haspointerlock = "pointerLockElement" in _doc || "webkitPointerLockElement" in _doc || "mozPointerLockElement" in _doc;
d.isopera = "opera" in _win;
d.isopera12 = d.isopera && "getUserMedia" in navigator;
d.isoperamini = Object.prototype.toString.call(_win.operamini) === "[object OperaMini]";
d.isie = "all" in _doc && "attachEvent" in _el && !d.isopera;
d.isieold = d.isie && !("msInterpolationMode" in _style);
d.isie7 = d.isie && !d.isieold && (!("documentMode" in _doc) || _doc.documentMode === 7);
d.isie8 = d.isie && "documentMode" in _doc && _doc.documentMode === 8;
d.isie9 = d.isie && "performance" in _win && _doc.documentMode === 9;
d.isie10 = d.isie && "performance" in _win && _doc.documentMode === 10;
d.isie11 = "msRequestFullscreen" in _el && _doc.documentMode >= 11;
d.ismsedge = "msCredentials" in _win;
d.ismozilla = "MozAppearance" in _style;
d.iswebkit = !d.ismsedge && "WebkitAppearance" in _style;
d.ischrome = d.iswebkit && "chrome" in _win;
d.ischrome38 = d.ischrome && "touchAction" in _style;
d.ischrome22 = !d.ischrome38 && (d.ischrome && d.haspointerlock);
d.ischrome26 = !d.ischrome38 && (d.ischrome && "transition" in _style);
d.cantouch = "ontouchstart" in _doc.documentElement || "ontouchstart" in _win;
d.hasw3ctouch = (_win.PointerEvent || false) && (navigator.maxTouchPoints > 0 || navigator.msMaxTouchPoints > 0);
d.hasmstouch = !d.hasw3ctouch && (_win.MSPointerEvent || false);
d.ismac = /^mac$/i.test(_platform);
d.isios = d.cantouch && /iphone|ipad|ipod/i.test(_platform);
d.isios4 = d.isios && !("seal" in Object);
d.isios7 = d.isios && "webkitHidden" in _doc;
d.isios8 = d.isios && "hidden" in _doc;
d.isios10 = d.isios && _win.Proxy;
d.isandroid = /android/i.test(_agent);
d.haseventlistener = "addEventListener" in _el;
d.trstyle = false;
d.hastransform = false;
d.hastranslate3d = false;
d.transitionstyle = false;
d.hastransition = false;
d.transitionend = false;
d.trstyle = "transform";
d.hastransform = "transform" in _style || function() {
var check = ["msTransform", "webkitTransform", "MozTransform", "OTransform"];
for (var a = 0, c = check.length; a < c; a++) { if (_style[check[a]] !== undefined) { d.trstyle = check[a]; break } }
d.hastransform = !!d.trstyle
}();
if (d.hastransform) {
_style[d.trstyle] = "translate3d(1px,2px,3px)";
d.hastranslate3d = /translate3d/.test(_style[d.trstyle])
}
d.transitionstyle = "transition";
d.prefixstyle = "";
d.transitionend = "transitionend";
d.hastransition = "transition" in _style || function() {
d.transitionend = false;
var check = ["webkitTransition", "msTransition", "MozTransition", "OTransition", "OTransition", "KhtmlTransition"];
var prefix = ["-webkit-", "-ms-", "-moz-", "-o-", "-o", "-khtml-"];
var evs = ["webkitTransitionEnd", "msTransitionEnd", "transitionend", "otransitionend", "oTransitionEnd", "KhtmlTransitionEnd"];
for (var a = 0, c = check.length; a < c; a++) {
if (check[a] in _style) {
d.transitionstyle = check[a];
d.prefixstyle = prefix[a];
d.transitionend = evs[a];
break
}
}
if (d.ischrome26) d.prefixstyle = prefix[1];
d.hastransition = d.transitionstyle
}();
function detectCursorGrab() {
var lst = ["grab", "-webkit-grab", "-moz-grab"];
if (d.ischrome && !d.ischrome38 || d.isie) lst = [];
for (var a = 0, l = lst.length; a < l; a++) {
var p = lst[a];
_style.cursor = p;
if (_style.cursor == p) return p
}
return "url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize"
}
d.cursorgrabvalue = detectCursorGrab();
d.hasmousecapture = "setCapture" in _el;
d.hasMutationObserver = ClsMutationObserver !== false;
_el = null;
browserdetected = d;
return d
};
var AxScrollClass = function(myopt, me) {
var self = this;
this.version = "3.7.6";
this.name = "axscroll";
this.me = me;
var $body = $("body");
var opt = this.opt = { doc: $body, win: false };
$.extend(opt, _globaloptions);
opt.snapbackspeed = 80;
if (myopt || false) { for (var a in opt) { if (myopt[a] !== undefined) opt[a] = myopt[a] } }
if (opt.disablemutationobserver) ClsMutationObserver = false;
this.doc = opt.doc;
this.iddoc = this.doc && this.doc[0] ? this.doc[0].id || "" : "";
this.ispage = /^BODY|HTML/.test(opt.win ? opt.win[0].nodeName : this.doc[0].nodeName);
this.haswrapper = opt.win !== false;
this.win = opt.win || (this.ispage ? $window : this.doc);
this.docscroll = this.ispage && !this.haswrapper ? $window : this.win;
this.body = $body;
this.viewport = false;
this.isfixed = false;
this.iframe = false;
this.isiframe = this.doc[0].nodeName == "IFRAME" && this.win[0].nodeName == "IFRAME";
this.istextarea = this.win[0].nodeName == "TEXTAREA";
this.forcescreen = false;
this.canshowonmouseevent = opt.autohidemode != "scroll";
this.onmousedown = false;
this.onmouseup = false;
this.onmousemove = false;
this.onmousewheel = false;
this.onkeypress = false;
this.ongesturezoom = false;
this.onclick = false;
this.onscrollstart = false;
this.onscrollend = false;
this.onscrollcancel = false;
this.onzoomin = false;
this.onzoomout = false;
this.view = false;
this.page = false;
this.scroll = { x: 0, y: 0 };
this.scrollratio = { x: 0, y: 0 };
this.cursorheight = 20;
this.scrollvaluemax = 0;
if (opt.rtlmode == "auto") {
var target = this.win[0] == _win ? this.body : this.win;
var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");
if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode === "") {
this.isrtlmode = target.css("direction") == "rtl";
this.isvertical = false
} else {
this.isrtlmode = writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb";
this.isvertical = writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl"
}
} else {
this.isrtlmode = opt.rtlmode === true;
this.isvertical = false
}
this.scrollrunning = false;
this.scrollmom = false;
this.observer = false;
this.observerremover = false;
this.observerbody = false;
if (opt.scrollbarid !== false) { this.id = opt.scrollbarid } else { do { this.id = "ascrail" + ascrailcounter++ } while (_doc.getElementById(this.id)) }
this.rail = false;
this.cursor = false;
this.cursorfreezed = false;
this.selectiondrag = false;
this.zoom = false;
this.zoomactive = false;
this.hasfocus = false;
this.hasmousefocus = false;
this.railslocked = false;
this.locked = false;
this.hidden = false;
this.cursoractive = true;
this.wheelprevented = false;
this.overflowx = opt.overflowx;
this.overflowy = opt.overflowy;
this.nativescrollingarea = false;
this.checkarea = 0;
this.events = [];
this.saved = {};
this.delaylist = {};
this.synclist = {};
this.lastdeltax = 0;
this.lastdeltay = 0;
this.detected = getBrowserDetection();
var cap = $.extend({}, this.detected);
this.canhwscroll = cap.hastransform && opt.hwacceleration;
this.ishwscroll = this.canhwscroll && self.haswrapper;
if (!this.isrtlmode) { this.hasreversehr = false } else if (this.isvertical) { this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11) } else { this.hasreversehr = !(cap.iswebkit || cap.isie && !cap.isie10 && !cap.isie11) }
this.istouchcapable = false;
if (!cap.cantouch && (cap.hasw3ctouch || cap.hasmstouch)) { this.istouchcapable = true } else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) { this.istouchcapable = true }
if (!opt.enablemouselockapi) {
cap.hasmousecapture = false;
cap.haspointerlock = false
}
this.debounced = function(name, fn, tm) {
if (!self) return;
var dd = self.delaylist[name] || false;
if (!dd) {
self.delaylist[name] = {
h: setAnimationFrame(function() {
self.delaylist[name].fn.call(self);
self.delaylist[name] = false
}, tm)
};
fn.call(self)
}
self.delaylist[name].fn = fn
};
this.synched = function(name, fn) {
if (self.synclist[name]) self.synclist[name] = fn;
else {
self.synclist[name] = fn;
setAnimationFrame(function() {
if (!self) return;
self.synclist[name] && self.synclist[name].call(self);
self.synclist[name] = null
})
}
};
this.unsynched = function(name) { if (self.synclist[name]) self.synclist[name] = false };
this.css = function(el, pars) {
for (var n in pars) {
self.saved.css.push([el, n, el.css(n)]);
el.css(n, pars[n])
}
};
this.scrollTop = function(val) { return val === undefined ? self.getScrollTop() : self.setScrollTop(val) };
this.scrollLeft = function(val) { return val === undefined ? self.getScrollLeft() : self.setScrollLeft(val) };
var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
this.st = st;
this.ed = ed;
this.spd = spd;
this.p1 = p1 || 0;
this.p2 = p2 || 1;
this.p3 = p3 || 0;
this.p4 = p4 || 1;
this.ts = now();
this.df = ed - st
};
BezierClass.prototype = {
B2: function(t) { return 3 * (1 - t) * (1 - t) * t },
B3: function(t) { return 3 * (1 - t) * t * t },
B4: function(t) { return t * t * t },
getPos: function() { return (now() - this.ts) / this.spd },
getNow: function() { var pc = (now() - this.ts) / this.spd; var bz = this.B2(pc) + this.B3(pc) + this.B4(pc); return pc >= 1 ? this.ed : this.st + this.df * bz | 0 },
update: function(ed, spd) {
this.st = this.getNow();
this.ed = ed;
this.spd = spd;
this.ts = now();
this.df = this.ed - this.st;
return this
}
};
function getMatrixValues() { var tr = self.doc.css(cap.trstyle); if (tr && tr.substr(0, 6) == "matrix") { return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, "").split(/, +/) } return false }
if (this.ishwscroll) {
this.doc.translate = { x: 0, y: 0, tx: "0px", ty: "0px" };
if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden");
this.getScrollTop = function(last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return mtx.length == 16 ? -mtx[13] : -mtx[5]; if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow() } return self.doc.translate.y };
this.getScrollLeft = function(last) { if (!last) { var mtx = getMatrixValues(); if (mtx) return mtx.length == 16 ? -mtx[12] : -mtx[4]; if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow() } return self.doc.translate.x };
this.notifyScrollEvent = function(el) {
var e = _doc.createEvent("UIEvents");
e.initUIEvent("scroll", false, false, _win, 1);
e.niceevent = true;
el.dispatchEvent(e)
};
var cxscrollleft = this.isrtlmode ? 1 : -1;
if (cap.hastranslate3d && opt.enabletranslate3d) {
this.setScrollTop = function(val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = val * -1 + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
if (!silent) self.notifyScrollEvent(self.win[0])
};
this.setScrollLeft = function(val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = val * cxscrollleft + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
if (!silent) self.notifyScrollEvent(self.win[0])
}
} else {
this.setScrollTop = function(val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = val * -1 + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0])
};
this.setScrollLeft = function(val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = val * cxscrollleft + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0])
}
}
} else {
this.getScrollTop = function() { return self.docscroll.scrollTop() };
this.setScrollTop = function(val) { self.docscroll.scrollTop(val) };
this.getScrollLeft = function() { var val; if (!self.hasreversehr) { val = self.docscroll.scrollLeft() } else if (self.detected.ismozilla) { val = self.page.maxw - Math.abs(self.docscroll.scrollLeft()) } else { val = self.page.maxw - self.docscroll.scrollLeft() } return val };
this.setScrollLeft = function(val) { return setTimeout(function() { if (!self) return; if (self.hasreversehr) { if (self.detected.ismozilla) { val = -(self.page.maxw - val) } else { val = self.page.maxw - val } } return self.docscroll.scrollLeft(val) }, 1) }
}
this.getTarget = function(e) { if (!e) return false; if (e.target) return e.target; if (e.srcElement) return e.srcElement; return false };
this.hasParent = function(e, id) { if (!e) return false; var el = e.target || e.srcElement || e || false; while (el && el.id != id) { el = el.parentNode || false } return el !== false };
function getZIndex() {
var dom = self.win;
if ("zIndex" in dom) return dom.zIndex();
while (dom.length > 0) {
if (dom[0].nodeType == 9) return false;
var zi = dom.css("zIndex");
if (!isNaN(zi) && zi !== 0) return parseInt(zi);
dom = dom.parent()
}
return false
}
var _convertBorderWidth = { thin: 1, medium: 3, thick: 5 };
function getWidthToPixel(dom, prop, chkheight) { var wd = dom.css(prop); var px = parseFloat(wd); if (isNaN(px)) { px = _convertBorderWidth[wd] || 0; var brd = px == 3 ? chkheight ? self.win.outerHeight() - self.win.innerHeight() : self.win.outerWidth() - self.win.innerWidth() : 1; if (self.isie8 && px) px += 1; return brd ? px : 0 } return px }
this.getDocumentScrollOffset = function() { return { top: _win.pageYOffset || _doc.documentElement.scrollTop, left: _win.pageXOffset || _doc.documentElement.scrollLeft } };
this.getOffset = function() {
if (self.isfixed) {
var ofs = self.win.offset();
var scrl = self.getDocumentScrollOffset();
ofs.top -= scrl.top;
ofs.left -= scrl.left;
return ofs
}
var ww = self.win.offset();
if (!self.viewport) return ww;
var vp = self.viewport.offset();
return { top: ww.top - vp.top, left: ww.left - vp.left }
};
this.updateScrollBar = function(len) {
var pos, off;
if (self.ishwscroll) { self.rail.css({ height: self.win.innerHeight() - (opt.railpadding.top + opt.railpadding.bottom) }); if (self.railh) self.railh.css({ width: self.win.innerWidth() - (opt.railpadding.left + opt.railpadding.right) }) } else {
var wpos = self.getOffset();
pos = { top: wpos.top, left: wpos.left - (opt.railpadding.left + opt.railpadding.right) };
pos.top += getWidthToPixel(self.win, "border-top-width", true);
pos.left += self.rail.align ? self.win.outerWidth() - getWidthToPixel(self.win, "border-right-width") - self.rail.width : getWidthToPixel(self.win, "border-left-width");
off = opt.railoffset;
if (off) { if (off.top) pos.top += off.top; if (off.left) pos.left += off.left }
if (!self.railslocked) self.rail.css({ top: pos.top, left: pos.left, height: (len ? len.h : self.win.innerHeight()) - (opt.railpadding.top + opt.railpadding.bottom) });
if (self.zoom) { self.zoom.css({ top: pos.top + 1, left: self.rail.align == 1 ? pos.left - 20 : pos.left + self.rail.width + 4 }) }
if (self.railh && !self.railslocked) {
pos = { top: wpos.top, left: wpos.left };
off = opt.railhoffset;
if (off) { if (off.top) pos.top += off.top; if (off.left) pos.left += off.left }
var y = self.railh.align ? pos.top + getWidthToPixel(self.win, "border-top-width", true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, "border-top-width", true);
var x = pos.left + getWidthToPixel(self.win, "border-left-width");
self.railh.css({ top: y - (opt.railpadding.top + opt.railpadding.bottom), left: x, width: self.railh.width })
}
}
};
this.doRailClick = function(e, dbl, hr) {
var fn, pg, cur, pos;
if (self.railslocked) return;
self.cancelEvent(e);
if (!("pageY" in e)) {
e.pageX = e.clientX + _doc.documentElement.scrollLeft;
e.pageY = e.clientY + _doc.documentElement.scrollTop
}
if (dbl) {
fn = hr ? self.doScrollLeft : self.doScrollTop;
cur = hr ? (e.pageX - self.railh.offset().left - self.cursorwidth / 2) * self.scrollratio.x : (e.pageY - self.rail.offset().top - self.cursorheight / 2) * self.scrollratio.y;
self.unsynched("relativexy");
fn(cur | 0)
} else {
fn = hr ? self.doScrollLeftBy : self.doScrollBy;
cur = hr ? self.scroll.x : self.scroll.y;
pos = hr ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
pg = hr ? self.view.w : self.view.h;
fn(cur >= pos ? pg : -pg)
}
};
self.newscrolly = self.newscrollx = 0;
self.hasanimationframe = "requestAnimationFrame" in _win;
self.hascancelanimationframe = "cancelAnimationFrame" in _win;
self.hasborderbox = false;
this.init = function() {
self.saved.css = [];
if (cap.isoperamini) return true;
if (cap.isandroid && !("hidden" in _doc)) return true;
opt.emulatetouch = opt.emulatetouch || opt.touchbehavior;
self.hasborderbox = _win.getComputedStyle && _win.getComputedStyle(_doc.body)["box-sizing"] === "border-box";
var _scrollyhidden = { "overflow-y": "hidden" };
if (cap.isie11 || cap.isie10) _scrollyhidden["-ms-overflow-style"] = "none";
if (self.ishwscroll) { this.doc.css(cap.transitionstyle, cap.prefixstyle + "transform 0ms ease-out"); if (cap.transitionend) self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false) }
self.zindex = "auto";
if (!self.ispage && opt.zindex == "auto") { self.zindex = getZIndex() || "auto" } else { self.zindex = opt.zindex }
if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) { globalmaxzindex = self.zindex }
if (self.isie && self.zindex === 0 && opt.zindex == "auto") { self.zindex = "auto" }
if (!self.ispage || !cap.isieold) {
var cont = self.docscroll;
if (self.ispage) cont = self.haswrapper ? self.win : self.doc;
self.css(cont, _scrollyhidden);
if (self.ispage && (cap.isie11 || cap.isie)) { self.css($("html"), _scrollyhidden) }
if (cap.isios && !self.ispage && !self.haswrapper) self.css($body, { "-webkit-overflow-scrolling": "touch" });
var cursor = $(_doc.createElement("div"));
cursor.css({ position: "relative", top: 0, height: 0, "background-color": opt.cursorcolor, border: opt.cursorborder, "background-clip": "padding-box", "-webkit-border-radius": opt.cursorborderradius, "-moz-border-radius": opt.cursorborderradius, "border-radius": opt.cursorborderradius });
cursor.addClass("axscroll-cursors");
self.cursor = cursor;
var rail = $(_doc.createElement("div"));
rail.attr("id", self.id);
rail.addClass("axscroll-rails axscroll-rails-vr");
var differ = parseInt(opt.cursorwidthHover) - parseInt(opt.cursorwidth);
rail.hover(function() {
var leftDiffer = parseInt($(this).css("left")) - differ;
var zoom = $(this).next(".axscroll-zoom");
var zoomDiffer = parseInt(zoom.css("left")) - differ;
$(this).css({ width: opt.cursorwidthHover, left: leftDiffer });
zoom.css({ left: zoomDiffer })
}, function() {
var leftDiffer = parseInt($(this).css("left")) + differ;
var zoom = $(this).next(".axscroll-zoom");
var zoomDiffer = parseInt(zoom.css("left")) + differ;
$(this).css({ width: opt.cursorwidth, left: leftDiffer });
zoom.css({ left: zoomDiffer })
});
if (opt.scrollCLass) { rail.addClass(opt.scrollCLass) }
var v, a, kp = ["left", "right", "top", "bottom"];
for (var n in kp) {
a = kp[n];
v = opt.railpadding[a] || 0;
v && rail.css("padding-" + a, v + "px")
}
rail.append(cursor);
rail.width = Math.max(parseFloat(opt.cursorwidth), cursor.outerWidth());
rail.css({ width: rail.width + "px", zIndex: self.zindex, background: opt.background, cursor: "default" });
rail.visibility = true;
rail.scrollable = true;
rail.align = opt.railalign == "left" ? 0 : 1;
self.rail = rail;
self.rail.drag = false;
var zoom = false;
if (opt.boxzoom && !self.ispage && !cap.isieold) {
zoom = _doc.createElement("div");
self.bind(zoom, "click", self.doZoom);
self.bind(zoom, "mouseenter", function() { self.zoom.css("opacity", opt.cursoropacitymax) });
self.bind(zoom, "mouseleave", function() { self.zoom.css("opacity", opt.cursoropacitymin) });
self.zoom = $(zoom);
self.zoom.css({ cursor: "pointer", zIndex: self.zindex, backgroundImage: "", height: 18, width: 18, backgroundPosition: "0 0" }).empty().prepend(svgExpand).addClass("axscroll-zoom");
if (opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
if (cap.cantouch && opt.gesturezoom) {
self.ongesturezoom = function(e) { if (e.scale > 1.5) self.doZoomIn(e); if (e.scale < .8) self.doZoomOut(e); return self.cancelEvent(e) };
self.bind(self.win, "gestureend", self.ongesturezoom)
}
}
self.railh = false;
var railh;
if (opt.horizrailenabled) {
self.css(cont, { overflowX: "hidden" });
cursor = $(_doc.createElement("div"));
cursor.css({ position: "absolute", top: 0, height: opt.cursorwidth, width: 0, backgroundColor: opt.cursorcolor, border: opt.cursorborder, backgroundClip: "padding-box", "-webkit-border-radius": opt.cursorborderradius, "-moz-border-radius": opt.cursorborderradius, "border-radius": opt.cursorborderradius });
cursor.hover(function() { $(this).css("background-color", opt.cursorcolorHover) }, function() { $(this).css("background-color", opt.cursorcolor) });
if (cap.isieold) cursor.css("overflow", "hidden");
cursor.addClass("axscroll-cursors");
self.cursorh = cursor;
railh = $(_doc.createElement("div"));
railh.attr("id", self.id + "-hr");
railh.addClass("axscroll-rails axscroll-rails-hr");
var differ = parseInt(opt.cursorwidthHover) - parseInt(opt.cursorwidth);
railh.hover(function() {
var topDiffer = parseInt($(this).css("top")) - differ;
$(this).css({ height: opt.cursorwidthHover, top: topDiffer });
$(this).find("div").css({ height: opt.cursorwidthHover })
}, function() {
var topDiffer = parseInt($(this).css("top")) + differ;
$(this).css({ height: opt.cursorwidth, top: topDiffer });
$(this).find("div").css({ height: opt.cursorwidth })
});
if (opt.scrollCLass) { railh.addClass(opt.scrollCLass) }
railh.height = Math.max(parseFloat(opt.cursorwidth), cursor.outerHeight());
railh.css({ height: railh.height + "px", zIndex: self.zindex, background: opt.background });
railh.append(cursor);
railh.visibility = true;
railh.scrollable = true;
railh.align = opt.railvalign == "top" ? 0 : 1;
self.railh = railh;
self.railh.drag = false
}
if (self.ispage) {
rail.css({ position: "fixed", top: 0, height: "100%" });
rail.css(rail.align ? { right: 0 } : { left: 0 });
self.body.append(rail);
if (self.railh) {
railh.css({ position: "fixed", left: 0, width: "100%" });
railh.css(railh.align ? { bottom: 0 } : { top: 0 });
self.body.append(railh)
}
} else {
if (self.ishwscroll) {
if (self.win.css("position") == "static") self.css(self.win, { position: "relative" });
var bd = self.win[0].nodeName == "HTML" ? self.body : self.win;
$(bd).scrollTop(0).scrollLeft(0);
if (self.zoom) {
self.zoom.css({ position: "absolute", top: 1, right: 0, "margin-right": rail.width + 4 });
bd.append(self.zoom)
}
rail.css({ position: "absolute", top: 0 });
rail.css(rail.align ? { right: 0 } : { left: 0 });
bd.append(rail);
if (railh) {
railh.css({ position: "absolute", left: 0, bottom: 0 });
railh.css(railh.align ? { bottom: 0 } : { top: 0 });
bd.append(railh)
}
} else {
self.isfixed = self.win.css("position") == "fixed";
var rlpos = self.isfixed ? "fixed" : "absolute";
if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
if (self.viewport) { self.body = self.viewport; if (!/fixed|absolute/.test(self.viewport.css("position"))) self.css(self.viewport, { position: "relative" }) }
rail.css({ position: rlpos });
if (self.zoom) self.zoom.css({ position: rlpos });
self.updateScrollBar();
self.body.append(rail);
if (self.zoom) self.body.append(self.zoom);
if (self.railh) {
railh.css({ position: rlpos });
self.body.append(railh)
}
}
if (cap.isios) self.css(self.win, { "-webkit-tap-highlight-color": "rgba(0,0,0,0)", "-webkit-touch-callout": "none" });
if (opt.disableoutline) { if (cap.isie) self.win.attr("hideFocus", "true"); if (cap.iswebkit) self.win.css("outline", "none") }
}
if (opt.autohidemode === false) {
self.autohidedom = false;
self.rail.css({ opacity: opt.cursoropacitymax });
if (self.railh) self.railh.css({ opacity: opt.cursoropacitymax })
} else if (opt.autohidemode === true || opt.autohidemode === "leave") { self.autohidedom = $().add(self.rail); if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor); if (self.railh) self.autohidedom = self.autohidedom.add(self.railh); if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh) } else if (opt.autohidemode == "scroll") { self.autohidedom = $().add(self.rail); if (self.railh) self.autohidedom = self.autohidedom.add(self.railh) } else if (opt.autohidemode == "cursor") { self.autohidedom = $().add(self.cursor); if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh) } else if (opt.autohidemode == "hidden") {
self.autohidedom = false;
self.hide();
self.railslocked = false
}
if (cap.cantouch || self.istouchcapable || opt.emulatetouch || cap.hasmstouch) {
self.scrollmom = new ScrollMomentumClass2D(self);
var delayedclick = null;
self.ontouchstart = function(e) {
if (self.locked) return false;
if (e.pointerType && (e.pointerType === "mouse" || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false;
self.hasmoving = false;
if (self.scrollmom.timer) {
self.triggerScrollEnd();
self.scrollmom.stop()
}
if (!self.railslocked) {
var tg = self.getTarget(e);
if (tg) { var skp = /INPUT/i.test(tg.nodeName) && /range/i.test(tg.type); if (skp) return self.stopPropagation(e) }
var ismouse = e.type === "mousedown";
if (!("clientX" in e) && "changedTouches" in e) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY
}
if (self.forcescreen) {
var le = e;
e = { original: e.original ? e.original : e };
e.clientX = le.screenX;
e.clientY = le.screenY
}
self.rail.drag = { x: e.clientX, y: e.clientY, sx: self.scroll.x, sy: self.scroll.y, st: self.getScrollTop(), sl: self.getScrollLeft(), pt: 2, dl: false, tg: tg };
if (self.ispage || !opt.directionlockdeadzone) { self.rail.drag.dl = "f" } else {
var view = { w: $window.width(), h: $window.height() };
var page = self.getContentSize();
var maxh = page.h - view.h;
var maxw = page.w - view.w;
if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = maxh > 0 ? "v" : false;
else if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = maxw > 0 ? "h" : false;
else self.rail.drag.ck = false
}
if (opt.emulatetouch && self.isiframe && cap.isie) {
var wp = self.win.position();
self.rail.drag.x += wp.left;
self.rail.drag.y += wp.top
}
self.hasmoving = false;
self.lastmouseup = false;
self.scrollmom.reset(e.clientX, e.clientY);
if (tg && ismouse) {
var ip = /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName);
if (!ip) {
if (cap.hasmousecapture) tg.setCapture();
if (opt.emulatetouch) {
if (tg.onclick && !(tg._onclick || false)) {
tg._onclick = tg.onclick;
tg.onclick = function(e) {
if (self.hasmoving) return false;
tg._onclick.call(this, e)
}
}
return self.cancelEvent(e)
}
return self.stopPropagation(e)
}
if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr("type"))) { self.preventclick = { tg: tg, click: false } }
}
}
};
self.ontouchend = function(e) {
if (!self.rail.drag) return true;
if (self.rail.drag.pt == 2) {
if (e.pointerType && (e.pointerType === "mouse" || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false;
self.rail.drag = false;
var ismouse = e.type === "mouseup";
if (self.hasmoving) {
self.scrollmom.doMomentum();
self.lastmouseup = true;
self.hideCursor();
if (cap.hasmousecapture) _doc.releaseCapture();
if (ismouse) return self.cancelEvent(e)
}
} else if (self.rail.drag.pt == 1) { return self.onmouseup(e) }
};
var moveneedoffset = opt.emulatetouch && self.isiframe && !cap.hasmousecapture;
var locktollerance = opt.directionlockdeadzone * .3 | 0;
self.ontouchmove = function(e, byiframe) {
if (!self.rail.drag) return true;
if (e.targetTouches && opt.preventmultitouchscrolling) { if (e.targetTouches.length > 1) return true }
if (e.pointerType && (e.pointerType === "mouse" || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return true;
if (self.rail.drag.pt == 2) {
if ("changedTouches" in e) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY
}
var ofy, ofx;
ofx = ofy = 0;
if (moveneedoffset && !byiframe) {
var wp = self.win.position();
ofx = -wp.left;
ofy = -wp.top
}
var fy = e.clientY + ofy;
var my = fy - self.rail.drag.y;
var fx = e.clientX + ofx;
var mx = fx - self.rail.drag.x;
var ny = self.rail.drag.st - my;
if (self.ishwscroll && opt.bouncescroll) { if (ny < 0) { ny = Math.round(ny / 2) } else if (ny > self.page.maxh) { ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2) } } else {
if (ny < 0) {
ny = 0;
fy = 0
} else if (ny > self.page.maxh) {
ny = self.page.maxh;
fy = 0
}
if (fy === 0 && !self.hasmoving) { if (!self.ispage) self.rail.drag = false; return true }
}
var nx = self.getScrollLeft();
if (self.railh && self.railh.scrollable) {
nx = self.isrtlmode ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
if (self.ishwscroll && opt.bouncescroll) { if (nx < 0) { nx = Math.round(nx / 2) } else if (nx > self.page.maxw) { nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2) } } else {
if (nx < 0) {
nx = 0;
fx = 0
}
if (nx > self.page.maxw) {
nx = self.page.maxw;
fx = 0
}
}
}
if (!self.hasmoving) {
if (self.rail.drag.y === e.clientY && self.rail.drag.x === e.clientX) return self.cancelEvent(e);
var ay = Math.abs(my);
var ax = Math.abs(mx);
var dz = opt.directionlockdeadzone;
if (!self.rail.drag.ck) {
if (ay > dz && ax > dz) self.rail.drag.dl = "f";
else if (ay > dz) self.rail.drag.dl = ax > locktollerance ? "f" : "v";
else if (ax > dz) self.rail.drag.dl = ay > locktollerance ? "f" : "h"
} else if (self.rail.drag.ck == "v") { if (ax > dz && ay <= locktollerance) { self.rail.drag = false } else if (ay > dz) self.rail.drag.dl = "v" } else if (self.rail.drag.ck == "h") { if (ay > dz && ax <= locktollerance) { self.rail.drag = false } else if (ax > dz) self.rail.drag.dl = "h" }
if (!self.rail.drag.dl) return self.cancelEvent(e);
self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);
self.hasmoving = true
}
if (self.preventclick && !self.preventclick.click) {
self.preventclick.click = self.preventclick.tg.onclick || false;
self.preventclick.tg.onclick = self.onpreventclick
}
if (self.rail.drag.dl) {
if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
else if (self.rail.drag.dl == "h") ny = self.rail.drag.st
}
self.synched("touchmove", function() {
if (self.rail.drag && self.rail.drag.pt == 2) {
if (self.prepareTransition) self.resetTransition();
if (self.rail.scrollable) self.setScrollTop(ny);
self.scrollmom.update(fx, fy);
if (self.railh && self.railh.scrollable) {
self.setScrollLeft(nx);
self.showCursor(ny, nx)
} else { self.showCursor(ny) }
if (cap.isie10) _doc.selection.clear()
}
});
return self.cancelEvent(e)
} else if (self.rail.drag.pt == 1) { return self.onmousemove(e) }
};
self.ontouchstartCursor = function(e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 3) return;
if (self.locked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = { x: e.touches[0].clientX, y: e.touches[0].clientY, sx: self.scroll.x, sy: self.scroll.y, pt: 3, hr: !!hronly };
var tg = self.getTarget(e);
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved.csspointerevents = self.doc.css("pointer-events");
self.css(self.doc, { "pointer-events": "none" })
}
return self.cancelEvent(e)
};
self.ontouchendCursor = function(e) {
if (self.rail.drag) {
if (cap.hasmousecapture) _doc.releaseCapture();
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
if (self.rail.drag.pt != 3) return;
self.rail.drag = false;
return self.cancelEvent(e)
}
};
self.ontouchmoveCursor = function(e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 3) return;
self.cursorfreezed = true;
if (self.rail.drag.hr) { self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x); if (self.scroll.x < 0) self.scroll.x = 0; var mw = self.scrollvaluemaxw; if (self.scroll.x > mw) self.scroll.x = mw } else { self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y); if (self.scroll.y < 0) self.scroll.y = 0; var my = self.scrollvaluemax; if (self.scroll.y > my) self.scroll.y = my }
self.synched("touchmove", function() {
if (self.rail.drag && self.rail.drag.pt == 3) {
self.showCursor();
if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), opt.cursordragspeed);
else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), opt.cursordragspeed)
}
});
return self.cancelEvent(e)
}
}
}
self.onmousedown = function(e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 1) return;
if (self.railslocked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = { x: e.clientX, y: e.clientY, sx: self.scroll.x, sy: self.scroll.y, pt: 1, hr: hronly || false };
var tg = self.getTarget(e);
if (cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved.csspointerevents = self.doc.css("pointer-events");
self.css(self.doc, { "pointer-events": "none" })
}
self.hasmoving = false;
return self.cancelEvent(e)
};
self.onmouseup = function(e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 1) return true;
if (cap.hasmousecapture) _doc.releaseCapture();
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
self.rail.drag = false;
self.cursorfreezed = false;
if (self.hasmoving) self.triggerScrollEnd();
return self.cancelEvent(e)
}
};
self.onmousemove = function(e) {
if (self.rail.drag) {
if (self.rail.drag.pt !== 1) return;
if (cap.ischrome && e.which === 0) return self.onmouseup(e);
self.cursorfreezed = true;
if (!self.hasmoving) self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);
self.hasmoving = true;
if (self.rail.drag.hr) { self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x); if (self.scroll.x < 0) self.scroll.x = 0; var mw = self.scrollvaluemaxw; if (self.scroll.x > mw) self.scroll.x = mw } else { self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y); if (self.scroll.y < 0) self.scroll.y = 0; var my = self.scrollvaluemax; if (self.scroll.y > my) self.scroll.y = my }
self.synched("mousemove", function() { if (self.cursorfreezed) { self.showCursor(); if (self.rail.drag.hr) { self.scrollLeft(Math.round(self.scroll.x * self.scrollratio.x)) } else { self.scrollTop(Math.round(self.scroll.y * self.scrollratio.y)) } } });
return self.cancelEvent(e)
} else { self.checkarea = 0 }
};
if (cap.cantouch || opt.emulatetouch) {
self.onpreventclick = function(e) {
if (self.preventclick) {
self.preventclick.tg.onclick = self.preventclick.click;
self.preventclick = false;
return self.cancelEvent(e)
}
};
self.onclick = cap.isios ? false : function(e) { if (self.lastmouseup) { self.lastmouseup = false; return self.cancelEvent(e) } else { return true } };
if (opt.grabcursorenabled && cap.cursorgrabvalue) {
self.css(self.ispage ? self.doc : self.win, { cursor: cap.cursorgrabvalue });
self.css(self.rail, { cursor: cap.cursorgrabvalue })
}
} else {
var checkSelectionScroll = function(e) {
if (!self.selectiondrag) return;
if (e) {
var ww = self.win.outerHeight();
var df = e.pageY - self.selectiondrag.top;
if (df > 0 && df < ww) df = 0;
if (df >= ww) df -= ww;
self.selectiondrag.df = df
}
if (self.selectiondrag.df === 0) return;
var rt = -(self.selectiondrag.df * 2 / 6) | 0;
self.doScrollBy(rt);
self.debounced("doselectionscroll", function() { checkSelectionScroll() }, 50)
};
if ("getSelection" in _doc) { self.hasTextSelected = function() { return _doc.getSelection().rangeCount > 0 } } else if ("selection" in _doc) { self.hasTextSelected = function() { return _doc.selection.type != "None" } } else { self.hasTextSelected = function() { return false } }
self.onselectionstart = function(e) {
if (self.ispage) return;
self.selectiondrag = self.win.offset()
};
self.onselectionend = function(e) { self.selectiondrag = false };
self.onselectiondrag = function(e) { if (!self.selectiondrag) return; if (self.hasTextSelected()) self.debounced("selectionscroll", function() { checkSelectionScroll(e) }, 250) }
}
if (cap.hasw3ctouch) {
self.css(self.ispage ? $("html") : self.win, { "touch-action": "none" });
self.css(self.rail, { "touch-action": "none" });
self.css(self.cursor, { "touch-action": "none" });
self.bind(self.win, "pointerdown", self.ontouchstart);
self.bind(_doc, "pointerup", self.ontouchend);
self.delegate(_doc, "pointermove", self.ontouchmove)
} else if (cap.hasmstouch) {
self.css(self.ispage ? $("html") : self.win, { "-ms-touch-action": "none" });
self.css(self.rail, { "-ms-touch-action": "none" });
self.css(self.cursor, { "-ms-touch-action": "none" });
self.bind(self.win, "MSPointerDown", self.ontouchstart);
self.bind(_doc, "MSPointerUp", self.ontouchend);
self.delegate(_doc, "MSPointerMove", self.ontouchmove);
self.bind(self.cursor, "MSGestureHold", function(e) { e.preventDefault() });
self.bind(self.cursor, "contextmenu", function(e) { e.preventDefault() })
} else if (cap.cantouch) {
self.bind(self.win, "touchstart", self.ontouchstart, false, true);
self.bind(_doc, "touchend", self.ontouchend, false, true);
self.bind(_doc, "touchcancel", self.ontouchend, false, true);
self.delegate(_doc, "touchmove", self.ontouchmove, false, true)
}
if (opt.emulatetouch) {
self.bind(self.win, "mousedown", self.ontouchstart, false, true);
self.bind(_doc, "mouseup", self.ontouchend, false, true);
self.bind(_doc, "mousemove", self.ontouchmove, false, true)
}
if (opt.cursordragontouch || !cap.cantouch && !opt.emulatetouch) {
self.rail.css({ cursor: "default" });
self.railh && self.railh.css({ cursor: "default" });
self.jqbind(self.rail, "mouseenter", function() {
if (!self.ispage && !self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true
});
self.jqbind(self.rail, "mouseleave", function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor() });
if (opt.sensitiverail) {
self.bind(self.rail, "click", function(e) { self.doRailClick(e, false, false) });
self.bind(self.rail, "dblclick", function(e) { self.doRailClick(e, true, false) });
self.bind(self.cursor, "click", function(e) { self.cancelEvent(e) });
self.bind(self.cursor, "dblclick", function(e) { self.cancelEvent(e) })
}
if (self.railh) {
self.jqbind(self.railh, "mouseenter", function() {
if (!self.ispage && !self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true
});
self.jqbind(self.railh, "mouseleave", function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor() });
if (opt.sensitiverail) {
self.bind(self.railh, "click", function(e) { self.doRailClick(e, false, true) });
self.bind(self.railh, "dblclick", function(e) { self.doRailClick(e, true, true) });
self.bind(self.cursorh, "click", function(e) { self.cancelEvent(e) });
self.bind(self.cursorh, "dblclick", function(e) { self.cancelEvent(e) })
}
}
}
if (opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) {
self.bind(self.cursor, "touchstart", self.ontouchstartCursor);
self.bind(self.cursor, "touchmove", self.ontouchmoveCursor);
self.bind(self.cursor, "touchend", self.ontouchendCursor);
self.cursorh && self.bind(self.cursorh, "touchstart", function(e) { self.ontouchstartCursor(e, true) });
self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor);
self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor)
}
if (!opt.emulatetouch && !cap.isandroid && !cap.isios) {
self.bind(cap.hasmousecapture ? self.win : _doc, "mouseup", self.onmouseup);
self.bind(_doc, "mousemove", self.onmousemove);
if (self.onclick) self.bind(_doc, "click", self.onclick);
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mouseup", self.onmouseup);
if (self.railh) {
self.bind(self.cursorh, "mousedown", function(e) { self.onmousedown(e, true) });
self.bind(self.cursorh, "mouseup", self.onmouseup)
}
if (!self.ispage && opt.enablescrollonselection) {
self.bind(self.win[0], "mousedown", self.onselectionstart);
self.bind(_doc, "mouseup", self.onselectionend);
self.bind(self.cursor, "mouseup", self.onselectionend);
if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
self.bind(_doc, "mousemove", self.onselectiondrag)
}
if (self.zoom) {
self.jqbind(self.zoom, "mouseenter", function() {
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true
});
self.jqbind(self.zoom, "mouseleave", function() { self.rail.active = false; if (!self.rail.drag) self.hideCursor() })
}
} else {
self.bind(cap.hasmousecapture ? self.win : _doc, "mouseup", self.ontouchend);
if (self.onclick) self.bind(_doc, "click", self.onclick);
if (opt.cursordragontouch) {
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mouseup", self.onmouseup);
self.cursorh && self.bind(self.cursorh, "mousedown", function(e) { self.onmousedown(e, true) });
self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup)
} else {
self.bind(self.rail, "mousedown", function(e) { e.preventDefault() });
self.railh && self.bind(self.railh, "mousedown", function(e) { e.preventDefault() })
}
}
if (opt.enablemousewheel) {
if (!self.isiframe) self.mousewheel(cap.isie && self.ispage ? _doc : self.win, self.onmousewheel);
self.mousewheel(self.rail, self.onmousewheel);
if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr)
}
if (!self.ispage && !cap.cantouch && !/HTML|^BODY/.test(self.win[0].nodeName)) {
if (!self.win.attr("tabindex")) self.win.attr({ tabindex: ++tabindexcounter });
self.bind(self.win, "focus", function(e) {
domfocus = self.getTarget(e).id || self.getTarget(e) || false;
self.hasfocus = true;
if (self.canshowonmouseevent) self.noticeCursor()
});
self.bind(self.win, "blur", function(e) {
domfocus = false;
self.hasfocus = false
});
self.bind(self.win, "mouseenter", function(e) {
mousefocus = self.getTarget(e).id || self.getTarget(e) || false;
self.hasmousefocus = true;
if (self.canshowonmouseevent) self.noticeCursor()
});
self.bind(self.win, "mouseleave", function(e) {
mousefocus = false;
self.hasmousefocus = false;
if (!self.rail.drag) self.hideCursor()
})
}
self.onkeypress = function(e) {
if (self.railslocked && self.page.maxh === 0) return true;
e = e || _win.event;
var tg = self.getTarget(e);
if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { var tp = tg.getAttribute("type") || tg.type || false; if (!tp || !/submit|button|cancel/i.tp) return true }
if ($(tg).attr("contenteditable")) return true;
if (self.hasfocus || self.hasmousefocus && !domfocus || self.ispage && !domfocus && !mousefocus) {
var key = e.keyCode;
if (self.railslocked && key != 27) return self.cancelEvent(e);
var ctrl = e.ctrlKey || false;
var shift = e.shiftKey || false;
var ret = false;
switch (key) {
case 38:
case 63233:
self.doScrollBy(24 * 3);
ret = true;
break;
case 40:
case 63235:
self.doScrollBy(-24 * 3);
ret = true;
break;
case 37:
case 63232:
if (self.railh) {
ctrl ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3);
ret = true
}
break;
case 39:
case 63234:
if (self.railh) {
ctrl ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3);
ret = true
}
break;
case 33:
case 63276:
self.doScrollBy(self.view.h);
ret = true;
break;
case 34:
case 63277:
self.doScrollBy(-self.view.h);
ret = true;
break;
case 36:
case 63273:
self.railh && ctrl ? self.doScrollPos(0, 0) : self.doScrollTo(0);
ret = true;
break;
case 35:
case 63275:
self.railh && ctrl ? self.doScrollPos(self.page.maxw, self.page.maxh) : self.doScrollTo(self.page.maxh);
ret = true;
break;
case 32:
if (opt.spacebarenabled) {
shift ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);
ret = true
}
break;
case 27:
if (self.zoomactive) {
self.doZoom();
ret = true
}
break
}
if (ret) return self.cancelEvent(e)
}
};
if (opt.enablekeyboard) self.bind(_doc, cap.isopera && !cap.isopera12 ? "keypress" : "keydown", self.onkeypress);
self.bind(_doc, "keydown", function(e) { var ctrl = e.ctrlKey || false; if (ctrl) self.wheelprevented = true });
self.bind(_doc, "keyup", function(e) { var ctrl = e.ctrlKey || false; if (!ctrl) self.wheelprevented = false });
self.bind(_win, "blur", function(e) { self.wheelprevented = false });
self.bind(_win, "resize", self.onscreenresize);
self.bind(_win, "orientationchange", self.onscreenresize);
self.bind(_win, "load", self.lazyResize);
if (cap.ischrome && !self.ispage && !self.haswrapper) {
var tmp = self.win.attr("style");
var ww = parseFloat(self.win.css("width")) + 1;
self.win.css("width", ww);
self.synched("chromefix", function() { self.win.attr("style", tmp) })
}
self.onAttributeChange = function(e) { self.lazyResize(self.isieold ? 250 : 30) };
if (opt.enableobserver) {
if (!self.isie11 && ClsMutationObserver !== false) {
self.observerbody = new ClsMutationObserver(function(mutations) { mutations.forEach(function(mut) { if (mut.type == "attributes") { return $body.hasClass("modal-open") && $body.hasClass("modal-dialog") && !$.contains($(".modal-dialog")[0], self.doc[0]) ? self.hide() : self.show() } }); if (self.me.clientWidth != self.page.width || self.me.clientHeight != self.page.height) return self.lazyResize(30) });
self.observerbody.observe(_doc.body, { childList: true, subtree: true, characterData: false, attributes: true, attributeFilter: ["class"] })
}
if (!self.ispage && !self.haswrapper) {
var _dom = self.win[0];
if (ClsMutationObserver !== false) {
self.observer = new ClsMutationObserver(function(mutations) { mutations.forEach(self.onAttributeChange) });
self.observer.observe(_dom, { childList: true, characterData: false, attributes: true, subtree: false });
self.observerremover = new ClsMutationObserver(function(mutations) { mutations.forEach(function(mo) { if (mo.removedNodes.length > 0) { for (var dd in mo.removedNodes) { if (!!self && mo.removedNodes[dd] === _dom) return self.remove() } } }) });
self.observerremover.observe(_dom.parentNode, { childList: true, characterData: false, attributes: false, subtree: false })
} else {
self.bind(_dom, cap.isie && !cap.isie9 ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
if (cap.isie9) _dom.attachEvent("onpropertychange", self.onAttributeChange);
self.bind(_dom, "DOMNodeRemoved", function(e) { if (e.target === _dom) self.remove() })
}
}
}
if (!self.ispage && opt.boxzoom) self.bind(_win, "resize", self.resizeZoom);
if (self.istextarea) {
self.bind(self.win, "keydown", self.lazyResize);
self.bind(self.win, "mouseup", self.lazyResize)
}
self.lazyResize(30)
}
if (this.doc[0].nodeName == "IFRAME") {
var oniframeload = function() {
self.iframexd = false;
var doc;
try { doc = "contentDocument" in this ? this.contentDocument : this.contentWindow._doc; var a = doc.domain } catch (e) {
self.iframexd = true;
doc = false
}
if (self.iframexd) { if ("console" in _win) console.log("AxScroll error: policy restriced iframe"); return true }
self.forcescreen = true;
if (self.isiframe) {
self.iframe = { doc: $(doc), html: self.doc.contents().find("html")[0], body: self.doc.contents().find("body")[0] };
self.getContentSize = function() { return { w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth), h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight) } };
self.docscroll = $(self.iframe.body)
}
if (!cap.isios && opt.iframeautoresize && !self.isiframe) {
self.win.scrollTop(0);
self.doc.height("");
var hh = Math.max(doc.getElementsByTagName("html")[0].scrollHeight, doc.body.scrollHeight);
self.doc.height(hh)
}
self.lazyResize(30);
self.css($(self.iframe.body), _scrollyhidden);
if (cap.isios && self.haswrapper) { self.css($(doc.body), { "-webkit-transform": "translate3d(0,0,0)" }) }
if ("contentWindow" in this) { self.bind(this.contentWindow, "scroll", self.onscroll) } else { self.bind(doc, "scroll", self.onscroll) }
if (opt.enablemousewheel) { self.mousewheel(doc, self.onmousewheel) }
if (opt.enablekeyboard) self.bind(doc, cap.isopera ? "keypress" : "keydown", self.onkeypress);
if (cap.cantouch) {
self.bind(doc, "touchstart", self.ontouchstart);
self.bind(doc, "touchmove", self.ontouchmove)
} else if (opt.emulatetouch) {
self.bind(doc, "mousedown", self.ontouchstart);
self.bind(doc, "mousemove", function(e) { return self.ontouchmove(e, true) });
if (opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), { cursor: cap.cursorgrabvalue })
}
self.bind(doc, "mouseup", self.ontouchend);
if (self.zoom) { if (opt.dblclickzoom) self.bind(doc, "dblclick", self.doZoom); if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom) }
};
if (this.doc[0].readyState && this.doc[0].readyState === "complete") { setTimeout(function() { oniframeload.call(self.doc[0], false) }, 500) }
self.bind(this.doc, "load", oniframeload)
}
};
this.showCursor = function(py, px) {
if (self.cursortimeout) {
clearTimeout(self.cursortimeout);
self.cursortimeout = 0
}
if (!self.rail) return;
if (self.autohidedom) {
self.autohidedom.stop().css({ opacity: opt.cursoropacitymax });
self.cursoractive = true
}
if (!self.rail.drag || self.rail.drag.pt != 1) { if (py !== undefined && py !== false) { self.scroll.y = py / self.scrollratio.y | 0 } if (px !== undefined) { self.scroll.x = px / self.scrollratio.x | 0 } }
self.cursor.css({ height: self.cursorheight, top: self.scroll.y });
if (self.cursorh) {
var lx = self.hasreversehr ? self.scrollvaluemaxw - self.scroll.x : self.scroll.x;
self.cursorh.css({ width: self.cursorwidth, left: !self.rail.align && self.rail.visibility ? lx + self.rail.width : lx });
self.cursoractive = true
}
if (self.zoom) self.zoom.stop().css({ opacity: opt.cursoropacitymax })
};
this.hideCursor = function(tm) {
if (self.cursortimeout) return;
if (!self.rail) return;
if (!self.autohidedom) return;
if (self.hasmousefocus && opt.autohidemode === "leave") return;
self.cursortimeout = setTimeout(function() {
if (!self.rail.active || !self.showonmouseevent) {
self.autohidedom.stop().animate({ opacity: opt.cursoropacitymin });
if (self.zoom) self.zoom.stop().animate({ opacity: opt.cursoropacitymin });
self.cursoractive = false
}
self.cursortimeout = 0
}, tm || opt.hidecursordelay)
};
this.noticeCursor = function(tm, py, px) { self.showCursor(py, px); if (!self.rail.active) self.hideCursor(tm) };
this.getContentSize = self.ispage ? function() { return { w: Math.max(_doc.body.scrollWidth, _doc.documentElement.scrollWidth), h: Math.max(_doc.body.scrollHeight, _doc.documentElement.scrollHeight) } } : self.haswrapper ? function() { return { w: self.doc[0].offsetWidth, h: self.doc[0].offsetHeight } } : function() { return { w: self.docscroll[0].scrollWidth, h: self.docscroll[0].scrollHeight } };
this.onResize = function(e, page) {
if (!self || !self.win) return false;
var premaxh = self.page.maxh,
premaxw = self.page.maxw,
previewh = self.view.h,
previeww = self.view.w;
self.view = { w: self.ispage ? self.win.width() : self.win[0].clientWidth, h: self.ispage ? self.win.height() : self.win[0].clientHeight };
self.page = page ? page : self.getContentSize();
self.page.maxh = Math.max(0, self.page.h - self.view.h);
self.page.maxw = Math.max(0, self.page.w - self.view.w);
if (self.page.maxh == premaxh && self.page.maxw == premaxw && self.view.w == previeww && self.view.h == previewh) {
if (!self.ispage) {
var pos = self.win.offset();
if (self.lastposition) { var lst = self.lastposition; if (lst.top == pos.top && lst.left == pos.left) return self }
self.lastposition = pos
} else { return self }
}
if (self.page.maxh === 0) {
self.hideRail();
self.scrollvaluemax = 0;
self.scroll.y = 0;
self.scrollratio.y = 0;
self.cursorheight = 0;
self.setScrollTop(0);
if (self.rail) self.rail.scrollable = false
} else {
self.page.maxh -= opt.railpadding.top + opt.railpadding.bottom;
self.rail.scrollable = true
}
if (self.page.maxw === 0) {
self.hideRailHr();
self.scrollvaluemaxw = 0;
self.scroll.x = 0;
self.scrollratio.x = 0;
self.cursorwidth = 0;
self.setScrollLeft(0);
if (self.railh) { self.railh.scrollable = false }
} else { self.page.maxw -= opt.railpadding.left + opt.railpadding.right; if (self.railh) self.railh.scrollable = opt.horizrailenabled }
self.railslocked = self.locked || self.page.maxh === 0 && self.page.maxw === 0;
if (self.railslocked) { if (!self.ispage) self.updateScrollBar(self.view); return false }
if (!self.hidden) { if (!self.rail.visibility) self.showRail(); if (self.railh && !self.railh.visibility) self.showRailHr() }
if (self.istextarea && self.win.css("resize") && self.win.css("resize") != "none") self.view.h -= 20;
self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
self.cursorheight = opt.cursorfixedheight ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorheight);
self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
self.cursorwidth = opt.cursorfixedheight ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorwidth);
self.scrollvaluemax = self.view.h - self.cursorheight - (opt.railpadding.top + opt.railpadding.bottom);
if (!self.hasborderbox) self.scrollvaluemax -= self.cursor[0].offsetHeight - self.cursor[0].clientHeight;
if (self.railh) {
self.railh.width = self.page.maxh > 0 ? self.view.w - self.rail.width : self.view.w;
self.scrollvaluemaxw = self.railh.width - self.cursorwidth - (opt.railpadding.left + opt.railpadding.right)
}
if (!self.ispage) self.updateScrollBar(self.view);
self.scrollratio = { x: self.page.maxw / self.scrollvaluemaxw, y: self.page.maxh / self.scrollvaluemax };
var sy = self.getScrollTop();
if (sy > self.page.maxh) { self.doScrollTop(self.page.maxh) } else {
self.scroll.y = self.getScrollTop() / self.scrollratio.y | 0;
self.scroll.x = self.getScrollLeft() / self.scrollratio.x | 0;
if (self.cursoractive) self.noticeCursor()
}
if (self.scroll.y && self.getScrollTop() === 0) self.doScrollTo(self.scroll.y * self.scrollratio.y | 0);
return self
};
this.resize = self.onResize;
var hlazyresize = 0;
this.onscreenresize = function(e) {
clearTimeout(hlazyresize);
var hiderails = !self.ispage && !self.haswrapper;
if (hiderails) self.hideRails();
hlazyresize = setTimeout(function() {
if (self) {
if (hiderails) self.showRails();
self.resize()
}
hlazyresize = 0
}, 120)
};
this.lazyResize = function(tm) {
clearTimeout(hlazyresize);
tm = isNaN(tm) ? 240 : tm;
hlazyresize = setTimeout(function() {
self && self.resize();
hlazyresize = 0
}, tm);
return self
};
function _modernWheelEvent(dom, name, fn, bubble) {
self._bind(dom, name, function(e) {
e = e || _win.event;
var event = { original: e, target: e.target || e.srcElement, type: "wheel", deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1, deltaX: 0, deltaZ: 0, preventDefault: function() { e.preventDefault ? e.preventDefault() : e.returnValue = false; return false }, stopImmediatePropagation: function() { e.stopImmediatePropagation ? e.stopImmediatePropagation() : e.cancelBubble = true } };
if (name == "mousewheel") {
e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
!event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta)
} else { event.deltaY = e.detail }
return fn.call(dom, event)
}, bubble)
}
this.jqbind = function(dom, name, fn) {
self.events.push({ e: dom, n: name, f: fn, q: true });
$(dom).on(name, fn)
};
this.mousewheel = function(dom, fn, bubble) {
var el = "jquery" in dom ? dom[0] : dom;
if ("onwheel" in _doc.createElement("div")) { self._bind(el, "wheel", fn, bubble || false) } else {
var wname = _doc.onmousewheel !== undefined ? "mousewheel" : "DOMMouseScroll";
_modernWheelEvent(el, wname, fn, bubble || false);
if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false)
}
};
var passiveSupported = false;
if (cap.haseventlistener) {
try {
var options = Object.defineProperty({}, "passive", { get: function() { passiveSupported = !0 } });
_win.addEventListener("test", null, options)
} catch (err) {}
this.stopPropagation = function(e) {
if (!e) return false;
e = e.original ? e.original : e;
e.stopPropagation();
return false
};
this.cancelEvent = function(e) {
if (e.cancelable) e.preventDefault();
e.stopImmediatePropagation();
if (e.preventManipulation) e.preventManipulation();
return false
}
} else {
Event.prototype.preventDefault = function() { this.returnValue = false };
Event.prototype.stopPropagation = function() { this.cancelBubble = true };
_win.constructor.prototype.addEventListener = _doc.constructor.prototype.addEventListener = Element.prototype.addEventListener = function(type, listener, useCapture) { this.attachEvent("on" + type, listener) };
_win.constructor.prototype.removeEventListener = _doc.constructor.prototype.removeEventListener = Element.prototype.removeEventListener = function(type, listener, useCapture) { this.detachEvent("on" + type, listener) };
this.cancelEvent = function(e) {
e = e || _win.event;
if (e) {
e.cancelBubble = true;
e.cancel = true;
e.returnValue = false
}
return false
};
this.stopPropagation = function(e) { e = e || _win.event; if (e) e.cancelBubble = true; return false }
}
this.delegate = function(dom, name, fn, bubble, active) {
var de = delegatevents[name] || false;
if (!de) {
de = {
a: [],
l: [],
f: function(e) {
var lst = de.l,
l = lst.length - 1;
var r = false;
for (var a = l; a >= 0; a--) { r = lst[a].call(e.target, e); if (r === false) return false }
return r
}
};
self.bind(dom, name, de.f, bubble, active);
delegatevents[name] = de
}
if (self.ispage) {
de.a = [self.id].concat(de.a);
de.l = [fn].concat(de.l)
} else {
de.a.push(self.id);
de.l.push(fn)
}
};
this.undelegate = function(dom, name, fn, bubble, active) {
var de = delegatevents[name] || false;
if (de && de.l) {
for (var a = 0, l = de.l.length; a < l; a++) {
if (de.a[a] === self.id) {
de.a.splice(a);
de.l.splice(a);
if (de.a.length === 0) {
self._unbind(dom, name, de.l.f);
delegatevents[name] = null
}
}
}
}
};
this.bind = function(dom, name, fn, bubble, active) {
var el = "jquery" in dom ? dom[0] : dom;
self._bind(el, name, fn, bubble || false, active || false)
};
this._bind = function(el, name, fn, bubble, active) {
self.events.push({ e: el, n: name, f: fn, b: bubble, q: false });
passiveSupported && (active || el == window.document || el == window.document.body || el == window) ? el.addEventListener(name, fn, { passive: false, capture: bubble }) : el.addEventListener(name, fn, bubble || false)
};
this._unbind = function(el, name, fn, bub) {
if (delegatevents[name]) self.undelegate(el, name, fn, bub);
else el.removeEventListener(name, fn, bub)
};
this.unbindAll = function() {
for (var a = 0; a < self.events.length; a++) {
var r = self.events[a];
r.q ? r.e.unbind(r.n, r.f) : self._unbind(r.e, r.n, r.f, r.b)
}
};
this.showRails = function() { return self.showRail().showRailHr() };
this.showRail = function() {
if (self.page.maxh !== 0 && (self.ispage || self.win.css("display") != "none")) {
self.rail.visibility = true;
self.rail.css("display", "block")
}
return self
};
this.showRailHr = function() {
if (self.railh) {
if (self.page.maxw !== 0 && (self.ispage || self.win.css("display") != "none")) {
self.railh.visibility = true;
self.railh.css("display", "block")
}
}
return self
};
this.hideRails = function() { return self.hideRail().hideRailHr() };
this.hideRail = function() {
self.rail.visibility = false;
self.rail.css("display", "none");
return self
};
this.hideRailHr = function() {
if (self.railh) {
self.railh.visibility = false;
self.railh.css("display", "none")
}
return self
};
this.show = function() {
self.hidden = false;
self.railslocked = false;
return self.showRails()
};
this.hide = function() {
self.hidden = true;
self.railslocked = true;
return self.hideRails()
};
this.toggle = function() { return self.hidden ? self.show() : self.hide() };
this.remove = function() {
self.stop();
if (self.cursortimeout) clearTimeout(self.cursortimeout);
for (var n in self.delaylist)
if (self.delaylist[n]) clearAnimationFrame(self.delaylist[n].h);
self.doZoomOut();
self.unbindAll();
if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange);
if (self.observer !== false) self.observer.disconnect();
if (self.observerremover !== false) self.observerremover.disconnect();
if (self.observerbody !== false) self.observerbody.disconnect();
self.events = null;
if (self.cursor) { self.cursor.remove() }
if (self.cursorh) { self.cursorh.remove() }
if (self.rail) { self.rail.remove() }
if (self.railh) { self.railh.remove() }
if (self.zoom) { self.zoom.remove() }
for (var a = 0; a < self.saved.css.length; a++) {
var d = self.saved.css[a];
d[0].css(d[1], d[2] === undefined ? "" : d[2])
}
self.saved = false;
self.me.data("__axscroll", "");
var lst = $.axscroll;
lst.each(function(i) {
if (!this) return;
if (this.id === self.id) {
delete lst[i];
for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
lst.length--;
if (lst.length) delete lst[lst.length]
}
});
for (var i in self) {
self[i] = null;
delete self[i]
}
self = null
};
this.scrollstart = function(fn) { this.onscrollstart = fn; return self };
this.scrollend = function(fn) { this.onscrollend = fn; return self };
this.scrollcancel = function(fn) { this.onscrollcancel = fn; return self };
this.zoomin = function(fn) { this.onzoomin = fn; return self };
this.zoomout = function(fn) { this.onzoomout = fn; return self };
this.isScrollable = function(e) {
var dom = e.target ? e.target : e;
if (dom.nodeName == "OPTION") return true;
while (dom && dom.nodeType == 1 && dom !== this.me[0] && !/^BODY|HTML/.test(dom.nodeName)) {
var dd = $(dom);
var ov = dd.css("overflowY") || dd.css("overflowX") || dd.css("overflow") || "";
if (/scroll|auto/.test(ov)) return dom.clientHeight != dom.scrollHeight;
dom = dom.parentNode ? dom.parentNode : false
}
return false
};
this.getViewport = function(me) {
var dom = me && me.parentNode ? me.parentNode : false;
while (dom && dom.nodeType == 1 && !/^BODY|HTML/.test(dom.nodeName)) {
var dd = $(dom);
if (/fixed|absolute/.test(dd.css("position"))) return dd;
var ov = dd.css("overflowY") || dd.css("overflowX") || dd.css("overflow") || "";
if (/scroll|auto/.test(ov) && dom.clientHeight != dom.scrollHeight) return dd;
if (dd.getAxScroll().length > 0) return dd;
dom = dom.parentNode ? dom.parentNode : false
}
return false
};
this.triggerScrollStart = function(cx, cy, rx, ry, ms) {
if (self.onscrollstart) {
var info = { type: "scrollstart", current: { x: cx, y: cy }, request: { x: rx, y: ry }, end: { x: self.newscrollx, y: self.newscrolly }, speed: ms };
self.onscrollstart.call(self, info)
}
};
this.triggerScrollEnd = function() {
if (self.onscrollend) {
var px = self.getScrollLeft();
var py = self.getScrollTop();
var info = { type: "scrollend", current: { x: px, y: py }, end: { x: px, y: py } };
self.onscrollend.call(self, info)
}
};
var scrolldiry = 0,
scrolldirx = 0,
scrolltmr = 0,
scrollspd = 1;
function doScrollRelative(px, py, chkscroll, iswheel) {
if (!self.scrollrunning) {
self.newscrolly = self.getScrollTop();
self.newscrollx = self.getScrollLeft();
scrolltmr = now()
}
var gap = now() - scrolltmr;
scrolltmr = now();
if (gap > 350) { scrollspd = 1 } else { scrollspd += (2 - scrollspd) / 10 }
px = px * scrollspd | 0;
py = py * scrollspd | 0;
if (px) {
if (iswheel) { if (px < 0) { if (self.getScrollLeft() >= self.page.maxw) return true } else { if (self.getScrollLeft() <= 0) return true } }
var dx = px > 0 ? 1 : -1;
if (scrolldirx !== dx) {
if (self.scrollmom) self.scrollmom.stop();
self.newscrollx = self.getScrollLeft();
scrolldirx = dx
}
self.lastdeltax -= px
}
if (py) {
var chk = function() { var top = self.getScrollTop(); if (py < 0) { if (top >= self.page.maxh) return true } else { if (top <= 0) return true } }();
if (chk) {
if (opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) return true;
var ny = self.view.h >> 1;
if (self.newscrolly < -ny) {
self.newscrolly = -ny;
py = -1
} else if (self.newscrolly > self.page.maxh + ny) {
self.newscrolly = self.page.maxh + ny;
py = 1
} else py = 0
}
var dy = py > 0 ? 1 : -1;
if (scrolldiry !== dy) {
if (self.scrollmom) self.scrollmom.stop();
self.newscrolly = self.getScrollTop();
scrolldiry = dy
}
self.lastdeltay -= py
}
if (py || px) {
self.synched("relativexy", function() {
var dty = self.lastdeltay + self.newscrolly;
self.lastdeltay = 0;
var dtx = self.lastdeltax + self.newscrollx;
self.lastdeltax = 0;
if (!self.rail.drag) self.doScrollPos(dtx, dty)
})
}
}
var hasparentscrollingphase = false;
function execScrollWheel(e, hr, chkscroll) {
var px, py;
if (!chkscroll && hasparentscrollingphase) return true;
if (e.deltaMode === 0) {
px = -(e.deltaX * (opt.mousescrollstep / (18 * 3))) | 0;
py = -(e.deltaY * (opt.mousescrollstep / (18 * 3))) | 0
} else if (e.deltaMode === 1) {
px = -(e.deltaX * opt.mousescrollstep * 50 / 80) | 0;
py = -(e.deltaY * opt.mousescrollstep * 50 / 80) | 0
}
if (hr && opt.oneaxismousemode && px === 0 && py) {
px = py;
py = 0;
if (chkscroll) {
var hrend = px < 0 ? self.getScrollLeft() >= self.page.maxw : self.getScrollLeft() <= 0;
if (hrend) {
py = px;
px = 0
}
}
}
if (self.isrtlmode) px = -px;
var chk = doScrollRelative(px, py, chkscroll, true);
if (chk) { if (chkscroll) hasparentscrollingphase = true } else {
hasparentscrollingphase = false;
e.stopImmediatePropagation();
return e.preventDefault()
}
}
this.onmousewheel = function(e) {
if (self.wheelprevented || self.locked) return false;
if (self.railslocked) { self.debounced("checkunlock", self.resize, 250); return false }
if (self.rail.drag) return self.cancelEvent(e);
if (opt.oneaxismousemode === "auto" && e.deltaX !== 0) opt.oneaxismousemode = false;
if (opt.oneaxismousemode && e.deltaX === 0) { if (!self.rail.scrollable) { if (self.railh && self.railh.scrollable) { return self.onmousewheelhr(e) } else { return true } } }
var nw = now();
var chk = false;
if (opt.preservenativescrolling && self.checkarea + 600 < nw) {
self.nativescrollingarea = self.isScrollable(e);
chk = true
}
self.checkarea = nw;
if (self.nativescrollingarea) return true;
var ret = execScrollWheel(e, false, chk);
if (ret) self.checkarea = 0;
return ret
};
this.onmousewheelhr = function(e) {
if (self.wheelprevented) return;
if (self.railslocked || !self.railh.scrollable) return true;
if (self.rail.drag) return self.cancelEvent(e);
var nw = now();
var chk = false;
if (opt.preservenativescrolling && self.checkarea + 600 < nw) {
self.nativescrollingarea = self.isScrollable(e);
chk = true
}
self.checkarea = nw;
if (self.nativescrollingarea) return true;
if (self.railslocked) return self.cancelEvent(e);
return execScrollWheel(e, true, chk)
};
this.stop = function() {
self.cancelScroll();
if (self.scrollmon) self.scrollmon.stop();
self.cursorfreezed = false;
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
self.noticeCursor();
return self
};
this.getTransitionSpeed = function(dif) { return 80 + dif / 72 * opt.scrollspeed | 0 };
if (!opt.smoothscroll) {
this.doScrollLeft = function(x, spd) {
var y = self.getScrollTop();
self.doScrollPos(x, y, spd)
};
this.doScrollTop = function(y, spd) {
var x = self.getScrollLeft();
self.doScrollPos(x, y, spd)
};
this.doScrollPos = function(x, y, spd) {
var nx = x > self.page.maxw ? self.page.maxw : x;
if (nx < 0) nx = 0;
var ny = y > self.page.maxh ? self.page.maxh : y;
if (ny < 0) ny = 0;
self.synched("scroll", function() {
self.setScrollTop(ny);
self.setScrollLeft(nx)
})
};
this.cancelScroll = function() {}
} else if (self.ishwscroll && cap.hastransition && opt.usetransition && !!opt.smoothscroll) {
var lasttransitionstyle = "";
this.resetTransition = function() {
lasttransitionstyle = "";
self.doc.css(cap.prefixstyle + "transition-duration", "0ms")
};
this.prepareTransition = function(dif, istime) {
var ex = istime ? dif : self.getTransitionSpeed(dif);
var trans = ex + "ms";
if (lasttransitionstyle !== trans) {
lasttransitionstyle = trans;
self.doc.css(cap.prefixstyle + "transition-duration", trans)
}
return ex
};
this.doScrollLeft = function(x, spd) {
var y = self.scrollrunning ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd)
};
this.doScrollTop = function(y, spd) {
var x = self.scrollrunning ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd)
};
this.cursorupdate = {
running: false,
start: function() {
var m = this;
if (m.running) return;
m.running = true;
var loop = function() {
if (m.running) setAnimationFrame(loop);
self.showCursor(self.getScrollTop(), self.getScrollLeft());
self.notifyScrollEvent(self.win[0])
};
setAnimationFrame(loop)
},
stop: function() { this.running = false }
};
this.doScrollPos = function(x, y, spd) {
var py = self.getScrollTop();
var px = self.getScrollLeft();
if ((self.newscrolly - py) * (y - py) < 0 || (self.newscrollx - px) * (x - px) < 0) self.cancelScroll();
if (!opt.bouncescroll) {
if (y < 0) y = 0;
else if (y > self.page.maxh) y = self.page.maxh;
if (x < 0) x = 0;
else if (x > self.page.maxw) x = self.page.maxw
} else {
if (y < 0) y = y / 2 | 0;
else if (y > self.page.maxh) y = self.page.maxh + (y - self.page.maxh) / 2 | 0;
if (x < 0) x = x / 2 | 0;
else if (x > self.page.maxw) x = self.page.maxw + (x - self.page.maxw) / 2 | 0
}
if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
self.newscrolly = y;
self.newscrollx = x;
var top = self.getScrollTop();
var lft = self.getScrollLeft();
var dst = {};
dst.x = x - lft;
dst.y = y - top;
var dd = Math.sqrt(dst.x * dst.x + dst.y * dst.y) | 0;
var ms = self.prepareTransition(dd);
if (!self.scrollrunning) {
self.scrollrunning = true;
self.triggerScrollStart(lft, top, x, y, ms);
self.cursorupdate.start()
}
self.scrollendtrapped = true;
if (!cap.transitionend) {
if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms)
}
self.setScrollTop(self.newscrolly);
self.setScrollLeft(self.newscrollx)
};
this.cancelScroll = function() {
if (!self.scrollendtrapped) return true;
var py = self.getScrollTop();
var px = self.getScrollLeft();
self.scrollrunning = false;
if (!cap.transitionend) clearTimeout(cap.transitionend);
self.scrollendtrapped = false;
self.resetTransition();
self.setScrollTop(py);
if (self.railh) self.setScrollLeft(px);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
self.timerscroll = false;
self.cursorfreezed = false;
self.cursorupdate.stop();
self.showCursor(py, px);
return self
};
this.onScrollTransitionEnd = function() {
if (!self.scrollendtrapped) return;
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (py < 0) py = 0;
else if (py > self.page.maxh) py = self.page.maxh;
if (px < 0) px = 0;
else if (px > self.page.maxw) px = self.page.maxw;
if (py != self.newscrolly || px != self.newscrollx) return self.doScrollPos(px, py, opt.snapbackspeed);
if (self.scrollrunning) self.triggerScrollEnd();
self.scrollrunning = false;
self.scrollendtrapped = false;
self.resetTransition();
self.timerscroll = false;
self.setScrollTop(py);
if (self.railh) self.setScrollLeft(px);
self.cursorupdate.stop();
self.noticeCursor(false, py, px);
self.cursorfreezed = false
}
} else {
this.doScrollLeft = function(x, spd) {
var y = self.scrollrunning ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd)
};
this.doScrollTop = function(y, spd) {
var x = self.scrollrunning ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd)
};
this.doScrollPos = function(x, y, spd) {
var py = self.getScrollTop();
var px = self.getScrollLeft();
if ((self.newscrolly - py) * (y - py) < 0 || (self.newscrollx - px) * (x - px) < 0) self.cancelScroll();
var clipped = false;
if (!self.bouncescroll || !self.rail.visibility) {
if (y < 0) {
y = 0;
clipped = true
} else if (y > self.page.maxh) {
y = self.page.maxh;
clipped = true
}
}
if (!self.bouncescroll || !self.railh.visibility) {
if (x < 0) {
x = 0;
clipped = true
} else if (x > self.page.maxw) {
x = self.page.maxw;
clipped = true
}
}
if (self.scrollrunning && self.newscrolly === y && self.newscrollx === x) return true;
self.newscrolly = y;
self.newscrollx = x;
self.dst = {};
self.dst.x = x - px;
self.dst.y = y - py;
self.dst.px = px;
self.dst.py = py;
var dd = Math.sqrt(self.dst.x * self.dst.x + self.dst.y * self.dst.y) | 0;
var ms = self.getTransitionSpeed(dd);
self.bzscroll = {};
var p3 = clipped ? 1 : .58;
self.bzscroll.x = new BezierClass(px, self.newscrollx, ms, 0, 0, p3, 1);
self.bzscroll.y = new BezierClass(py, self.newscrolly, ms, 0, 0, p3, 1);
var loopid = now();
var loop = function() {
if (!self.scrollrunning) return;
var x = self.bzscroll.y.getPos();
self.setScrollLeft(self.bzscroll.x.getNow());
self.setScrollTop(self.bzscroll.y.getNow());
if (x <= 1) { self.timer = setAnimationFrame(loop) } else {
self.scrollrunning = false;
self.timer = 0;
self.triggerScrollEnd()
}
};
if (!self.scrollrunning) {
self.triggerScrollStart(px, py, x, y, ms);
self.scrollrunning = true;
self.timer = setAnimationFrame(loop)
}
};
this.cancelScroll = function() {
if (self.timer) clearAnimationFrame(self.timer);
self.timer = 0;
self.bzscroll = false;
self.scrollrunning = false;
return self
}
}
this.doScrollBy = function(stp, relative) { doScrollRelative(0, stp) };
this.doScrollLeftBy = function(stp, relative) { doScrollRelative(stp, 0) };
this.doScrollTo = function(pos, relative) {
var ny = relative ? Math.round(pos * self.scrollratio.y) : pos;
if (ny < 0) ny = 0;
else if (ny > self.page.maxh) ny = self.page.maxh;
self.cursorfreezed = false;
self.doScrollTop(pos)
};
this.checkContentSize = function() { var pg = self.getContentSize(); if (pg.h != self.page.h || pg.w != self.page.w) self.resize(false, pg) };
self.onscroll = function(e) {
if (self.rail.drag) return;
if (!self.cursorfreezed) {
self.synched("scroll", function() {
self.scroll.y = Math.round(self.getScrollTop() / self.scrollratio.y);
if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() / self.scrollratio.x);
self.noticeCursor()
})
}
};
self.bind(self.docscroll, "scroll", self.onscroll);
this.doZoomIn = function(e) {
if (self.zoomactive) return;
self.zoomactive = true;
self.zoomrestore = { style: {} };
var lst = ["position", "top", "left", "zIndex", "backgroundColor", "marginTop", "marginBottom", "marginLeft", "marginRight"];
var win = self.win[0].style;
for (var a in lst) {
var pp = lst[a];
self.zoomrestore.style[pp] = win[pp] !== undefined ? win[pp] : ""
}
self.zoomrestore.style.width = self.win.css("width");
self.zoomrestore.style.height = self.win.css("height");
self.zoomrestore.padding = { w: self.win.outerWidth() - self.win.width(), h: self.win.outerHeight() - self.win.height() };
if (cap.isios4) {
self.zoomrestore.scrollTop = $window.scrollTop();
$window.scrollTop(0)
}
self.win.css({ position: cap.isios4 ? "absolute" : "fixed", top: 0, left: 0, zIndex: globalmaxzindex + 100, margin: 0 });
var bkg = self.win.css("backgroundColor");
if ("" === bkg || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
self.rail.css({ zIndex: globalmaxzindex + 101 });
self.zoom.css({ zIndex: globalmaxzindex + 102 });
self.zoom.css("backgroundPosition", "0 -18px").empty().prepend(svgCollapse);
self.resizeZoom();
if (self.onzoomin) self.onzoomin.call(self);
return self.cancelEvent(e)
};
this.doZoomOut = function(e) {
if (!self.zoomactive) return;
self.zoomactive = false;
self.win.css("margin", "");
self.win.css(self.zoomrestore.style);
if (cap.isios4) { $window.scrollTop(self.zoomrestore.scrollTop) }
self.rail.css({ "z-index": self.zindex });
self.zoom.css({ "z-index": self.zindex });
self.zoomrestore = false;
self.zoom.css("backgroundPosition", "0 0").empty().prepend(svgExpand);
self.onResize();
if (self.onzoomout) self.onzoomout.call(self);
return self.cancelEvent(e)
};
this.doZoom = function(e) { return self.zoomactive ? self.doZoomOut(e) : self.doZoomIn(e) };
this.resizeZoom = function() {
if (!self.zoomactive) return;
var py = self.getScrollTop();
self.win.css({ width: $window.width() - self.zoomrestore.padding.w + "px", height: $window.height() - self.zoomrestore.padding.h + "px" });
self.onResize();
self.setScrollTop(Math.min(self.page.maxh, py))
};
this.init();
$.axscroll.push(this)
};
var ScrollMomentumClass2D = function(nc) {
var self = this;
this.nc = nc;
this.lastx = 0;
this.lasty = 0;
this.speedx = 0;
this.speedy = 0;
this.lasttime = 0;
this.steptime = 0;
this.snapx = false;
this.snapy = false;
this.demulx = 0;
this.demuly = 0;
this.lastscrollx = -1;
this.lastscrolly = -1;
this.chkx = 0;
this.chky = 0;
this.timer = 0;
this.reset = function(px, py) {
self.stop();
self.steptime = 0;
self.lasttime = now();
self.speedx = 0;
self.speedy = 0;
self.lastx = px;
self.lasty = py;
self.lastscrollx = -1;
self.lastscrolly = -1
};
this.update = function(px, py) {
var tm = now();
self.steptime = tm - self.lasttime;
self.lasttime = tm;
var dy = py - self.lasty;
var dx = px - self.lastx;
var sy = self.nc.getScrollTop();
var sx = self.nc.getScrollLeft();
var newy = sy + dy;
var newx = sx + dx;
self.snapx = newx < 0 || newx > self.nc.page.maxw;
self.snapy = newy < 0 || newy > self.nc.page.maxh;
self.speedx = dx;
self.speedy = dy;
self.lastx = px;
self.lasty = py
};
this.stop = function() {
self.nc.unsynched("domomentum2d");
if (self.timer) clearTimeout(self.timer);
self.timer = 0;
self.lastscrollx = -1;
self.lastscrolly = -1
};
this.doSnapy = function(nx, ny) {
var snap = false;
if (ny < 0) {
ny = 0;
snap = true
} else if (ny > self.nc.page.maxh) {
ny = self.nc.page.maxh;
snap = true
}
if (nx < 0) {
nx = 0;
snap = true
} else if (nx > self.nc.page.maxw) {
nx = self.nc.page.maxw;
snap = true
}
snap ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) : self.nc.triggerScrollEnd()
};
this.doMomentum = function(gp) {
var t = now();
var l = gp ? t + gp : self.lasttime;
var sl = self.nc.getScrollLeft();
var st = self.nc.getScrollTop();
var pageh = self.nc.page.maxh;
var pagew = self.nc.page.maxw;
self.speedx = pagew > 0 ? Math.min(60, self.speedx) : 0;
self.speedy = pageh > 0 ? Math.min(60, self.speedy) : 0;
var chk = l && t - l <= 60;
if (st < 0 || st > pageh || sl < 0 || sl > pagew) chk = false;
var sy = self.speedy && chk ? self.speedy : false;
var sx = self.speedx && chk ? self.speedx : false;
if (sy || sx) {
var tm = Math.max(16, self.steptime);
if (tm > 50) {
var xm = tm / 50;
self.speedx *= xm;
self.speedy *= xm;
tm = 50
}
self.demulxy = 0;
self.lastscrollx = self.nc.getScrollLeft();
self.chkx = self.lastscrollx;
self.lastscrolly = self.nc.getScrollTop();
self.chky = self.lastscrolly;
var nx = self.lastscrollx;
var ny = self.lastscrolly;
var onscroll = function() {
var df = now() - t > 600 ? .04 : .02;
if (self.speedx) {
nx = Math.floor(self.lastscrollx - self.speedx * (1 - self.demulxy));
self.lastscrollx = nx;
if (nx < 0 || nx > pagew) df = .1
}
if (self.speedy) {
ny = Math.floor(self.lastscrolly - self.speedy * (1 - self.demulxy));
self.lastscrolly = ny;
if (ny < 0 || ny > pageh) df = .1
}
self.demulxy = Math.min(1, self.demulxy + df);
self.nc.synched("domomentum2d", function() {
if (self.speedx) {
var scx = self.nc.getScrollLeft();
self.chkx = nx;
self.nc.setScrollLeft(nx)
}
if (self.speedy) {
var scy = self.nc.getScrollTop();
self.chky = ny;
self.nc.setScrollTop(ny)
}
if (!self.timer) {
self.nc.hideCursor();
self.doSnapy(nx, ny)
}
});
if (self.demulxy < 1) { self.timer = setTimeout(onscroll, tm) } else {
self.stop();
self.nc.hideCursor();
self.doSnapy(nx, ny)
}
};
onscroll()
} else { self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop()) }
}
};
var _scrollTop = jQuery.fn.scrollTop;
jQuery.cssHooks.pageYOffset = {
get: function(elem, computed, extra) { var nice = $.data(elem, "__axscroll") || false; return nice && nice.ishwscroll ? nice.getScrollTop() : _scrollTop.call(elem) },
set: function(elem, value) {
var nice = $.data(elem, "__axscroll") || false;
nice && nice.ishwscroll ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value);
return this
}
};
jQuery.fn.scrollTop = function(value) {
if (value === undefined) { var nice = this[0] ? $.data(this[0], "__axscroll") || false : false; return nice && nice.ishwscroll ? nice.getScrollTop() : _scrollTop.call(this) } else {
return this.each(function() {
var nice = $.data(this, "__axscroll") || false;
nice && nice.ishwscroll ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this), value)
})
}
};
var _scrollLeft = jQuery.fn.scrollLeft;
$.cssHooks.pageXOffset = {
get: function(elem, computed, extra) { var nice = $.data(elem, "__axscroll") || false; return nice && nice.ishwscroll ? nice.getScrollLeft() : _scrollLeft.call(elem) },
set: function(elem, value) {
var nice = $.data(elem, "__axscroll") || false;
nice && nice.ishwscroll ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value);
return this
}
};
jQuery.fn.scrollLeft = function(value) {
if (value === undefined) { var nice = this[0] ? $.data(this[0], "__axscroll") || false : false; return nice && nice.ishwscroll ? nice.getScrollLeft() : _scrollLeft.call(this) } else {
return this.each(function() {
var nice = $.data(this, "__axscroll") || false;
nice && nice.ishwscroll ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this), value)
})
}
};
var AxScrollArray = function(doms) {
var self = this;
this.length = 0;
this.name = "axscrollarray";
this.each = function(fn) { $.each(self, fn); return self };
this.push = function(nice) {
self[self.length] = nice;
self.length++
};
this.eq = function(idx) { return self[idx] };
if (doms) {
for (var a = 0; a < doms.length; a++) {
var nice = $.data(doms[a], "__axscroll") || false;
if (nice) {
this[this.length] = nice;
this.length++
}
}
}
return this
};
function mplex(el, lst, fn) { for (var a = 0, l = lst.length; a < l; a++) fn(el, lst[a]) }
mplex(AxScrollArray.prototype, ["show", "hide", "toggle", "onResize", "resize", "remove", "stop", "doScrollPos"], function(e, n) { e[n] = function() { var args = arguments; return this.each(function() { this[n].apply(this, args) }) } });
jQuery.fn.getAxScroll = function(index) { if (index === undefined) { return new AxScrollArray(this) } else { return this[index] && $.data(this[index], "__axscroll") || false } };
var pseudos = jQuery.expr.pseudos || jQuery.expr[":"];
pseudos.axscroll = function(a) { return $.data(a, "__axscroll") !== undefined };
$.fn.axScroll = function(wrapper, _opt) {
if (_opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
_opt = wrapper;
wrapper = false
}
var ret = new AxScrollArray;
this.each(function() {
var $this = $(this);
var opt = $.extend({}, _opt);
if (wrapper || false) {
var wrp = $(wrapper);
opt.doc = wrp.length > 1 ? $(wrapper, $this) : wrp;
opt.win = $this
}
var docundef = !("doc" in opt);
if (!docundef && !("win" in opt)) opt.win = $this;
var nice = $this.data("__axscroll") || false;
if (!nice) {
opt.doc = opt.doc || $this;
nice = new AxScrollClass(opt, $this);
$this.data("__axscroll", nice)
}
ret.push(nice)
});
return ret.length === 1 ? ret[0] : ret
};
_win.AxScroll = { getjQuery: function() { return jQuery } };
if (!$.axscroll) {
$.axscroll = new AxScrollArray;
$.axscroll.options = _globaloptions
}
});
if (platformIs == 'pc') {
$(".ax-scroll").axScroll();
$("body").bind('resize', function() { $(".ax-scroll").getAxScroll().resize() })
};
/* Popup */
(function(window, document, undefined) {
'use strict';
(function(factory) {
if (typeof define === 'function' && define.amd) {
// Register as an anonymous AMD module.
define(['jquery'], factory);
} else if (typeof exports === 'object') {
// Node/CommonJS
module.exports = factory(require('jquery'));
} else {
// Browser globals
factory(window.jQuery);
}
}(function($) {
// Create the defaults once
var pluginName = 'axPopup';
var pluginClass = 'ax-popup';
var pluginType = 'ax.popup';
var defaults = {
placement: 'auto',
container: null,
width: 'auto',
height: 'auto',
maxWidth: '', //AXUI
maxHeight: '', //AXUI
trigger: 'click', //hover,click,sticky,manual
style: '',
selector: false, // jQuery selector, if a selector is provided, popover objects will be delegated to the specified.
delay: {
show: null,
hide: 300
},
async: {
type: 'GET',
before: null, //function(that, xhr, settings){}
success: null, //function(that, xhr){}
error: null //function(that, xhr, data){}
},
cache: true,
multi: false,
arrow: true,
title: '',
content: '',
closeable: false,
padding: true,
url: '',
type: 'html',
direction: '', // ltr,rtl
animation: null,
template: '', //AXUI
backdrop: false,
dismissible: true,
onShow: null,
onHide: null,
abortXHR: true,
autoHide: false,
offsetTop: 0,
offsetLeft: 0,
iframeOptions: {
frameborder: '0',
allowtransparency: 'true',
id: '',
name: '',
scrolling: '',
onload: '',
class: '',
height: '100%',
width: '100%',
},
hideEmpty: false
};
var rtlClass = pluginClass + '-rtl';
var _srcElements = [];
var backdrop = $(''); //AXUI
var _globalIdSeed = 0;
var _isBodyEventHandled = false;
var _offsetOut = -2000; // the value offset out of the screen
var $document = $(document);
var toNumber = function(numeric, fallback) {
return isNaN(numeric) ? (fallback || 0) : Number(numeric);
};
var getPopFromElement = function($element) {
return $element.data('plugin_' + pluginName);
};
var hideAllPop = function() {
var pop = null;
for (var i = 0; i < _srcElements.length; i++) {
pop = getPopFromElement(_srcElements[i]);
if (pop) {
pop.hide(true);
}
}
$document.trigger('hiddenAll.' + pluginType);
};
var hideOtherPops = function(currentPop) {
var pop = null;
for (var i = 0; i < _srcElements.length; i++) {
pop = getPopFromElement(_srcElements[i]);
if (pop && pop.id !== currentPop.id) {
pop.hide(true);
}
}
$document.trigger('hiddenAll.' + pluginType);
};
var isMobile = ('ontouchstart' in document.documentElement) && (/Mobi/.test(navigator.userAgent));
var pointerEventToXY = function(e) {
var out = {
x: 0,
y: 0
};
if (e.type === 'touchstart' || e.type === 'touchmove' || e.type === 'touchend' || e.type === 'touchcancel') {
var touch = e.originalEvent.touches[0] || e.originalEvent.changedTouches[0];
out.x = touch.pageX;
out.y = touch.pageY;
} else if (e.type === 'mousedown' || e.type === 'mouseup' || e.type === 'click') {
out.x = e.pageX;
out.y = e.pageY;
}
return out;
};
// The actual plugin constructor
function AxPopup(element, options) {
this.$element = $(element);
if (options) {
if ($.type(options.delay) === 'string' || $.type(options.delay) === 'number') {
options.delay = {
show: options.delay,
hide: options.delay
}; // bc break fix
}
}
this.options = $.extend({}, defaults, options);
this._defaults = defaults;
this._name = pluginName;
this._targetclick = false;
this.init();
_srcElements.push(this.$element);
return this;
}
AxPopup.prototype = {
//init ax.popup
init: function() {
if (this.$element[0] instanceof document.constructor && !this.options.selector) {
throw new Error('`selector` option must be specified when initializing ' + this.type + ' on the window.document object!');
}
if (this.getTrigger() !== 'manual') {
//init the event handlers
if (isMobile) {
this.$element.off('touchend', this.options.selector).on('touchend', this.options.selector, $.proxy(this.toggle, this));
} else if (this.getTrigger() === 'click') {
this.$element.off('click', this.options.selector).on('click', this.options.selector, $.proxy(this.toggle, this));
} else if (this.getTrigger() === 'hover') {
this.$element
.off('mouseenter mouseleave click', this.options.selector)
.on('mouseenter', this.options.selector, $.proxy(this.mouseenterHandler, this))
.on('mouseleave', this.options.selector, $.proxy(this.mouseleaveHandler, this));
}
}
this._poped = false;
this._inited = true;
this._opened = false;
this._idSeed = _globalIdSeed;
this.id = pluginName + this._idSeed;
// normalize container
this.options.container = $(this.options.container || document.body).first();
if (this.options.backdrop) {
backdrop.appendTo(this.options.container).hide();
}
_globalIdSeed++;
if (this.getTrigger() === 'sticky') {
this.show();
}
if (this.options.selector) {
this._options = $.extend({}, this.options, {
selector: ''
});
}
},
/* api methods and actions */
destroy: function() {
var index = -1;
for (var i = 0; i < _srcElements.length; i++) {
if (_srcElements[i] === this.$element) {
index = i;
break;
}
}
_srcElements.splice(index, 1);
this.hide();
this.$element.data('plugin_' + pluginName, null);
if (this.getTrigger() === 'click') {
this.$element.off('click');
} else if (this.getTrigger() === 'hover') {
this.$element.off('mouseenter mouseleave');
}
if (this.$target) {
this.$target.remove();
}
},
getDelegateOptions: function() {
var options = {};
this._options && $.each(this._options, function(key, value) {
if (defaults[key] !== value) {
options[key] = value;
}
});
return options;
},
/*
param: force boolean value, if value is true then force hide the popover
param: event dom event,
*/
hide: function(force, event) {
if (!force && this.getTrigger() === 'sticky') {
return;
}
if (!this._opened) {
return;
}
if (event) {
event.preventDefault();
event.stopPropagation();
}
if (this.xhr && this.options.abortXHR === true) {
this.xhr.abort();
this.xhr = null;
}
var e = $.Event('hide.' + pluginType);
this.$element.trigger(e, [this.$target]);
if (this.$target) {
this.$target.removeClass('ax-in').addClass(this.getHideAnimation()); //AXUI
var that = this;
setTimeout(function() {
that.$target.hide();
if (!that.getCache()) {
that.$target.remove();
//that.getTriggerElement.removeAttr('data-target');
}
}, that.getHideDelay());
}
if (this.options.backdrop) {
backdrop.hide();
}
this._opened = false;
this.$element.trigger('hidden.' + pluginType, [this.$target]);
if (this.options.onHide) {
this.options.onHide(this.$target);
}
},
resetAutoHide: function() {
var that = this;
var autoHide = that.getAutoHide();
if (autoHide) {
if (that.autoHideHandler) {
clearTimeout(that.autoHideHandler);
}
that.autoHideHandler = setTimeout(function() {
that.hide();
}, autoHide);
}
},
delegate: function(eventTarget) {
var self = $(eventTarget).data('plugin_' + pluginName);
if (!self) {
self = new AxPopup(eventTarget, this.getDelegateOptions());
$(eventTarget).data('plugin_' + pluginName, self);
}
return self;
},
toggle: function(e) {
var self = this;
if (e) {
e.preventDefault();
e.stopPropagation();
if (this.options.selector) {
self = this.delegate(e.currentTarget);
}
}
self[self.getTarget().hasClass('ax-in') ? 'hide' : 'show'](); //AXUI
},
hideAll: function() {
hideAllPop();
},
hideOthers: function() {
hideOtherPops(this);
},
/*core method ,show popover */
show: function() {
if (this._opened) {
return;
}
//removeAllTargets();
var
$target = this.getTarget().removeClass().addClass(pluginClass).addClass(this._customTargetClass);
if (!this.options.multi) {
this.hideOthers();
}
// use cache by default, if not cache setted , reInit the contents
if (!this.getCache() || !this._poped || this.content === '') {
this.content = '';
this.setTitle(this.getTitle());
if (!this.options.closeable) {
$target.find('.ax-close').off('click').remove(); //AXUI
}
if (!this.isAsync()) {
this.setContent(this.getContent());
} else {
this.setContentASync(this.options.content);
}
if (this.canEmptyHide() && this.content === '') {
return;
}
$target.show();
}
this.displayContent();
if (this.options.onShow) {
this.options.onShow($target);
}
this.bindBodyEvents();
if (this.options.backdrop) {
backdrop.show();
}
this._opened = true;
this.resetAutoHide();
},
displayContent: function() {
var
//element postion
elementPos = this.getElementPosition(),
//target postion
$target = this.getTarget().removeClass().addClass(pluginClass).addClass(this._customTargetClass),
//target content
$targetContent = this.getContentElement(),
//target Width
targetWidth = $target[0].offsetWidth,
//target Height
targetHeight = $target[0].offsetHeight,
//placement
placement = 'bottom',
e = $.Event('show.' + pluginType);
if (this.canEmptyHide()) {
var content = $targetContent.children().html();
if (content !== null && content.trim().length === 0) {
return;
}
}
//if (this.hasContent()){
this.$element.trigger(e, [$target]);
//}
// support width as data attribute
var optWidth = this.$element.data('width') || this.options.width;
if (optWidth === '') {
optWidth = this._defaults.width;
}
if (optWidth !== 'auto') {
$targetContent.width(optWidth); //AXUI
}
// support max width as data attribute
var optmaxWidth = this.$element.attr('data-maxWidth') || this.$element.data('maxWidth') || this.options.maxWidth;
if (optmaxWidth === '') {
optmaxWidth = this._defaults.maxWidth;
} else {
$targetContent.css('max-width', optmaxWidth);
} //AXUI
// support height as data attribute
var optHeight = this.$element.data('height') || this.options.height;
if (optHeight === '') {
optHeight = this._defaults.height;
}
if (optHeight !== 'auto') {
$targetContent.height(optHeight);
}
// support max height as data attribute
var optmaxHeight = this.$element.attr('data-maxHeight') || this.$element.data('maxHeight') || this.options.maxHeight;
if (optmaxHeight === '') {
optmaxHeight = this._defaults.maxHeight;
} else {
$targetContent.css('max-height', optmaxHeight);
} //AXUI
if (this.options.style) {
this.$target.addClass(pluginClass + '-' + this.options.style);
}
//check rtl
if (this.options.direction === 'rtl' && !$targetContent.hasClass(rtlClass)) {
$targetContent.addClass(rtlClass);
}
//init the popover and insert into the document body
if (!this.options.arrow) {
$target.find('.ax-arrow').remove(); //AXUI
}
$target.detach().css({
top: _offsetOut,
left: _offsetOut,
display: 'block'
});
if (this.getAnimation()) {
$target.addClass(this.getAnimation());
}
$target.appendTo(this.options.container);
placement = this.getPlacement(elementPos);
//This line is just for compatible with knockout custom binding
this.$element.trigger('added.' + pluginType);
this.initTargetEvents();
if (!this.options.padding) {
if (this.options.height !== 'auto') {
$targetContent.css('height', $targetContent.outerHeight());
}
this.$target.addClass('ax-no-padding'); //AXUI
}
// add maxHeight and maxWidth support by limodou@gmail.com 2016/10/1
//if (this.options.maxHeight) {
// $targetContent.css('maxHeight', this.options.maxHeight);
//}
//if (this.options.maxWidth) {
// $targetContent.css('maxWidth', this.options.maxWidth);
//}
// end
//AXUI
targetWidth = $target[0].offsetWidth;
targetHeight = $target[0].offsetHeight;
var postionInfo = this.getTargetPositin(elementPos, placement, targetWidth, targetHeight);
this.$target.css(postionInfo.position).addClass('ax-' + placement).addClass('ax-in'); //AXUI
if (this.options.type === 'iframe') {
var $iframe = $target.find('iframe');
var iframeWidth = $target.width();
var iframeHeight = $iframe.parent().height();
if (this.options.iframeOptions.width !== '' && this.options.iframeOptions.width !== 'auto') {
iframeWidth = this.options.iframeOptions.width;
}
if (this.options.iframeOptions.height !== '' && this.options.iframeOptions.height !== 'auto') {
iframeHeight = this.options.iframeOptions.height;
}
$iframe.width(iframeWidth).height(iframeHeight);
}
if (!this.options.arrow) {
this.$target.css({
'margin': 0
});
}
if (this.options.arrow) {
var $arrow = this.$target.find('.ax-arrow'); //AXUI
$arrow.removeAttr('style');
//prevent arrow change by content size
if (placement === 'left' || placement === 'right') {
$arrow.css({
top: this.$target.height() / 2
});
} else if (placement === 'top' || placement === 'bottom') {
$arrow.css({
left: this.$target.width() / 2
});
}
if (postionInfo.arrowOffset) {
//hide the arrow if offset is negative
if (postionInfo.arrowOffset.left === -1 || postionInfo.arrowOffset.top === -1) {
$arrow.hide();
} else {
$arrow.css(postionInfo.arrowOffset);
}
}
}
this._poped = true;
this.$element.trigger('shown.' + pluginType, [this.$target]);
$targetContent.axScroll(); //AXUI
},
isTargetLoaded: function() {
return this.getTarget().find('i.glyphicon-refresh').length === 0;
},
/*getter setters */
getTriggerElement: function() {
return this.$element;
},
getTarget: function() {
if (!this.$target) {
var id = pluginName + this._idSeed;
this.$target = $(this.options.template)
.attr('id', id);
this._customTargetClass = this.$target.attr('class') !== pluginClass ? this.$target.attr('class') : null;
this.getTriggerElement().attr('data-target', id);
}
if (!this.$target.data('trigger-element')) {
this.$target.data('trigger-element', this.getTriggerElement());
}
return this.$target;
},
removeTarget: function() {
this.$target.remove();
this.$target = null;
this.$contentElement = null;
},
getTitleElement: function() {
return this.getTarget().find('.' + pluginClass + '-title');
},
getContentElement: function() {
if (!this.$contentElement) {
this.$contentElement = this.getTarget().find('.' + pluginClass + '-content');
}
return this.$contentElement;
},
getTitle: function() {
return this.$element.attr('data-title') || this.options.title; //AXUI
},
getUrl: function() {
return this.$element.attr('data-url') || this.options.url;
},
getAutoHide: function() {
return this.$element.attr('data-auto-hide') || this.options.autoHide;
},
getOffsetTop: function() {
return toNumber(this.$element.attr('data-offset-top')) || this.options.offsetTop;
},
getOffsetLeft: function() {
return toNumber(this.$element.attr('data-offset-left')) || this.options.offsetLeft;
},
getCache: function() {
var dataAttr = this.$element.attr('data-cache');
if (typeof(dataAttr) !== 'undefined') {
switch (dataAttr.toLowerCase()) {
case 'true':
case 'yes':
case '1':
return true;
case 'false':
case 'no':
case '0':
return false;
}
}
return this.options.cache;
},
getTrigger: function() {
return this.$element.attr('data-trigger') || this.options.trigger;
},
getDelayShow: function() {
var dataAttr = this.$element.attr('data-delay-show');
if (typeof(dataAttr) !== 'undefined') {
return dataAttr;
}
return this.options.delay.show === 0 ? 0 : this.options.delay.show || 100;
},
getHideDelay: function() {
var dataAttr = this.$element.attr('data-delay-hide');
if (typeof(dataAttr) !== 'undefined') {
return dataAttr;
}
return this.options.delay.hide === 0 ? 0 : this.options.delay.hide || 100;
},
getAnimation: function() {
var dataAttr = this.$element.attr('data-animation');
if (this.options.animation == null) {
return dataAttr || this.options.animation;
} else {
return 'ax-' + this.options.animation;
} //AXUI
},
getHideAnimation: function() {
var ani = this.getAnimation();
return ani ? ani + '-out' : 'ax-out'; //AXUI
},
setTitle: function(title) {
var $titleEl = this.getTitleElement();
if (title) {
//check rtl
if (this.options.direction === 'rtl' && !$titleEl.hasClass(rtlClass)) {
$titleEl.addClass(rtlClass);
}
$titleEl.html(title);
} else {
$titleEl.remove();
}
},
hasContent: function() {
return this.getContent();
},
canEmptyHide: function() {
return this.options.hideEmpty && this.options.type === 'html';
},
getIframe: function() {
var $iframe = $('').attr('src', this.getUrl());
var self = this;
$.each(this._defaults.iframeOptions, function(opt) {
if (typeof self.options.iframeOptions[opt] !== 'undefined') {
$iframe.attr(opt, self.options.iframeOptions[opt]);
}
});
return $iframe;
},
getContent: function() {
if (this.getUrl()) {
switch (this.options.type) {
case 'iframe':
this.content = this.getIframe();
break;
case 'html':
try {
this.content = $(this.getUrl());
if (!this.content.is(':visible')) {
this.content.show();
}
} catch (error) {
throw new Error('Unable to get popover content. Invalid selector specified.');
}
break;
}
} else if (!this.content) {
var content = '';
if ($.isFunction(this.options.content)) {
content = this.options.content.apply(this.$element[0], [this]);
} else {
content = this.options.content;
}
this.content = this.$element.attr('data-content') || content;
if (!this.content) {
var $next = this.$element.next();
if ($next && $next.hasClass(pluginClass + '-content')) {
this.content = $next;
}
}
}
return this.content;
},
setContent: function(content) {
var $target = this.getTarget();
var $ct = this.getContentElement();
if (typeof content === 'string') {
$ct.html(content);
} else if (content instanceof $) {
$ct.html('');
//Don't want to clone too many times.
if (!this.options.cache) {
content.clone(true, true).removeClass(pluginClass + '-content').appendTo($ct);
} else {
content.removeClass(pluginClass + '-content').appendTo($ct);
}
}
this.$target = $target;
},
isAsync: function() {
return this.options.type === 'async';
},
setContentASync: function(content) {
var that = this;
if (this.xhr) {
return;
}
this.xhr = $.ajax({
url: this.getUrl(),
type: this.options.async.type,
cache: this.getCache(),
beforeSend: function(xhr, settings) {
if (that.options.async.before) {
that.options.async.before(that, xhr, settings);
}
},
success: function(data) {
that.bindBodyEvents();
if (content && $.isFunction(content)) {
that.content = content.apply(that.$element[0], [data]);
} else {
that.content = data;
}
that.setContent(that.content);
var $targetContent = that.getContentElement();
$targetContent.removeAttr('style');
that.displayContent();
if (that.options.async.success) {
that.options.async.success(that, data);
}
},
complete: function() {
that.xhr = null;
},
error: function(xhr, data) {
if (that.options.async.error) {
that.options.async.error(that, xhr, data);
}
}
});
},
bindBodyEvents: function() {
if (_isBodyEventHandled) {
return;
}
if (this.options.dismissible && this.getTrigger() === 'click') {
if (isMobile) {
$document.off('touchstart.ax-popup').on('touchstart.ax-popup', $.proxy(this.bodyTouchStartHandler, this));
} else {
$document.off('keyup.ax-popup').on('keyup.ax-popup', $.proxy(this.escapeHandler, this));
$document.off('click.ax-popup').on('click.ax-popup', $.proxy(this.bodyClickHandler, this));
}
} else if (this.getTrigger() === 'hover') {
$document.off('touchend.ax-popup')
.on('touchend.ax-popup', $.proxy(this.bodyClickHandler, this));
}
},
/* event handlers */
mouseenterHandler: function(e) {
var self = this;
if (e && this.options.selector) {
self = this.delegate(e.currentTarget);
}
if (self._timeout) {
clearTimeout(self._timeout);
}
self._enterTimeout = setTimeout(function() {
if (!self.getTarget().is(':visible')) {
self.show();
}
}, this.getDelayShow());
},
mouseleaveHandler: function() {
var self = this;
clearTimeout(self._enterTimeout);
//key point, set the _timeout then use clearTimeout when mouse leave
self._timeout = setTimeout(function() {
self.hide();
}, this.getHideDelay());
},
escapeHandler: function(e) {
if (e.keyCode === 27) {
this.hideAll();
}
},
bodyTouchStartHandler: function(e) {
var self = this;
var $eventEl = $(e.currentTarget);
$eventEl.on('touchend', function(e) {
self.bodyClickHandler(e);
$eventEl.off('touchend');
});
$eventEl.on('touchmove', function() {
$eventEl.off('touchend');
});
},
bodyClickHandler: function(e) {
_isBodyEventHandled = true;
var canHide = true;
for (var i = 0; i < _srcElements.length; i++) {
var pop = getPopFromElement(_srcElements[i]);
if (pop && pop._opened) {
var offset = pop.getTarget().offset();
var popX1 = offset.left;
var popY1 = offset.top;
var popX2 = offset.left + pop.getTarget().width();
var popY2 = offset.top + pop.getTarget().height();
var pt = pointerEventToXY(e);
var inPop = pt.x >= popX1 && pt.x <= popX2 && pt.y >= popY1 && pt.y <= popY2;
if (inPop) {
canHide = false;
break;
}
}
}
if (canHide) {
hideAllPop();
}
},
/*
targetClickHandler: function() {
this._targetclick = true;
},
*/
//reset and init the target events;
initTargetEvents: function() {
if (this.getTrigger() === 'hover') {
this.$target
.off('mouseenter mouseleave')
.on('mouseenter', $.proxy(this.mouseenterHandler, this))
.on('mouseleave', $.proxy(this.mouseleaveHandler, this));
}
this.$target.find('.ax-close').off('click').on('click', $.proxy(this.hide, this, true)); //AXUI
//this.$target.off('click.ax-popup').on('click.ax-popup', $.proxy(this.targetClickHandler, this));
},
/* utils methods */
//caculate placement of the popover
getPlacement: function(pos) {
var
placement,
container = this.options.container,
clientWidth = container.innerWidth(),
clientHeight = container.innerHeight(),
scrollTop = container.scrollTop(),
scrollLeft = container.scrollLeft(),
pageX = Math.max(0, pos.left - scrollLeft),
pageY = Math.max(0, pos.top - scrollTop);
//arrowSize = 20;
//if placement equals auto，caculate the placement by element information;
if (typeof(this.options.placement) === 'function') {
placement = this.options.placement.call(this, this.getTarget()[0], this.$element[0]);
} else {
placement = this.$element.data('placement') || this.options.placement;
}
var isH = placement === 'horizontal';
var isV = placement === 'vertical';
var detect = placement === 'auto' || isH || isV;
if (detect) {
if (pageX < clientWidth / 3) {
if (pageY < clientHeight / 3) {
placement = isH ? 'right-bottom' : 'bottom-right';
} else if (pageY < clientHeight * 2 / 3) {
if (isV) {
placement = pageY <= clientHeight / 2 ? 'bottom-right' : 'top-right';
} else {
placement = 'right';
}
} else {
placement = isH ? 'right-top' : 'top-right';
}
//placement= pageY>targetHeight+arrowSize?'top-right':'bottom-right';
} else if (pageX < clientWidth * 2 / 3) {
if (pageY < clientHeight / 3) {
if (isH) {
placement = pageX <= clientWidth / 2 ? 'right-bottom' : 'left-bottom';
} else {
placement = 'bottom';
}
} else if (pageY < clientHeight * 2 / 3) {
if (isH) {
placement = pageX <= clientWidth / 2 ? 'right' : 'left';
} else {
placement = pageY <= clientHeight / 2 ? 'bottom' : 'top';
}
} else {
if (isH) {
placement = pageX <= clientWidth / 2 ? 'right-top' : 'left-top';
} else {
placement = 'top';
}
}
} else {
//placement = pageY>targetHeight+arrowSize?'top-left':'bottom-left';
if (pageY < clientHeight / 3) {
placement = isH ? 'left-bottom' : 'bottom-left';
} else if (pageY < clientHeight * 2 / 3) {
if (isV) {
placement = pageY <= clientHeight / 2 ? 'bottom-left' : 'top-left';
} else {
placement = 'left';
}
} else {
placement = isH ? 'left-top' : 'top-left';
}
}
} else if (placement === 'auto-top') {
if (pageX < clientWidth / 3) {
placement = 'top-right';
} else if (pageX < clientWidth * 2 / 3) {
placement = 'top';
} else {
placement = 'top-left';
}
} else if (placement === 'auto-bottom') {
if (pageX < clientWidth / 3) {
placement = 'bottom-right';
} else if (pageX < clientWidth * 2 / 3) {
placement = 'bottom';
} else {
placement = 'bottom-left';
}
} else if (placement === 'auto-left') {
if (pageY < clientHeight / 3) {
placement = 'left-top';
} else if (pageY < clientHeight * 2 / 3) {
placement = 'left';
} else {
placement = 'left-bottom';
}
} else if (placement === 'auto-right') {
if (pageY < clientHeight / 3) {
placement = 'right-bottom';
} else if (pageY < clientHeight * 2 / 3) {
placement = 'right';
} else {
placement = 'right-top';
}
}
if (platformIs == 'mobile' || clientIs == 'phone' || clientIs == 'pad' || clientIs == 'padflip' || clientIs == 'padpro') {
placement = 'center';
} //AXUI
return placement;
},
getElementPosition: function() {
// If the container is the body or normal conatiner, just use $element.offset()
var elRect = this.$element[0].getBoundingClientRect();
var container = this.options.container;
var cssPos = container.css('position');
if (container.is(document.body) || cssPos === 'static') {
return $.extend({}, this.$element.offset(), {
width: this.$element[0].offsetWidth || elRect.width,
height: this.$element[0].offsetHeight || elRect.height
});
// Else fixed container need recalculate the position
} else if (cssPos === 'fixed') {
var containerRect = container[0].getBoundingClientRect();
return {
top: elRect.top - containerRect.top + container.scrollTop(),
left: elRect.left - containerRect.left + container.scrollLeft(),
width: elRect.width,
height: elRect.height
};
} else if (cssPos === 'relative') {
return {
top: this.$element.offset().top - container.offset().top,
left: this.$element.offset().left - container.offset().left,
width: this.$element[0].offsetWidth || elRect.width,
height: this.$element[0].offsetHeight || elRect.height
};
}
},
getTargetPositin: function(elementPos, placement, targetWidth, targetHeight) {
var pos = elementPos,
container = this.options.container,
//clientWidth = container.innerWidth(),
//clientHeight = container.innerHeight(),
elementW = this.$element.outerWidth(),
elementH = this.$element.outerHeight(),
scrollTop = document.documentElement.scrollTop + container.scrollTop(),
scrollLeft = document.documentElement.scrollLeft + container.scrollLeft(),
position = {},
arrowOffset = null,
arrowSize = this.options.arrow ? 20 : 0,
padding = 10,
fixedW = elementW < arrowSize + padding ? arrowSize : 0,
fixedH = elementH < arrowSize + padding ? arrowSize : 0,
refix = 0,
pageH = document.documentElement.clientHeight + scrollTop,
pageW = document.documentElement.clientWidth + scrollLeft;
var validLeft = pos.left + pos.width / 2 - fixedW > 0;
var validRight = pos.left + pos.width / 2 + fixedW < pageW;
var validTop = pos.top + pos.height / 2 - fixedH > 0;
var validBottom = pos.top + pos.height / 2 + fixedH < pageH;
switch (placement) {
case 'center':
position = {
top: $(window).height() / 2 - targetHeight / 2,
left: $(window).width() / 2 - targetWidth / 2,
};
break; //AXUI
case 'bottom':
position = {
top: pos.top + pos.height,
left: pos.left + pos.width / 2 - targetWidth / 2
};
break;
case 'top':
position = {
top: pos.top - targetHeight,
left: pos.left + pos.width / 2 - targetWidth / 2
};
break;
case 'left':
position = {
top: pos.top + pos.height / 2 - targetHeight / 2,
left: pos.left - targetWidth
};
break;
case 'right':
position = {
top: pos.top + pos.height / 2 - targetHeight / 2,
left: pos.left + pos.width
};
break;
case 'top-right':
position = {
top: pos.top - targetHeight,
left: validLeft ? pos.left - fixedW : padding
};
arrowOffset = {
left: validLeft ? Math.min(elementW, targetWidth) / 2 + fixedW : _offsetOut
};
break;
case 'top-left':
refix = validRight ? fixedW : -padding;
position = {
top: pos.top - targetHeight,
left: pos.left - targetWidth + pos.width + refix
};
arrowOffset = {
left: validRight ? targetWidth - Math.min(elementW, targetWidth) / 2 - fixedW : _offsetOut
};
break;
case 'bottom-right':
position = {
top: pos.top + pos.height,
left: validLeft ? pos.left - fixedW : padding
};
arrowOffset = {
left: validLeft ? Math.min(elementW, targetWidth) / 2 + fixedW : _offsetOut
};
break;
case 'bottom-left':
refix = validRight ? fixedW : -padding;
position = {
top: pos.top + pos.height,
left: pos.left - targetWidth + pos.width + refix
};
arrowOffset = {
left: validRight ? targetWidth - Math.min(elementW, targetWidth) / 2 - fixedW : _offsetOut
};
break;
case 'right-top':
refix = validBottom ? fixedH : -padding;
position = {
top: pos.top - targetHeight + pos.height + refix,
left: pos.left + pos.width
};
arrowOffset = {
top: validBottom ? targetHeight - Math.min(elementH, targetHeight) / 2 - fixedH : _offsetOut
};
break;
case 'right-bottom':
position = {
top: validTop ? pos.top - fixedH : padding,
left: pos.left + pos.width
};
arrowOffset = {
top: validTop ? Math.min(elementH, targetHeight) / 2 + fixedH : _offsetOut
};
break;
case 'left-top':
refix = validBottom ? fixedH : -padding;
position = {
top: pos.top - targetHeight + pos.height + refix,
left: pos.left - targetWidth
};
arrowOffset = {
top: validBottom ? targetHeight - Math.min(elementH, targetHeight) / 2 - fixedH : _offsetOut
};
break;
case 'left-bottom':
position = {
top: validTop ? pos.top - fixedH : padding,
left: pos.left - targetWidth
};
arrowOffset = {
top: validTop ? Math.min(elementH, targetHeight) / 2 + fixedH : _offsetOut
};
break;
}
position.top += this.getOffsetTop();
position.left += this.getOffsetLeft();
return {
position: position,
arrowOffset: arrowOffset
};
}
};
$.fn[pluginName] = function(options, noInit) {
var results = [];
var $result = this.each(function() {
var axPopup = $.data(this, 'plugin_' + pluginName);
if (!axPopup) {
if (!options) {
axPopup = new AxPopup(this, null);
} else if (typeof options === 'string') {
if (options !== 'destroy') {
if (!noInit) {
axPopup = new AxPopup(this, null);
results.push(axPopup[options]());
}
}
} else if (typeof options === 'object') {
axPopup = new AxPopup(this, options);
}
$.data(this, 'plugin_' + pluginName, axPopup);
} else {
if (options === 'destroy') {
axPopup.destroy();
} else if (typeof options === 'string') {
results.push(axPopup[options]());
}
}
});
return (results.length) ? results : $result;
};
//Global object exposes to window.
var AxPopups = (function() {
var _hideAll = function() {
hideAllPop();
};
var _create = function(selector, options) {
options = options || {};
$(selector).axPopup(options);
};
var _isCreated = function(selector) {
var created = true;
$(selector).each(function(i, item) {
created = created && $(item).data('plugin_' + pluginName) !== undefined;
});
return created;
};
var _show = function(selector, options) {
if (options) {
$(selector).axPopup(options).axPopup('show');
} else {
$(selector).axPopup('show');
}
};
var _hide = function(selector) {
$(selector).axPopup('hide');
};
var _setDefaultOptions = function(options) {
defaults = $.extend({}, defaults, options);
};
var _updateContent = function(selector, content) {
var pop = $(selector).data('plugin_' + pluginName);
if (pop) {
var cache = pop.getCache();
pop.options.cache = false;
pop.options.content = content;
if (pop._opened) {
pop._opened = false;
pop.show();
} else {
if (pop.isAsync()) {
pop.setContentASync(content);
} else {
pop.setContent(content);
}
}
pop.options.cache = cache;
}
};
var _updateContentAsync = function(selector, url) {
var pop = $(selector).data('plugin_' + pluginName);
if (pop) {
var cache = pop.getCache();
var type = pop.options.type;
pop.options.cache = false;
pop.options.url = url;
if (pop._opened) {
pop._opened = false;
pop.show();
} else {
pop.options.type = 'async';
pop.setContentASync(pop.content);
}
pop.options.cache = cache;
pop.options.type = type;
}
};
return {
show: _show,
hide: _hide,
create: _create,
isCreated: _isCreated,
hideAll: _hideAll,
updateContent: _updateContent,
updateContentAsync: _updateContentAsync,
setDefaultOptions: _setDefaultOptions
};
})();
window.axPopups = AxPopups;
}));
})(window, document);
/* menu */
(function(global, factory) {
typeof exports === "object" && typeof module !== "undefined" ? module.exports = factory(require("jquery")) : typeof define === "function" && define.amd ? define(["jquery"], factory) : (global = global || self, global.axMenu = factory(global.jQuery))
}(this, function($) {
$ = $ && $.hasOwnProperty("default") ? $["default"] : $;
function _extends() {
_extends = Object.assign || function(target) {
for (var i = 1; i < arguments.length; i++) {
var source = arguments[i];
for (var key in source) {
if (Object.prototype.hasOwnProperty.call(source, key)) {
target[key] = source[key]
}
}
}
return target
};
return _extends.apply(this, arguments)
}
var Util = function($) {
var TRANSITION_END = "transitionend";
var Util = {
TRANSITION_END: "mmTransitionEnd",
triggerTransitionEnd: function triggerTransitionEnd(element) {
$(element).trigger(TRANSITION_END)
},
supportsTransitionEnd: function supportsTransitionEnd() {
return Boolean(TRANSITION_END)
}
};
function getSpecialTransitionEndEvent() {
return {
bindType: TRANSITION_END,
delegateType: TRANSITION_END,
handle: function handle(event) {
if ($(event.target).is(this)) {
return event.handleObj.handler.apply(this, arguments)
}
return undefined
}
}
}
function transitionEndEmulator(duration) {
var _this = this;
var called = false;
$(this).one(Util.TRANSITION_END, function() {
called = true
});
setTimeout(function() {
if (!called) {
Util.triggerTransitionEnd(_this)
}
}, duration);
return this
}
function setTransitionEndSupport() {
$.fn.mmEmulateTransitionEnd = transitionEndEmulator;
$.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent()
}
setTransitionEndSupport();
return Util
}($);
var NAME = "axMenu";
var DATA_KEY = "axMenu";
var EVENT_KEY = "." + DATA_KEY;
var DATA_API_KEY = ".data-api";
var JQUERY_NO_CONFLICT = $.fn[NAME];
var TRANSITION_DURATION = 350;
var Default = {
toggle: true,
cookie: false, //AXUI
row: false, //AXUI
width: '', //AXUI
dropWidth: '', //AXUI
gutter: '', //AXUI
trigger: 'click', //AXUI
preventDefault: true,
triggerElement: "a",
parentTrigger: "li",
subMenu: "ul"
};
var Event = {
SHOW: "show" + EVENT_KEY,
SHOWN: "shown" + EVENT_KEY,
HIDE: "hide" + EVENT_KEY,
HIDDEN: "hidden" + EVENT_KEY,
CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
CLICK_DATA_API_2: "mouseenter" + EVENT_KEY + DATA_API_KEY, //AXUI
CLICK_DATA_API_3: "mouseleave" + EVENT_KEY + DATA_API_KEY, //AXUI
};
var ClassName = {
AX: "",
ACTIVE: "ax-active",
SHOW: "ax-show",
COLLAPSE: "ax-collapse",
COLLAPSING: "ax-collapsing",
COLLAPSED: "ax-collapsed",
ROW: "ax-menu-row",
HOVER: "ax-menu-hover",
};
var AxMenu = function() {
function AxMenu(element, config) {
this.element = element;
this.config = _extends({}, Default, {}, config);
this.transitioning = null;
this.init()
}
var _proto = AxMenu.prototype;
_proto.init = function init() {
var self = this;
var conf = this.config;
var el = $(this.element);
el.addClass(ClassName.AX);
if (conf.row == true) {
el.addClass(ClassName.ROW);
}
if (conf.dropWidth != '') {
el.children("li").children("ul").css("width", conf.dropWidth);
}
if (conf.width != '') {
el.children("li").css("width", conf.width);
var offsetLeft = (el.children("li").width() - el.children("li").children("ul").width() - 2) / 2;
el.children("li").children("ul").css("left", offsetLeft);
}
if (conf.gutter != '') {
el.children("li").css({ "margin-left": conf.gutter, "margin-right": conf.gutter });
}
//cookie
if (conf.cookie == true) {
var thisMenuid = el.attr("id");
el.find("li").each(function(i) {
$(this).children("a:first-child").attr("aria-cookie", thisMenuid + i);
});
var cookieId = "menu-" + thisMenuid;
var cookieExpand = "expand-" + thisMenuid;
el.find("a").click(function() {
var thismenu = $(this).attr("aria-cookie");
$.cookie(cookieId, thismenu, { expires: 365000, path: '/' });
var thisexpand = $(this).attr("aria-expanded");
if (typeof($(this).attr("aria-expanded")) == "undefined") {
$.cookie(cookieExpand, 'false', { expires: 365000, path: '/' });
} else {
$.cookie(cookieExpand, thisexpand, { expires: 365000, path: '/' });
}
});
//
var menuid = $("[aria-cookie=" + $.cookie(cookieId) + "]");
if ($.cookie(cookieExpand) == "true") {
menuid.parent("li").removeClass(ClassName.ACTIVE);
} else {
menuid.parent("li").addClass(ClassName.ACTIVE);
}
}
//
var thisActive = el.find(conf.parentTrigger + "." + ClassName.ACTIVE);
$(thisActive).each(function() {
if ($(this).children("ul").length > 0) {
$(this).children(conf.triggerElement).attr("aria-expanded", "true");
} else {
$(this).children(conf.triggerElement).attr("aria-expanded", "childless");
}
});
//
el.find(conf.parentTrigger + "." + ClassName.ACTIVE).parents(conf.parentTrigger).addClass(ClassName.ACTIVE);
el.find(conf.parentTrigger + "." + ClassName.ACTIVE).parents(conf.parentTrigger).children(conf.triggerElement).attr("aria-expanded", "true");
el.find(conf.parentTrigger + "." + ClassName.ACTIVE).has(conf.subMenu).children(conf.subMenu).addClass(ClassName.COLLAPSE + " " + ClassName.SHOW);
el.find(conf.parentTrigger).not("." + ClassName.ACTIVE).has(conf.subMenu).children(conf.subMenu).addClass(ClassName.COLLAPSE);
//AXUI
if (conf.trigger == "hover") {
el.find(conf.parentTrigger).on(Event.CLICK_DATA_API_3, function(e) {
$(this).removeClass(ClassName.ACTIVE);
$(this).children(conf.triggerElement).attr('aria-expanded', 'false');
$(this).children(conf.subMenu).removeClass(ClassName.SHOW);
}); //trigger mouseleaver
el.find(conf.parentTrigger).on(Event.CLICK_DATA_API_2, function(e) {
// eslint-disable-line func-names
var eTar = $(this).children(conf.triggerElement);
if (eTar.attr("aria-disabled") === "true") {
return
}
if (conf.preventDefault && eTar.attr("href") === "#") {
e.preventDefault()
}
var paRent = eTar.parent(conf.parentTrigger);
var sibLi = paRent.siblings(conf.parentTrigger);
var sibTrigger = sibLi.children(conf.triggerElement);
if (paRent.hasClass(ClassName.ACTIVE)) {
eTar.attr("aria-expanded", "false");
self.removeActive(paRent)
} else {
if (eTar.next("ul").length > 0) {
eTar.attr("aria-expanded", "true")
} else {
eTar.attr("aria-expanded", "childless")
}
self.setActive(paRent);
if (conf.toggle) {
self.removeActive(sibLi);
sibTrigger.attr("aria-expanded", "false")
}
}
if (conf.onTransitionStart) {
conf.onTransitionStart(e)
}
}); //trigger mouseenter
} else {
el.find(conf.parentTrigger).children(conf.triggerElement).on(Event.CLICK_DATA_API, function(e) {
var eTar = $(this);
if (eTar.attr("aria-disabled") === "true") {
return
}
if (conf.preventDefault && eTar.attr("href") === "#") {
e.preventDefault()
}
var paRent = eTar.parent(conf.parentTrigger);
var sibLi = paRent.siblings(conf.parentTrigger);
var sibTrigger = sibLi.children(conf.triggerElement);
if (paRent.hasClass(ClassName.ACTIVE)) {
eTar.attr("aria-expanded", "false");
self.removeActive(paRent)
} else {
if (eTar.next("ul").length > 0) {
eTar.attr("aria-expanded", "true")
} else {
eTar.attr("aria-expanded", "childless")
}
self.setActive(paRent);
if (conf.toggle) {
self.removeActive(sibLi);
sibTrigger.attr("aria-expanded", "false")
}
}
if (conf.onTransitionStart) {
conf.onTransitionStart(e)
}
}); //trigger click
}
//AXUI
};
_proto.setActive = function setActive(li) {
$(li).addClass(ClassName.ACTIVE);
var ul = $(li).children(this.config.subMenu);
if (ul.length > 0 && !ul.hasClass(ClassName.SHOW)) {
this.show(ul)
}
};
_proto.removeActive = function removeActive(li) {
$(li).removeClass(ClassName.ACTIVE);
var ul = $(li).children(this.config.subMenu + "." + ClassName.SHOW);
if (ul.length > 0) {
this.hide(ul)
}
};
_proto.show = function show(element) {
var _this = this;
if (this.transitioning || $(element).hasClass(ClassName.COLLAPSING)) {
return
}
var elem = $(element);
var startEvent = $.Event(Event.SHOW);
elem.trigger(startEvent);
if (startEvent.isDefaultPrevented()) {
return
}
elem.parent(this.config.parentTrigger).addClass(ClassName.ACTIVE);
if (this.config.toggle) {
var toggleElem = elem.parent(this.config.parentTrigger).siblings().children(this.config.subMenu + "." + ClassName.SHOW);
this.hide(toggleElem)
}
elem.removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING).height(0);
this.setTransitioning(true);
var complete = function complete() {
if (!_this.config || !_this.element) {
return
}
elem.removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE + " " + ClassName.SHOW).height("");
_this.setTransitioning(false);
elem.trigger(Event.SHOWN)
};
elem.height(element[0].scrollHeight).one(Util.TRANSITION_END, complete).mmEmulateTransitionEnd(TRANSITION_DURATION)
};
_proto.hide = function hide(element) {
var _this2 = this;
if (this.transitioning || !$(element).hasClass(ClassName.SHOW)) {
return
}
var elem = $(element);
var startEvent = $.Event(Event.HIDE);
elem.trigger(startEvent);
if (startEvent.isDefaultPrevented()) {
return
}
elem.parent(this.config.parentTrigger).removeClass(ClassName.ACTIVE);
elem.height(elem.height())[0].offsetHeight;
elem.addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
this.setTransitioning(true);
var complete = function complete() {
if (!_this2.config || !_this2.element) {
return
}
if (_this2.transitioning && _this2.config.onTransitionEnd) {
_this2.config.onTransitionEnd()
}
_this2.setTransitioning(false);
elem.trigger(Event.HIDDEN);
elem.removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE)
};
if (elem.height() === 0 || elem.css("display") === "none") {
complete()
} else {
elem.height(0).one(Util.TRANSITION_END, complete).mmEmulateTransitionEnd(TRANSITION_DURATION)
}
};
_proto.setTransitioning = function setTransitioning(isTransitioning) {
this.transitioning = isTransitioning
};
_proto.dispose = function dispose() {
$.removeData(this.element, DATA_KEY);
$(this.element).find(this.config.parentTrigger) //.has(this.config.subMenu)
.children(this.config.triggerElement).off(Event.CLICK_DATA_API);
this.transitioning = null;
this.config = null;
this.element = null
};
AxMenu.jQueryInterface = function jQueryInterface(config) {
return this.each(function() {
var $this = $(this);
var data = $this.data(DATA_KEY);
var conf = _extends({}, Default, {}, $this.data(), {}, typeof config === 'object' && config ? config : {});
if (!data) {
data = new AxMenu(this, conf);
$this.data(DATA_KEY, data)
}
if (typeof config === "string") {
if (data[config] === undefined) {
throw new Error('No method named "' + config + '"')
}
data[config]()
}
})
};
return AxMenu
}();
$.fn[NAME] = AxMenu.jQueryInterface;
$.fn[NAME].Constructor = AxMenu;
$.fn[NAME].noConflict = function() {
$.fn[NAME] = JQUERY_NO_CONFLICT;
return AxMenu.jQueryInterface
};
return AxMenu
}));
/* select2 */
;
(function(factory) {
if (typeof define === 'function' && define.amd) {
// AMD. Register as an anonymous module.
define(['jquery'], factory);
} else if (typeof module === 'object' && module.exports) {
// Node/CommonJS
module.exports = function(root, jQuery) {
if (jQuery === undefined) {
// require('jQuery') returns a factory that requires window to
// build a jQuery instance, we normalize how we use modules
// that require this pattern but the window provided is a noop
// if it's defined (how jquery works)
if (typeof window !== 'undefined') {
jQuery = require('jquery');
} else {
jQuery = require('jquery')(root);
}
}
factory(jQuery);
return jQuery;
};
} else {
// Browser globals
factory(jQuery);
}
}(function(jQuery) {
// This is needed so we can catch the AMD loader configuration and use it
// The inner file should be wrapped (by `banner.start.js`) in a function that
// returns the AMD loader references.
var S2 = (function() {
// Restore the Select2 AMD loader so it can be used
// Needed mostly in the language files, where the loader is not inserted
if (jQuery && jQuery.fn && jQuery.fn.select2 && jQuery.fn.select2.amd) {
var S2 = jQuery.fn.select2.amd;
}
var S2;
(function() {
if (!S2 || !S2.requirejs) {
if (!S2) { S2 = {}; } else { require = S2; }
/**
* @license almond 0.3.3 Copyright jQuery Foundation and other contributors.
* Released under MIT license, http://github.com/requirejs/almond/LICENSE
*/
//Going sloppy to avoid 'use strict' string cost, but strict practices should
//be followed.
/*global setTimeout: false */
var requirejs, require, define;
(function(undef) {
var main, req, makeMap, handlers,
defined = {},
waiting = {},
config = {},
defining = {},
hasOwn = Object.prototype.hasOwnProperty,
aps = [].slice,
jsSuffixRegExp = /\.js$/;
function hasProp(obj, prop) {
return hasOwn.call(obj, prop);
}
/**
* Given a relative module name, like ./something, normalize it to
* a real name that can be mapped to a path.
* @param {String} name the relative name
* @param {String} baseName a real name that the name arg is relative
* to.
* @returns {String} normalized name
*/
function normalize(name, baseName) {
var nameParts, nameSegment, mapValue, foundMap, lastIndex,
foundI, foundStarMap, starI, i, j, part, normalizedBaseParts,
baseParts = baseName && baseName.split("/"),
map = config.map,
starMap = (map && map['*']) || {};
//Adjust any relative paths.
if (name) {
name = name.split('/');
lastIndex = name.length - 1;
// If wanting node ID compatibility, strip .js from end
// of IDs. Have to do this here, and not in nameToUrl
// because node allows either .js or non .js to map
// to same file.
if (config.nodeIdCompat && jsSuffixRegExp.test(name[lastIndex])) {
name[lastIndex] = name[lastIndex].replace(jsSuffixRegExp, '');
}
// Starts with a '.' so need the baseName
if (name[0].charAt(0) === '.' && baseParts) {
//Convert baseName to array, and lop off the last part,
//so that . matches that 'directory' and not name of the baseName's
//module. For instance, baseName of 'one/two/three', maps to
//'one/two/three.js', but we want the directory, 'one/two' for
//this normalization.
normalizedBaseParts = baseParts.slice(0, baseParts.length - 1);
name = normalizedBaseParts.concat(name);
}
//start trimDots
for (i = 0; i < name.length; i++) {
part = name[i];
if (part === '.') {
name.splice(i, 1);
i -= 1;
} else if (part === '..') {
// If at the start, or previous value is still ..,
// keep them so that when converted to a path it may
// still work when converted to a path, even though
// as an ID it is less than ideal. In larger point
// releases, may be better to just kick out an error.
if (i === 0 || (i === 1 && name[2] === '..') || name[i - 1] === '..') {
continue;
} else if (i > 0) {
name.splice(i - 1, 2);
i -= 2;
}
}
}
//end trimDots
name = name.join('/');
}
//Apply map config if available.
if ((baseParts || starMap) && map) {
nameParts = name.split('/');
for (i = nameParts.length; i > 0; i -= 1) {
nameSegment = nameParts.slice(0, i).join("/");
if (baseParts) {
//Find the longest baseName segment match in the config.
//So, do joins on the biggest to smallest lengths of baseParts.
for (j = baseParts.length; j > 0; j -= 1) {
mapValue = map[baseParts.slice(0, j).join('/')];
//baseName segment has config, find if it has one for
//this name.
if (mapValue) {
mapValue = mapValue[nameSegment];
if (mapValue) {
//Match, update name to the new value.
foundMap = mapValue;
foundI = i;
break;
}
}
}
}
if (foundMap) {
break;
}
//Check for a star map match, but just hold on to it,
//if there is a shorter segment match later in a matching
//config, then favor over this star map.
if (!foundStarMap && starMap && starMap[nameSegment]) {
foundStarMap = starMap[nameSegment];
starI = i;
}
}
if (!foundMap && foundStarMap) {
foundMap = foundStarMap;
foundI = starI;
}
if (foundMap) {
nameParts.splice(0, foundI, foundMap);
name = nameParts.join('/');
}
}
return name;
}
function makeRequire(relName, forceSync) {
return function() {
//A version of a require function that passes a moduleName
//value for items that may need to
//look up paths relative to the moduleName
var args = aps.call(arguments, 0);
//If first arg is not require('string'), and there is only
//one arg, it is the array form without a callback. Insert
//a null so that the following concat is correct.
if (typeof args[0] !== 'string' && args.length === 1) {
args.push(null);
}
return req.apply(undef, args.concat([relName, forceSync]));
};
}
function makeNormalize(relName) {
return function(name) {
return normalize(name, relName);
};
}
function makeLoad(depName) {
return function(value) {
defined[depName] = value;
};
}
function callDep(name) {
if (hasProp(waiting, name)) {
var args = waiting[name];
delete waiting[name];
defining[name] = true;
main.apply(undef, args);
}
if (!hasProp(defined, name) && !hasProp(defining, name)) {
throw new Error('No ' + name);
}
return defined[name];
}
//Turns a plugin!resource to [plugin, resource]
//with the plugin being undefined if the name
//did not have a plugin prefix.
function splitPrefix(name) {
var prefix,
index = name ? name.indexOf('!') : -1;
if (index > -1) {
prefix = name.substring(0, index);
name = name.substring(index + 1, name.length);
}
return [prefix, name];
}
//Creates a parts array for a relName where first part is plugin ID,
//second part is resource ID. Assumes relName has already been normalized.
function makeRelParts(relName) {
return relName ? splitPrefix(relName) : [];
}
/**
* Makes a name map, normalizing the name, and using a plugin
* for normalization if necessary. Grabs a ref to plugin
* too, as an optimization.
*/
makeMap = function(name, relParts) {
var plugin,
parts = splitPrefix(name),
prefix = parts[0],
relResourceName = relParts[1];
name = parts[1];
if (prefix) {
prefix = normalize(prefix, relResourceName);
plugin = callDep(prefix);
}
//Normalize according
if (prefix) {
if (plugin && plugin.normalize) {
name = plugin.normalize(name, makeNormalize(relResourceName));
} else {
name = normalize(name, relResourceName);
}
} else {
name = normalize(name, relResourceName);
parts = splitPrefix(name);
prefix = parts[0];
name = parts[1];
if (prefix) {
plugin = callDep(prefix);
}
}
//Using ridiculous property names for space reasons
return {
f: prefix ? prefix + '!' + name : name, //fullName
n: name,
pr: prefix,
p: plugin
};
};
function makeConfig(name) {
return function() {
return (config && config.config && config.config[name]) || {};
};
}
handlers = {
require: function(name) {
return makeRequire(name);
},
exports: function(name) {
var e = defined[name];
if (typeof e !== 'undefined') {
return e;
} else {
return (defined[name] = {});
}
},
module: function(name) {
return {
id: name,
uri: '',
exports: defined[name],
config: makeConfig(name)
};
}
};
main = function(name, deps, callback, relName) {
var cjsModule, depName, ret, map, i, relParts,
args = [],
callbackType = typeof callback,
usingExports;
//Use name if no relName
relName = relName || name;
relParts = makeRelParts(relName);
//Call the callback to define the module, if necessary.
if (callbackType === 'undefined' || callbackType === 'function') {
//Pull out the defined dependencies and pass the ordered
//values to the callback.
//Default to [require, exports, module] if no deps
deps = !deps.length && callback.length ? ['require', 'exports', 'module'] : deps;
for (i = 0; i < deps.length; i += 1) {
map = makeMap(deps[i], relParts);
depName = map.f;
//Fast path CommonJS standard dependencies.
if (depName === "require") {
args[i] = handlers.require(name);
} else if (depName === "exports") {
//CommonJS module spec 1.1
args[i] = handlers.exports(name);
usingExports = true;
} else if (depName === "module") {
//CommonJS module spec 1.1
cjsModule = args[i] = handlers.module(name);
} else if (hasProp(defined, depName) ||
hasProp(waiting, depName) ||
hasProp(defining, depName)) {
args[i] = callDep(depName);
} else if (map.p) {
map.p.load(map.n, makeRequire(relName, true), makeLoad(depName), {});
args[i] = defined[depName];
} else {
throw new Error(name + ' missing ' + depName);
}
}
ret = callback ? callback.apply(defined[name], args) : undefined;
if (name) {
//If setting exports via "module" is in play,
//favor that over return value and exports. After that,
//favor a non-undefined return value over exports use.
if (cjsModule && cjsModule.exports !== undef &&
cjsModule.exports !== defined[name]) {
defined[name] = cjsModule.exports;
} else if (ret !== undef || !usingExports) {
//Use the return value from the function.
defined[name] = ret;
}
}
} else if (name) {
//May just be an object definition for the module. Only
//worry about defining if have a module name.
defined[name] = callback;
}
};
requirejs = require = req = function(deps, callback, relName, forceSync, alt) {
if (typeof deps === "string") {
if (handlers[deps]) {
//callback in this case is really relName
return handlers[deps](callback);
}
//Just return the module wanted. In this scenario, the
//deps arg is the module name, and second arg (if passed)
//is just the relName.
//Normalize module name, if it contains . or ..
return callDep(makeMap(deps, makeRelParts(callback)).f);
} else if (!deps.splice) {
//deps is a config object, not an array.
config = deps;
if (config.deps) {
req(config.deps, config.callback);
}
if (!callback) {
return;
}
if (callback.splice) {
//callback is an array, which means it is a dependency list.
//Adjust args if there are dependencies
deps = callback;
callback = relName;
relName = null;
} else {
deps = undef;
}
}
//Support require(['a'])
callback = callback || function() {};
//If relName is a function, it is an errback handler,
//so remove it.
if (typeof relName === 'function') {
relName = forceSync;
forceSync = alt;
}
//Simulate async callback;
if (forceSync) {
main(undef, deps, callback, relName);
} else {
//Using a non-zero value because of concern for what old browsers
//do, and latest browsers "upgrade" to 4 if lower value is used:
//http://www.whatwg.org/specs/web-apps/current-work/multipage/timers.html#dom-windowtimers-settimeout:
//If want a value immediately, use require('id') instead -- something
//that works in almond on the global level, but not guaranteed and
//unlikely to work in other AMD implementations.
setTimeout(function() {
main(undef, deps, callback, relName);
}, 4);
}
return req;
};
/**
* Just drops the config on the floor, but returns req in case
* the config return value is used.
*/
req.config = function(cfg) {
return req(cfg);
};
/**
* Expose module registry for debugging and tooling
*/
requirejs._defined = defined;
define = function(name, deps, callback) {
if (typeof name !== 'string') {
throw new Error('See almond README: incorrect module build, no module name');
}
//This module may not have dependencies
if (!deps.splice) {
//deps is not an array, so probably means
//an object literal or factory function for
//the value. Adjust args.
callback = deps;
deps = [];
}
if (!hasProp(defined, name) && !hasProp(waiting, name)) {
waiting[name] = [name, deps, callback];
}
};
define.amd = {
jQuery: true
};
}());
S2.requirejs = requirejs;
S2.require = require;
S2.define = define;
}
}());
S2.define("almond", function() {});
/* global jQuery:false, $:false */
S2.define('jquery', [], function() {
var _$ = jQuery || $;
if (_$ == null && console && console.error) {
console.error(
'Select2: An instance of jQuery or a jQuery-compatible library was not ' +
'found. Make sure that you are including jQuery before Select2 on your ' +
'web page.'
);
}
return _$;
});
S2.define('select2/utils', [
'jquery'
], function($) {
var Utils = {};
Utils.Extend = function(ChildClass, SuperClass) {
var __hasProp = {}.hasOwnProperty;
function BaseConstructor() {
this.constructor = ChildClass;
}
for (var key in SuperClass) {
if (__hasProp.call(SuperClass, key)) {
ChildClass[key] = SuperClass[key];
}
}
BaseConstructor.prototype = SuperClass.prototype;
ChildClass.prototype = new BaseConstructor();
ChildClass.__super__ = SuperClass.prototype;
return ChildClass;
};
function getMethods(theClass) {
var proto = theClass.prototype;
var methods = [];
for (var methodName in proto) {
var m = proto[methodName];
if (typeof m !== 'function') {
continue;
}
if (methodName === 'constructor') {
continue;
}
methods.push(methodName);
}
return methods;
}
Utils.Decorate = function(SuperClass, DecoratorClass) {
var decoratedMethods = getMethods(DecoratorClass);
var superMethods = getMethods(SuperClass);
function DecoratedClass() {
var unshift = Array.prototype.unshift;
var argCount = DecoratorClass.prototype.constructor.length;
var calledConstructor = SuperClass.prototype.constructor;
if (argCount > 0) {
unshift.call(arguments, SuperClass.prototype.constructor);
calledConstructor = DecoratorClass.prototype.constructor;
}
calledConstructor.apply(this, arguments);
}
DecoratorClass.displayName = SuperClass.displayName;
function ctr() {
this.constructor = DecoratedClass;
}
DecoratedClass.prototype = new ctr();
for (var m = 0; m < superMethods.length; m++) {
var superMethod = superMethods[m];
DecoratedClass.prototype[superMethod] =
SuperClass.prototype[superMethod];
}
var calledMethod = function(methodName) {
// Stub out the original method if it's not decorating an actual method
var originalMethod = function() {};
if (methodName in DecoratedClass.prototype) {
originalMethod = DecoratedClass.prototype[methodName];
}
var decoratedMethod = DecoratorClass.prototype[methodName];
return function() {
var unshift = Array.prototype.unshift;
unshift.call(arguments, originalMethod);
return decoratedMethod.apply(this, arguments);
};
};
for (var d = 0; d < decoratedMethods.length; d++) {
var decoratedMethod = decoratedMethods[d];
DecoratedClass.prototype[decoratedMethod] = calledMethod(decoratedMethod);
}
return DecoratedClass;
};
var Observable = function() {
this.listeners = {};
};
Observable.prototype.on = function(event, callback) {
this.listeners = this.listeners || {};
if (event in this.listeners) {
this.listeners[event].push(callback);
} else {
this.listeners[event] = [callback];
}
};
Observable.prototype.trigger = function(event) {
var slice = Array.prototype.slice;
var params = slice.call(arguments, 1);
this.listeners = this.listeners || {};
// Params should always come in as an array
if (params == null) {
params = [];
}
// If there are no arguments to the event, use a temporary object
if (params.length === 0) {
params.push({});
}
// Set the `_type` of the first object to the event
params[0]._type = event;
if (event in this.listeners) {
this.invoke(this.listeners[event], slice.call(arguments, 1));
}
if ('*' in this.listeners) {
this.invoke(this.listeners['*'], arguments);
}
};
Observable.prototype.invoke = function(listeners, params) {
for (var i = 0, len = listeners.length; i < len; i++) {
listeners[i].apply(this, params);
}
};
Utils.Observable = Observable;
Utils.generateChars = function(length) {
var chars = '';
for (var i = 0; i < length; i++) {
var randomChar = Math.floor(Math.random() * 36);
chars += randomChar.toString(36);
}
return chars;
};
Utils.bind = function(func, context) {
return function() {
func.apply(context, arguments);
};
};
Utils._convertData = function(data) {
for (var originalKey in data) {
var keys = originalKey.split('-');
var dataLevel = data;
if (keys.length === 1) {
continue;
}
for (var k = 0; k < keys.length; k++) {
var key = keys[k];
// Lowercase the first letter
// By default, dash-separated becomes camelCase
key = key.substring(0, 1).toLowerCase() + key.substring(1);
if (!(key in dataLevel)) {
dataLevel[key] = {};
}
if (k == keys.length - 1) {
dataLevel[key] = data[originalKey];
}
dataLevel = dataLevel[key];
}
delete data[originalKey];
}
return data;
};
Utils.hasScroll = function(index, el) {
// Adapted from the function created by @ShadowScripter
// and adapted by @BillBarry on the Stack Exchange Code Review website.
// The original code can be found at
// http://codereview.stackexchange.com/q/13338
// and was designed to be used with the Sizzle selector engine.
var $el = $(el);
var overflowX = el.style.overflowX;
var overflowY = el.style.overflowY;
//Check both x and y declarations
if (overflowX === overflowY &&
(overflowY === 'hidden' || overflowY === 'visible')) {
return false;
}
if (overflowX === 'scroll' || overflowY === 'scroll') {
return true;
}
return ($el.innerHeight() < el.scrollHeight ||
$el.innerWidth() < el.scrollWidth);
};
Utils.escapeMarkup = function(markup) {
var replaceMap = {
'\\': '\',
'&': '&',
'<': '<',
'>': '>',
'"': '"',
'\'': ''',
'/': '/'
};
// Do not try to escape the markup if it's not a string
if (typeof markup !== 'string') {
return markup;
}
return String(markup).replace(/[&<>"'\/\\]/g, function(match) {
return replaceMap[match];
});
};
// Append an array of jQuery nodes to a given element.
Utils.appendMany = function($element, $nodes) {
// jQuery 1.7.x does not support $.fn.append() with an array
// Fall back to a jQuery object collection using $.fn.add()
if ($.fn.jquery.substr(0, 3) === '1.7') {
var $jqNodes = $();
$.map($nodes, function(node) {
$jqNodes = $jqNodes.add(node);
});
$nodes = $jqNodes;
}
$element.append($nodes);
};
// Cache objects in Utils.__cache instead of $.data (see #4346)
Utils.__cache = {};
var id = 0;
Utils.GetUniqueElementId = function(element) {
// Get a unique element Id. If element has no id,
// creates a new unique number, stores it in the id
// attribute and returns the new id.
// If an id already exists, it simply returns it.
var select2Id = element.getAttribute('data-select-id');
if (select2Id == null) {
// If element has id, use it.
if (element.id) {
select2Id = element.id;
element.setAttribute('data-select-id', select2Id);
} else {
element.setAttribute('data-select-id', ++id);
select2Id = id.toString();
}
}
return select2Id;
};
Utils.StoreData = function(element, name, value) {
// Stores an item in the cache for a specified element.
// name is the cache key.
var id = Utils.GetUniqueElementId(element);
if (!Utils.__cache[id]) {
Utils.__cache[id] = {};
}
Utils.__cache[id][name] = value;
};
Utils.GetData = function(element, name) {
// Retrieves a value from the cache by its key (name)
// name is optional. If no name specified, return
// all cache items for the specified element.
// and for a specified element.
var id = Utils.GetUniqueElementId(element);
if (name) {
if (Utils.__cache[id]) {
if (Utils.__cache[id][name] != null) {
return Utils.__cache[id][name];
}
return $(element).data(name); // Fallback to HTML5 data attribs.
}
return $(element).data(name); // Fallback to HTML5 data attribs.
} else {
return Utils.__cache[id];
}
};
Utils.RemoveData = function(element) {
// Removes all cached items for a specified element.
var id = Utils.GetUniqueElementId(element);
if (Utils.__cache[id] != null) {
delete Utils.__cache[id];
}
element.removeAttribute('data-select-id');
};
return Utils;
});
S2.define('select2/results', [
'jquery',
'./utils'
], function($, Utils) {
function Results($element, options, dataAdapter) {
this.$element = $element;
this.data = dataAdapter;
this.options = options;
Results.__super__.constructor.call(this);
}
Utils.Extend(Results, Utils.Observable);
Results.prototype.render = function() {
var $results = $(
''
);
if (this.options.get('multiple')) {
$results.attr('aria-multiselectable', 'true');
}
this.$results = $results;
return $results;
};
Results.prototype.clear = function() {
this.$results.empty();
};
Results.prototype.displayMessage = function(params) {
var escapeMarkup = this.options.get('escapeMarkup');
this.clear();
this.hideLoading();
var $message = $(
''
);
var message = this.options.get('translations').get(params.message);
$message.append(
escapeMarkup(
message(params.args)
)
);
$message[0].className += ' select2-results-message';
this.$results.append($message);
};
Results.prototype.hideMessages = function() {
this.$results.find('.select2-results-message').remove();
};
Results.prototype.append = function(data) {
this.hideLoading();
var $options = [];
if (data.results == null || data.results.length === 0) {
if (this.$results.children().length === 0) {
this.trigger('results:message', {
message: 'noResults'
});
}
return;
}
data.results = this.sort(data.results);
for (var d = 0; d < data.results.length; d++) {
var item = data.results[d];
var $option = this.option(item);
$options.push($option);
}
this.$results.append($options);
};
Results.prototype.position = function($results, $dropdown) {
var $resultsContainer = $dropdown.find('.select2-results');
$resultsContainer.append($results);
};
Results.prototype.sort = function(data) {
var sorter = this.options.get('sorter');
return sorter(data);
};
Results.prototype.highlightFirstItem = function() {
var $options = this.$results
.find('.select2-results-option[aria-selected]');
var $selected = $options.filter('[aria-selected=true]');
// Check if there are any selected options
if ($selected.length > 0) {
// If there are selected options, highlight the first
$selected.first().trigger('mouseenter');
} else {
// If there are no selected options, highlight the first option
// in the dropdown
$options.first().trigger('mouseenter');
}
this.ensureHighlightVisible();
};
Results.prototype.setClasses = function() {
var self = this;
this.data.current(function(selected) {
var selectedIds = $.map(selected, function(s) {
return s.id.toString();
});
var $options = self.$results
.find('.select2-results-option[aria-selected]');
$options.each(function() {
var $option = $(this);
var item = Utils.GetData(this, 'data');
// id needs to be converted to a string when comparing
var id = '' + item.id;
if ((item.element != null && item.element.selected) ||
(item.element == null && $.inArray(id, selectedIds) > -1)) {
$option.attr('aria-selected', 'true');
} else {
$option.attr('aria-selected', 'false');
}
});
});
};
Results.prototype.showLoading = function(params) {
this.hideLoading();
var loadingMore = this.options.get('translations').get('searching');
var loading = {
disabled: true,
loading: true,
text: loadingMore(params)
};
var $loading = this.option(loading);
$loading.className += ' loading-results';
this.$results.prepend($loading);
};
Results.prototype.hideLoading = function() {
this.$results.find('.loading-results').remove();
};
Results.prototype.option = function(data) {
var option = document.createElement('li');
option.className = 'select2-results-option';
var attrs = {
'role': 'option',
'aria-selected': 'false'
};
var matches = window.Element.prototype.matches ||
window.Element.prototype.msMatchesSelector ||
window.Element.prototype.webkitMatchesSelector;
if ((data.element != null && matches.call(data.element, ':disabled')) ||
(data.element == null && data.disabled)) {
delete attrs['aria-selected'];
attrs['aria-disabled'] = 'true';
}
if (data.id == null) {
delete attrs['aria-selected'];
}
if (data._resultId != null) {
option.id = data._resultId;
}
if (data.title) {
option.title = data.title;
}
if (data.children) {
attrs.role = 'group';
attrs['aria-label'] = data.text;
delete attrs['aria-selected'];
}
for (var attr in attrs) {
var val = attrs[attr];
option.setAttribute(attr, val);
}
if (data.children) {
var $option = $(option);
var label = document.createElement('strong');
label.className = 'select2-results-group';
var $label = $(label);
this.template(data, label);
var $children = [];
for (var c = 0; c < data.children.length; c++) {
var child = data.children[c];
var $child = this.option(child);
$children.push($child);
}
var $childrenContainer = $('', {
'class': 'select2-results-options select2-results-options-nested'
});
$childrenContainer.append($children);
$(".select2-results-options").axScroll(); //AXUI
$option.append(label);
$option.append($childrenContainer);
} else {
this.template(data, option);
}
Utils.StoreData(option, 'data', data);
return option;
};
Results.prototype.bind = function(container, $container) {
var self = this;
var id = container.id + '-results';
this.$results.attr('id', id);
container.on('results:all', function(params) {
self.clear();
self.append(params.data);
if (container.isOpen()) {
self.setClasses();
self.highlightFirstItem();
}
});
container.on('results:append', function(params) {
self.append(params.data);
if (container.isOpen()) {
self.setClasses();
}
});
container.on('query', function(params) {
self.hideMessages();
self.showLoading(params);
});
container.on('select', function() {
if (!container.isOpen()) {
return;
}
self.setClasses();
if (self.options.get('scrollAfterSelect')) {
self.highlightFirstItem();
}
});
container.on('unselect', function() {
if (!container.isOpen()) {
return;
}
self.setClasses();
if (self.options.get('scrollAfterSelect')) {
self.highlightFirstItem();
}
});
container.on('open', function() {
// When the dropdown is open, aria-expended="true"
self.$results.attr('aria-expanded', 'true');
self.$results.attr('aria-hidden', 'false');
self.setClasses();
self.ensureHighlightVisible();
});
container.on('close', function() {
// When the dropdown is closed, aria-expended="false"
self.$results.attr('aria-expanded', 'false');
self.$results.attr('aria-hidden', 'true');
self.$results.removeAttr('aria-activedescendant');
});
container.on('results:toggle', function() {
var $highlighted = self.getHighlightedResults();
if ($highlighted.length === 0) {
return;
}
$highlighted.trigger('mouseup');
});
container.on('results:select', function() {
var $highlighted = self.getHighlightedResults();
if ($highlighted.length === 0) {
return;
}
var data = Utils.GetData($highlighted[0], 'data');
if ($highlighted.attr('aria-selected') == 'true') {
self.trigger('close', {});
} else {
self.trigger('select', {
data: data
});
}
});
container.on('results:previous', function() {
var $highlighted = self.getHighlightedResults();
var $options = self.$results.find('[aria-selected]');
var currentIndex = $options.index($highlighted);
// If we are already at the top, don't move further
// If no options, currentIndex will be -1
if (currentIndex <= 0) {
return;
}
var nextIndex = currentIndex - 1;
// If none are highlighted, highlight the first
if ($highlighted.length === 0) {
nextIndex = 0;
}
var $next = $options.eq(nextIndex);
$next.trigger('mouseenter');
var currentOffset = self.$results.offset().top;
var nextTop = $next.offset().top;
var nextOffset = self.$results.scrollTop() + (nextTop - currentOffset);
if (nextIndex === 0) {
self.$results.scrollTop(0);
} else if (nextTop - currentOffset < 0) {
self.$results.scrollTop(nextOffset);
}
});
container.on('results:next', function() {
var $highlighted = self.getHighlightedResults();
var $options = self.$results.find('[aria-selected]');
var currentIndex = $options.index($highlighted);
var nextIndex = currentIndex + 1;
// If we are at the last option, stay there
if (nextIndex >= $options.length) {
return;
}
var $next = $options.eq(nextIndex);
$next.trigger('mouseenter');
var currentOffset = self.$results.offset().top +
self.$results.outerHeight(false);
var nextBottom = $next.offset().top + $next.outerHeight(false);
var nextOffset = self.$results.scrollTop() + nextBottom - currentOffset;
if (nextIndex === 0) {
self.$results.scrollTop(0);
} else if (nextBottom > currentOffset) {
self.$results.scrollTop(nextOffset);
}
});
container.on('results:focus', function(params) {
params.element.addClass('select2-results-option-highlighted');
});
container.on('results:message', function(params) {
self.displayMessage(params);
});
if ($.fn.mousewheel) {
this.$results.on('mousewheel', function(e) {
var top = self.$results.scrollTop();
var bottom = self.$results.get(0).scrollHeight - top + e.deltaY;
var isAtTop = e.deltaY > 0 && top - e.deltaY <= 0;
var isAtBottom = e.deltaY < 0 && bottom <= self.$results.height();
if (isAtTop) {
self.$results.scrollTop(0);
e.preventDefault();
e.stopPropagation();
} else if (isAtBottom) {
self.$results.scrollTop(
self.$results.get(0).scrollHeight - self.$results.height()
);
e.preventDefault();
e.stopPropagation();
}
});
}
this.$results.on('mouseup', '.select2-results-option[aria-selected]',
function(evt) {
var $this = $(this);
var data = Utils.GetData(this, 'data');
if ($this.attr('aria-selected') === 'true') {
if (self.options.get('multiple')) {
self.trigger('unselect', {
originalEvent: evt,
data: data
});
} else {
self.trigger('close', {});
}
return;
}
self.trigger('select', {
originalEvent: evt,
data: data
});
});
this.$results.on('mouseenter', '.select2-results-option[aria-selected]',
function(evt) {
var data = Utils.GetData(this, 'data');
self.getHighlightedResults()
.removeClass('select2-results-option-highlighted');
self.trigger('results:focus', {
data: data,
element: $(this)
});
});
};
Results.prototype.getHighlightedResults = function() {
var $highlighted = this.$results
.find('.select2-results-option-highlighted');
return $highlighted;
};
Results.prototype.destroy = function() {
this.$results.remove();
};
Results.prototype.ensureHighlightVisible = function() {
var $highlighted = this.getHighlightedResults();
if ($highlighted.length === 0) {
return;
}
var $options = this.$results.find('[aria-selected]');
var currentIndex = $options.index($highlighted);
var currentOffset = this.$results.offset().top;
var nextTop = $highlighted.offset().top;
var nextOffset = this.$results.scrollTop() + (nextTop - currentOffset);
var offsetDelta = nextTop - currentOffset;
nextOffset -= $highlighted.outerHeight(false) * 2;
if (currentIndex <= 2) {
this.$results.scrollTop(0);
} else if (offsetDelta > this.$results.outerHeight() || offsetDelta < 0) {
this.$results.scrollTop(nextOffset);
}
};
Results.prototype.template = function(result, container) {
var template = this.options.get('templateResult');
var escapeMarkup = this.options.get('escapeMarkup');
var content = template(result, container);
if (content == null) {
container.style.display = 'none';
} else if (typeof content === 'string') {
container.innerHTML = escapeMarkup(content);
} else {
$(container).append(content);
}
};
return Results;
});
S2.define('select2/keys', [
], function() {
var KEYS = {
BACKSPACE: 8,
TAB: 9,
ENTER: 13,
SHIFT: 16,
CTRL: 17,
ALT: 18,
ESC: 27,
SPACE: 32,
PAGE_UP: 33,
PAGE_DOWN: 34,
END: 35,
HOME: 36,
LEFT: 37,
UP: 38,
RIGHT: 39,
DOWN: 40,
DELETE: 46
};
return KEYS;
});
S2.define('select2/selection/base', [
'jquery',
'../utils',
'../keys'
], function($, Utils, KEYS) {
function BaseSelection($element, options) {
this.$element = $element;
this.options = options;
BaseSelection.__super__.constructor.call(this);
}
Utils.Extend(BaseSelection, Utils.Observable);
BaseSelection.prototype.render = function() {
var $selection = $(
'' +
''
);
this._tabindex = 0;
if (Utils.GetData(this.$element[0], 'old-tabindex') != null) {
this._tabindex = Utils.GetData(this.$element[0], 'old-tabindex');
} else if (this.$element.attr('tabindex') != null) {
this._tabindex = this.$element.attr('tabindex');
}
$selection.attr('title', this.$element.attr('title'));
$selection.attr('tabindex', this._tabindex);
$selection.attr('aria-disabled', 'false');
this.$selection = $selection;
return $selection;
};
BaseSelection.prototype.bind = function(container, $container) {
var self = this;
var resultsId = container.id + '-results';
this.container = container;
this.$selection.on('focus', function(evt) {
self.trigger('focus', evt);
});
this.$selection.on('blur', function(evt) {
self._handleBlur(evt);
});
this.$selection.on('keydown', function(evt) {
self.trigger('keypress', evt);
if (evt.which === KEYS.SPACE) {
evt.preventDefault();
}
});
container.on('results:focus', function(params) {
self.$selection.attr('aria-activedescendant', params.data._resultId);
});
container.on('selection:update', function(params) {
self.update(params.data);
});
container.on('open', function() {
// When the dropdown is open, aria-expanded="true"
self.$selection.attr('aria-expanded', 'true');
self.$selection.attr('aria-owns', resultsId);
self._attachCloseHandler(container);
});
container.on('close', function() {
// When the dropdown is closed, aria-expanded="false"
self.$selection.attr('aria-expanded', 'false');
self.$selection.removeAttr('aria-activedescendant');
self.$selection.removeAttr('aria-owns');
self.$selection.trigger('focus');
self._detachCloseHandler(container);
});
container.on('enable', function() {
self.$selection.attr('tabindex', self._tabindex);
self.$selection.attr('aria-disabled', 'false');
});
container.on('disable', function() {
self.$selection.attr('tabindex', '-1');
self.$selection.attr('aria-disabled', 'true');
});
};
BaseSelection.prototype._handleBlur = function(evt) {
var self = this;
// This needs to be delayed as the active element is the body when the tab
// key is pressed, possibly along with others.
window.setTimeout(function() {
// Don't trigger `blur` if the focus is still in the selection
if (
(document.activeElement == self.$selection[0]) ||
($.contains(self.$selection[0], document.activeElement))
) {
return;
}
self.trigger('blur', evt);
}, 1);
};
BaseSelection.prototype._attachCloseHandler = function(container) {
$(document.body).on('mousedown.select2.' + container.id, function(e) {
var $target = $(e.target);
var $select = $target.closest('.select2');
var $all = $('.select2.select-box-open');
$all.each(function() {
if (this == $select[0]) {
return;
}
var $element = Utils.GetData(this, 'element');
$element.select2('close');
});
});
};
BaseSelection.prototype._detachCloseHandler = function(container) {
$(document.body).off('mousedown.select2.' + container.id);
};
BaseSelection.prototype.position = function($selection, $container) {
var $selectionContainer = $container.find('.selection');
$selectionContainer.append($selection);
};
BaseSelection.prototype.destroy = function() {
this._detachCloseHandler(this.container);
};
BaseSelection.prototype.update = function(data) {
throw new Error('The `update` method must be defined in child classes.');
};
/**
* Helper method to abstract the "enabled" (not "disabled") state of this
* object.
*
* @return {true} if the instance is not disabled.
* @return {false} if the instance is disabled.
*/
BaseSelection.prototype.isEnabled = function() {
return !this.isDisabled();
};
/**
* Helper method to abstract the "disabled" state of this object.
*
* @return {true} if the disabled option is true.
* @return {false} if the disabled option is false.
*/
BaseSelection.prototype.isDisabled = function() {
return this.options.get('disabled');
};
return BaseSelection;
});
S2.define('select2/selection/single', [
'jquery',
'./base',
'../utils',
'../keys'
], function($, BaseSelection, Utils, KEYS) {
function SingleSelection() {
SingleSelection.__super__.constructor.apply(this, arguments);
}
Utils.Extend(SingleSelection, BaseSelection);
SingleSelection.prototype.render = function() {
var $selection = SingleSelection.__super__.render.call(this);
$selection.addClass('select-single');
$selection.html(
'' +
'' +
'' +
''
);
return $selection;
};
SingleSelection.prototype.bind = function(container, $container) {
var self = this;
SingleSelection.__super__.bind.apply(this, arguments);
var id = container.id + '-box';
this.$selection.find('.select-rendered')
.attr('id', id)
.attr('role', 'textbox')
.attr('aria-readonly', 'true');
this.$selection.attr('aria-labelledby', id);
this.$selection.on('mousedown', function(evt) {
// Only respond to left clicks
if (evt.which !== 1) {
return;
}
self.trigger('toggle', {
originalEvent: evt
});
});
this.$selection.on('focus', function(evt) {
// User focuses on the container
});
this.$selection.on('blur', function(evt) {
// User exits the container
});
container.on('focus', function(evt) {
if (!container.isOpen()) {
self.$selection.trigger('focus');
}
});
};
SingleSelection.prototype.clear = function() {
var $rendered = this.$selection.find('.select-rendered');
$rendered.empty();
$rendered.removeAttr('title'); // clear tooltip on empty
};
SingleSelection.prototype.display = function(data, container) {
var template = this.options.get('templateSelection');
var escapeMarkup = this.options.get('escapeMarkup');
return escapeMarkup(template(data, container));
};
SingleSelection.prototype.selectionContainer = function() {
return $('');
};
SingleSelection.prototype.update = function(data) {
if (data.length === 0) {
this.clear();
return;
}
var selection = data[0];
var $rendered = this.$selection.find('.select-rendered');
var formatted = this.display(selection, $rendered);
$rendered.empty().append(formatted);
var title = selection.title || selection.text;
if (title) {
$rendered.attr('title', title);
} else {
$rendered.removeAttr('title');
}
};
return SingleSelection;
});
S2.define('select2/selection/multiple', [
'jquery',
'./base',
'../utils'
], function($, BaseSelection, Utils) {
function MultipleSelection($element, options) {
MultipleSelection.__super__.constructor.apply(this, arguments);
}
Utils.Extend(MultipleSelection, BaseSelection);
MultipleSelection.prototype.render = function() {
var $selection = MultipleSelection.__super__.render.call(this);
$selection.addClass('select-multiple');
$selection.html(
''
);
return $selection;
};
MultipleSelection.prototype.bind = function(container, $container) {
var self = this;
MultipleSelection.__super__.bind.apply(this, arguments);
this.$selection.on('click', function(evt) {
self.trigger('toggle', {
originalEvent: evt
});
});
this.$selection.on(
'click',
'.select-text-choice-remove',
function(evt) {
// Ignore the event if it is disabled
if (self.isDisabled()) {
return;
}
var $remove = $(this);
var $selection = $remove.parent();
var data = Utils.GetData($selection[0], 'data');
self.trigger('unselect', {
originalEvent: evt,
data: data
});
}
);
};
MultipleSelection.prototype.clear = function() {
var $rendered = this.$selection.find('.select-rendered');
$rendered.empty();
$rendered.removeAttr('title');
};
MultipleSelection.prototype.display = function(data, container) {
var template = this.options.get('templateSelection');
var escapeMarkup = this.options.get('escapeMarkup');
return escapeMarkup(template(data, container));
};
MultipleSelection.prototype.selectionContainer = function() {
var $container = $(
'' +
'' +
'×' +
'' +
''
);
return $container;
};
MultipleSelection.prototype.update = function(data) {
this.clear();
if (data.length === 0) {
return;
}
var $selections = [];
for (var d = 0; d < data.length; d++) {
var selection = data[d];
var $selection = this.selectionContainer();
var formatted = this.display(selection, $selection);
$selection.append(formatted);
var title = selection.title || selection.text;
if (title) {
$selection.attr('title', title);
}
Utils.StoreData($selection[0], 'data', selection);
$selections.push($selection);
}
var $rendered = this.$selection.find('.select-rendered');
Utils.appendMany($rendered, $selections);
};
return MultipleSelection;
});
S2.define('select2/selection/placeholder', [
'../utils'
], function(Utils) {
function Placeholder(decorated, $element, options) {
this.placeholder = this.normalizePlaceholder(options.get('placeholder'));
decorated.call(this, $element, options);
}
Placeholder.prototype.normalizePlaceholder = function(_, placeholder) {
if (typeof placeholder === 'string') {
placeholder = {
id: '',
text: placeholder
};
}
return placeholder;
};
Placeholder.prototype.createPlaceholder = function(decorated, placeholder) {
var $placeholder = this.selectionContainer();
$placeholder.html(this.display(placeholder));
$placeholder.addClass('select-text-placeholder')
.removeClass('select-text-choice');
return $placeholder;
};
Placeholder.prototype.update = function(decorated, data) {
var singlePlaceholder = (
data.length == 1 && data[0].id != this.placeholder.id
);
var multipleSelections = data.length > 1;
if (multipleSelections || singlePlaceholder) {
return decorated.call(this, data);
}
this.clear();
var $placeholder = this.createPlaceholder(this.placeholder);
this.$selection.find('.select-rendered').append($placeholder);
};
return Placeholder;
});
S2.define('select2/selection/allowClear', [
'jquery',
'../keys',
'../utils'
], function($, KEYS, Utils) {
function AllowClear() {}
AllowClear.prototype.bind = function(decorated, container, $container) {
var self = this;
decorated.call(this, container, $container);
if (this.placeholder == null) {
if (this.options.get('debug') && window.console && console.error) {
console.error(
'Select2: The `allowClear` option should be used in combination ' +
'with the `placeholder` option.'
);
}
}
this.$selection.on('mousedown', '.select-text-clear',
function(evt) {
self._handleClear(evt);
});
container.on('keypress', function(evt) {
self._handleKeyboardClear(evt, container);
});
};
AllowClear.prototype._handleClear = function(_, evt) {
// Ignore the event if it is disabled
if (this.isDisabled()) {
return;
}
var $clear = this.$selection.find('.select-text-clear');
// Ignore the event if nothing has been selected
if ($clear.length === 0) {
return;
}
evt.stopPropagation();
var data = Utils.GetData($clear[0], 'data');
var previousVal = this.$element.val();
this.$element.val(this.placeholder.id);
var unselectData = {
data: data
};
this.trigger('clear', unselectData);
if (unselectData.prevented) {
this.$element.val(previousVal);
return;
}
for (var d = 0; d < data.length; d++) {
unselectData = {
data: data[d]
};
// Trigger the `unselect` event, so people can prevent it from being
// cleared.
this.trigger('unselect', unselectData);
// If the event was prevented, don't clear it out.
if (unselectData.prevented) {
this.$element.val(previousVal);
return;
}
}
this.$element.trigger('input').trigger('change');
this.trigger('toggle', {});
};
AllowClear.prototype._handleKeyboardClear = function(_, evt, container) {
if (container.isOpen()) {
return;
}
if (evt.which == KEYS.DELETE || evt.which == KEYS.BACKSPACE) {
this._handleClear(evt);
}
};
AllowClear.prototype.update = function(decorated, data) {
decorated.call(this, data);
if (this.$selection.find('.select-text-placeholder').length > 0 ||
data.length === 0) {
return;
}
var removeAll = this.options.get('translations').get('removeAllItems');
var $remove = $(
'' +
'×' +
''
);
Utils.StoreData($remove[0], 'data', data);
this.$selection.find('.select-rendered').prepend($remove);
};
return AllowClear;
});
S2.define('select2/selection/search', [
'jquery',
'../utils',
'../keys'
], function($, Utils, KEYS) {
function Search(decorated, $element, options) {
decorated.call(this, $element, options);
}
Search.prototype.render = function(decorated) {
var $search = $(
'' +
'' +
''
);
this.$searchContainer = $search;
this.$search = $search.find('input');
var $rendered = decorated.call(this);
this._transferTabIndex();
return $rendered;
};
Search.prototype.bind = function(decorated, container, $container) {
var self = this;
var resultsId = container.id + '-results';
decorated.call(this, container, $container);
container.on('open', function() {
self.$search.attr('aria-controls', resultsId);
self.$search.trigger('focus');
});
container.on('close', function() {
self.$search.val('');
self.$search.removeAttr('aria-controls');
self.$search.removeAttr('aria-activedescendant');
self.$search.trigger('focus');
});
container.on('enable', function() {
self.$search.prop('disabled', false);
self._transferTabIndex();
});
container.on('disable', function() {
self.$search.prop('disabled', true);
});
container.on('focus', function(evt) {
self.$search.trigger('focus');
});
container.on('results:focus', function(params) {
if (params.data._resultId) {
self.$search.attr('aria-activedescendant', params.data._resultId);
} else {
self.$search.removeAttr('aria-activedescendant');
}
});
this.$selection.on('focusin', '.select2-search-inline', function(evt) {
self.trigger('focus', evt);
});
this.$selection.on('focusout', '.select2-search-inline', function(evt) {
self._handleBlur(evt);
});
this.$selection.on('keydown', '.select2-search-inline', function(evt) {
evt.stopPropagation();
self.trigger('keypress', evt);
self._keyUpPrevented = evt.isDefaultPrevented();
var key = evt.which;
if (key === KEYS.BACKSPACE && self.$search.val() === '') {
var $previousChoice = self.$searchContainer
.prev('.select-text-choice');
if ($previousChoice.length > 0) {
var item = Utils.GetData($previousChoice[0], 'data');
self.searchRemoveChoice(item);
evt.preventDefault();
}
}
});
this.$selection.on('click', '.select2-search-inline', function(evt) {
if (self.$search.val()) {
evt.stopPropagation();
}
});
// Try to detect the IE version should the `documentMode` property that
// is stored on the document. This is only implemented in IE and is
// slightly cleaner than doing a user agent check.
// This property is not available in Edge, but Edge also doesn't have
// this bug.
var msie = document.documentMode;
var disableInputEvents = msie && msie <= 11;
// Workaround for browsers which do not support the `input` event
// This will prevent double-triggering of events for browsers which support
// both the `keyup` and `input` events.
this.$selection.on(
'input.searchcheck',
'.select2-search-inline',
function(evt) {
// IE will trigger the `input` event when a placeholder is used on a
// search box. To get around this issue, we are forced to ignore all
// `input` events in IE and keep using `keyup`.
if (disableInputEvents) {
self.$selection.off('input.search input.searchcheck');
return;
}
// Unbind the duplicated `keyup` event
self.$selection.off('keyup.search');
}
);
this.$selection.on(
'keyup.search input.search',
'.select2-search-inline',
function(evt) {
// IE will trigger the `input` event when a placeholder is used on a
// search box. To get around this issue, we are forced to ignore all
// `input` events in IE and keep using `keyup`.
if (disableInputEvents && evt.type === 'input') {
self.$selection.off('input.search input.searchcheck');
return;
}
var key = evt.which;
// We can freely ignore events from modifier keys
if (key == KEYS.SHIFT || key == KEYS.CTRL || key == KEYS.ALT) {
return;
}
// Tabbing will be handled during the `keydown` phase
if (key == KEYS.TAB) {
return;
}
self.handleSearch(evt);
}
);
};
/**
* This method will transfer the tabindex attribute from the rendered
* selection to the search box. This allows for the search box to be used as
* the primary focus instead of the selection container.
*
* @private
*/
Search.prototype._transferTabIndex = function(decorated) {
this.$search.attr('tabindex', this.$selection.attr('tabindex'));
this.$selection.attr('tabindex', '-1');
};
Search.prototype.createPlaceholder = function(decorated, placeholder) {
this.$search.attr('placeholder', placeholder.text);
};
Search.prototype.update = function(decorated, data) {
var searchHadFocus = this.$search[0] == document.activeElement;
this.$search.attr('placeholder', '');
decorated.call(this, data);
this.$selection.find('.select-rendered')
.append(this.$searchContainer);
this.resizeSearch();
if (searchHadFocus) {
this.$search.trigger('focus');
}
};
Search.prototype.handleSearch = function() {
this.resizeSearch();
if (!this._keyUpPrevented) {
var input = this.$search.val();
this.trigger('query', {
term: input
});
}
this._keyUpPrevented = false;
};
Search.prototype.searchRemoveChoice = function(decorated, item) {
this.trigger('unselect', {
data: item
});
this.$search.val(item.text);
this.handleSearch();
};
Search.prototype.resizeSearch = function() {
this.$search.css('width', '25px');
var width = '';
if (this.$search.attr('placeholder') !== '') {
width = this.$selection.find('.select-rendered').width();
} else {
var minimumWidth = this.$search.val().length + 1;
width = 'calc(' + (minimumWidth * 0.75) + 'em + 20px)'; //AXUI
}
this.$search.css('width', width);
};
return Search;
});
S2.define('select2/selection/eventRelay', [
'jquery'
], function($) {
function EventRelay() {}
EventRelay.prototype.bind = function(decorated, container, $container) {
var self = this;
var relayEvents = [
'open', 'opening',
'close', 'closing',
'select', 'selecting',
'unselect', 'unselecting',
'clear', 'clearing'
];
var preventableEvents = [
'opening', 'closing', 'selecting', 'unselecting', 'clearing'
];
decorated.call(this, container, $container);
container.on('*', function(name, params) {
// Ignore events that should not be relayed
if ($.inArray(name, relayEvents) === -1) {
return;
}
// The parameters should always be an object
params = params || {};
// Generate the jQuery event for the Select2 event
var evt = $.Event('select2:' + name, {
params: params
});
self.$element.trigger(evt);
// Only handle preventable events if it was one
if ($.inArray(name, preventableEvents) === -1) {
return;
}
params.prevented = evt.isDefaultPrevented();
});
};
return EventRelay;
});
S2.define('select2/translation', [
'jquery',
'require'
], function($, require) {
function Translation(dict) {
this.dict = dict || {};
}
Translation.prototype.all = function() {
return this.dict;
};
Translation.prototype.get = function(key) {
return this.dict[key];
};
Translation.prototype.extend = function(translation) {
this.dict = $.extend({}, translation.all(), this.dict);
};
// Static functions
Translation._cache = {};
Translation.loadPath = function(path) {
if (!(path in Translation._cache)) {
var translations = require(path);
Translation._cache[path] = translations;
}
return new Translation(Translation._cache[path]);
};
return Translation;
});
S2.define('select2/diacritics', [
], function() {
var diacritics = {
'\u24B6': 'A',
'\uFF21': 'A',
'\u00C0': 'A',
'\u00C1': 'A',
'\u00C2': 'A',
'\u1EA6': 'A',
'\u1EA4': 'A',
'\u1EAA': 'A',
'\u1EA8': 'A',
'\u00C3': 'A',
'\u0100': 'A',
'\u0102': 'A',
'\u1EB0': 'A',
'\u1EAE': 'A',
'\u1EB4': 'A',
'\u1EB2': 'A',
'\u0226': 'A',
'\u01E0': 'A',
'\u00C4': 'A',
'\u01DE': 'A',
'\u1EA2': 'A',
'\u00C5': 'A',
'\u01FA': 'A',
'\u01CD': 'A',
'\u0200': 'A',
'\u0202': 'A',
'\u1EA0': 'A',
'\u1EAC': 'A',
'\u1EB6': 'A',
'\u1E00': 'A',
'\u0104': 'A',
'\u023A': 'A',
'\u2C6F': 'A',
'\uA732': 'AA',
'\u00C6': 'AE',
'\u01FC': 'AE',
'\u01E2': 'AE',
'\uA734': 'AO',
'\uA736': 'AU',
'\uA738': 'AV',
'\uA73A': 'AV',
'\uA73C': 'AY',
'\u24B7': 'B',
'\uFF22': 'B',
'\u1E02': 'B',
'\u1E04': 'B',
'\u1E06': 'B',
'\u0243': 'B',
'\u0182': 'B',
'\u0181': 'B',
'\u24B8': 'C',
'\uFF23': 'C',
'\u0106': 'C',
'\u0108': 'C',
'\u010A': 'C',
'\u010C': 'C',
'\u00C7': 'C',
'\u1E08': 'C',
'\u0187': 'C',
'\u023B': 'C',
'\uA73E': 'C',
'\u24B9': 'D',
'\uFF24': 'D',
'\u1E0A': 'D',
'\u010E': 'D',
'\u1E0C': 'D',
'\u1E10': 'D',
'\u1E12': 'D',
'\u1E0E': 'D',
'\u0110': 'D',
'\u018B': 'D',
'\u018A': 'D',
'\u0189': 'D',
'\uA779': 'D',
'\u01F1': 'DZ',
'\u01C4': 'DZ',
'\u01F2': 'Dz',
'\u01C5': 'Dz',
'\u24BA': 'E',
'\uFF25': 'E',
'\u00C8': 'E',
'\u00C9': 'E',
'\u00CA': 'E',
'\u1EC0': 'E',
'\u1EBE': 'E',
'\u1EC4': 'E',
'\u1EC2': 'E',
'\u1EBC': 'E',
'\u0112': 'E',
'\u1E14': 'E',
'\u1E16': 'E',
'\u0114': 'E',
'\u0116': 'E',
'\u00CB': 'E',
'\u1EBA': 'E',
'\u011A': 'E',
'\u0204': 'E',
'\u0206': 'E',
'\u1EB8': 'E',
'\u1EC6': 'E',
'\u0228': 'E',
'\u1E1C': 'E',
'\u0118': 'E',
'\u1E18': 'E',
'\u1E1A': 'E',
'\u0190': 'E',
'\u018E': 'E',
'\u24BB': 'F',
'\uFF26': 'F',
'\u1E1E': 'F',
'\u0191': 'F',
'\uA77B': 'F',
'\u24BC': 'G',
'\uFF27': 'G',
'\u01F4': 'G',
'\u011C': 'G',
'\u1E20': 'G',
'\u011E': 'G',
'\u0120': 'G',
'\u01E6': 'G',
'\u0122': 'G',
'\u01E4': 'G',
'\u0193': 'G',
'\uA7A0': 'G',
'\uA77D': 'G',
'\uA77E': 'G',
'\u24BD': 'H',
'\uFF28': 'H',
'\u0124': 'H',
'\u1E22': 'H',
'\u1E26': 'H',
'\u021E': 'H',
'\u1E24': 'H',
'\u1E28': 'H',
'\u1E2A': 'H',
'\u0126': 'H',
'\u2C67': 'H',
'\u2C75': 'H',
'\uA78D': 'H',
'\u24BE': 'I',
'\uFF29': 'I',
'\u00CC': 'I',
'\u00CD': 'I',
'\u00CE': 'I',
'\u0128': 'I',
'\u012A': 'I',
'\u012C': 'I',
'\u0130': 'I',
'\u00CF': 'I',
'\u1E2E': 'I',
'\u1EC8': 'I',
'\u01CF': 'I',
'\u0208': 'I',
'\u020A': 'I',
'\u1ECA': 'I',
'\u012E': 'I',
'\u1E2C': 'I',
'\u0197': 'I',
'\u24BF': 'J',
'\uFF2A': 'J',
'\u0134': 'J',
'\u0248': 'J',
'\u24C0': 'K',
'\uFF2B': 'K',
'\u1E30': 'K',
'\u01E8': 'K',
'\u1E32': 'K',
'\u0136': 'K',
'\u1E34': 'K',
'\u0198': 'K',
'\u2C69': 'K',
'\uA740': 'K',
'\uA742': 'K',
'\uA744': 'K',
'\uA7A2': 'K',
'\u24C1': 'L',
'\uFF2C': 'L',
'\u013F': 'L',
'\u0139': 'L',
'\u013D': 'L',
'\u1E36': 'L',
'\u1E38': 'L',
'\u013B': 'L',
'\u1E3C': 'L',
'\u1E3A': 'L',
'\u0141': 'L',
'\u023D': 'L',
'\u2C62': 'L',
'\u2C60': 'L',
'\uA748': 'L',
'\uA746': 'L',
'\uA780': 'L',
'\u01C7': 'LJ',
'\u01C8': 'Lj',
'\u24C2': 'M',
'\uFF2D': 'M',
'\u1E3E': 'M',
'\u1E40': 'M',
'\u1E42': 'M',
'\u2C6E': 'M',
'\u019C': 'M',
'\u24C3': 'N',
'\uFF2E': 'N',
'\u01F8': 'N',
'\u0143': 'N',
'\u00D1': 'N',
'\u1E44': 'N',
'\u0147': 'N',
'\u1E46': 'N',
'\u0145': 'N',
'\u1E4A': 'N',
'\u1E48': 'N',
'\u0220': 'N',
'\u019D': 'N',
'\uA790': 'N',
'\uA7A4': 'N',
'\u01CA': 'NJ',
'\u01CB': 'Nj',
'\u24C4': 'O',
'\uFF2F': 'O',
'\u00D2': 'O',
'\u00D3': 'O',
'\u00D4': 'O',
'\u1ED2': 'O',
'\u1ED0': 'O',
'\u1ED6': 'O',
'\u1ED4': 'O',
'\u00D5': 'O',
'\u1E4C': 'O',
'\u022C': 'O',
'\u1E4E': 'O',
'\u014C': 'O',
'\u1E50': 'O',
'\u1E52': 'O',
'\u014E': 'O',
'\u022E': 'O',
'\u0230': 'O',
'\u00D6': 'O',
'\u022A': 'O',
'\u1ECE': 'O',
'\u0150': 'O',
'\u01D1': 'O',
'\u020C': 'O',
'\u020E': 'O',
'\u01A0': 'O',
'\u1EDC': 'O',
'\u1EDA': 'O',
'\u1EE0': 'O',
'\u1EDE': 'O',
'\u1EE2': 'O',
'\u1ECC': 'O',
'\u1ED8': 'O',
'\u01EA': 'O',
'\u01EC': 'O',
'\u00D8': 'O',
'\u01FE': 'O',
'\u0186': 'O',
'\u019F': 'O',
'\uA74A': 'O',
'\uA74C': 'O',
'\u0152': 'OE',
'\u01A2': 'OI',
'\uA74E': 'OO',
'\u0222': 'OU',
'\u24C5': 'P',
'\uFF30': 'P',
'\u1E54': 'P',
'\u1E56': 'P',
'\u01A4': 'P',
'\u2C63': 'P',
'\uA750': 'P',
'\uA752': 'P',
'\uA754': 'P',
'\u24C6': 'Q',
'\uFF31': 'Q',
'\uA756': 'Q',
'\uA758': 'Q',
'\u024A': 'Q',
'\u24C7': 'R',
'\uFF32': 'R',
'\u0154': 'R',
'\u1E58': 'R',
'\u0158': 'R',
'\u0210': 'R',
'\u0212': 'R',
'\u1E5A': 'R',
'\u1E5C': 'R',
'\u0156': 'R',
'\u1E5E': 'R',
'\u024C': 'R',
'\u2C64': 'R',
'\uA75A': 'R',
'\uA7A6': 'R',
'\uA782': 'R',
'\u24C8': 'S',
'\uFF33': 'S',
'\u1E9E': 'S',
'\u015A': 'S',
'\u1E64': 'S',
'\u015C': 'S',
'\u1E60': 'S',
'\u0160': 'S',
'\u1E66': 'S',
'\u1E62': 'S',
'\u1E68': 'S',
'\u0218': 'S',
'\u015E': 'S',
'\u2C7E': 'S',
'\uA7A8': 'S',
'\uA784': 'S',
'\u24C9': 'T',
'\uFF34': 'T',
'\u1E6A': 'T',
'\u0164': 'T',
'\u1E6C': 'T',
'\u021A': 'T',
'\u0162': 'T',
'\u1E70': 'T',
'\u1E6E': 'T',
'\u0166': 'T',
'\u01AC': 'T',
'\u01AE': 'T',
'\u023E': 'T',
'\uA786': 'T',
'\uA728': 'TZ',
'\u24CA': 'U',
'\uFF35': 'U',
'\u00D9': 'U',
'\u00DA': 'U',
'\u00DB': 'U',
'\u0168': 'U',
'\u1E78': 'U',
'\u016A': 'U',
'\u1E7A': 'U',
'\u016C': 'U',
'\u00DC': 'U',
'\u01DB': 'U',
'\u01D7': 'U',
'\u01D5': 'U',
'\u01D9': 'U',
'\u1EE6': 'U',
'\u016E': 'U',
'\u0170': 'U',
'\u01D3': 'U',
'\u0214': 'U',
'\u0216': 'U',
'\u01AF': 'U',
'\u1EEA': 'U',
'\u1EE8': 'U',
'\u1EEE': 'U',
'\u1EEC': 'U',
'\u1EF0': 'U',
'\u1EE4': 'U',
'\u1E72': 'U',
'\u0172': 'U',
'\u1E76': 'U',
'\u1E74': 'U',
'\u0244': 'U',
'\u24CB': 'V',
'\uFF36': 'V',
'\u1E7C': 'V',
'\u1E7E': 'V',
'\u01B2': 'V',
'\uA75E': 'V',
'\u0245': 'V',
'\uA760': 'VY',
'\u24CC': 'W',
'\uFF37': 'W',
'\u1E80': 'W',
'\u1E82': 'W',
'\u0174': 'W',
'\u1E86': 'W',
'\u1E84': 'W',
'\u1E88': 'W',
'\u2C72': 'W',
'\u24CD': 'X',
'\uFF38': 'X',
'\u1E8A': 'X',
'\u1E8C': 'X',
'\u24CE': 'Y',
'\uFF39': 'Y',
'\u1EF2': 'Y',
'\u00DD': 'Y',
'\u0176': 'Y',
'\u1EF8': 'Y',
'\u0232': 'Y',
'\u1E8E': 'Y',
'\u0178': 'Y',
'\u1EF6': 'Y',
'\u1EF4': 'Y',
'\u01B3': 'Y',
'\u024E': 'Y',
'\u1EFE': 'Y',
'\u24CF': 'Z',
'\uFF3A': 'Z',
'\u0179': 'Z',
'\u1E90': 'Z',
'\u017B': 'Z',
'\u017D': 'Z',
'\u1E92': 'Z',
'\u1E94': 'Z',
'\u01B5': 'Z',
'\u0224': 'Z',
'\u2C7F': 'Z',
'\u2C6B': 'Z',
'\uA762': 'Z',
'\u24D0': 'a',
'\uFF41': 'a',
'\u1E9A': 'a',
'\u00E0': 'a',
'\u00E1': 'a',
'\u00E2': 'a',
'\u1EA7': 'a',
'\u1EA5': 'a',
'\u1EAB': 'a',
'\u1EA9': 'a',
'\u00E3': 'a',
'\u0101': 'a',
'\u0103': 'a',
'\u1EB1': 'a',
'\u1EAF': 'a',
'\u1EB5': 'a',
'\u1EB3': 'a',
'\u0227': 'a',
'\u01E1': 'a',
'\u00E4': 'a',
'\u01DF': 'a',
'\u1EA3': 'a',
'\u00E5': 'a',
'\u01FB': 'a',
'\u01CE': 'a',
'\u0201': 'a',
'\u0203': 'a',
'\u1EA1': 'a',
'\u1EAD': 'a',
'\u1EB7': 'a',
'\u1E01': 'a',
'\u0105': 'a',
'\u2C65': 'a',
'\u0250': 'a',
'\uA733': 'aa',
'\u00E6': 'ae',
'\u01FD': 'ae',
'\u01E3': 'ae',
'\uA735': 'ao',
'\uA737': 'au',
'\uA739': 'av',
'\uA73B': 'av',
'\uA73D': 'ay',
'\u24D1': 'b',
'\uFF42': 'b',
'\u1E03': 'b',
'\u1E05': 'b',
'\u1E07': 'b',
'\u0180': 'b',
'\u0183': 'b',
'\u0253': 'b',
'\u24D2': 'c',
'\uFF43': 'c',
'\u0107': 'c',
'\u0109': 'c',
'\u010B': 'c',
'\u010D': 'c',
'\u00E7': 'c',
'\u1E09': 'c',
'\u0188': 'c',
'\u023C': 'c',
'\uA73F': 'c',
'\u2184': 'c',
'\u24D3': 'd',
'\uFF44': 'd',
'\u1E0B': 'd',
'\u010F': 'd',
'\u1E0D': 'd',
'\u1E11': 'd',
'\u1E13': 'd',
'\u1E0F': 'd',
'\u0111': 'd',
'\u018C': 'd',
'\u0256': 'd',
'\u0257': 'd',
'\uA77A': 'd',
'\u01F3': 'dz',
'\u01C6': 'dz',
'\u24D4': 'e',
'\uFF45': 'e',
'\u00E8': 'e',
'\u00E9': 'e',
'\u00EA': 'e',
'\u1EC1': 'e',
'\u1EBF': 'e',
'\u1EC5': 'e',
'\u1EC3': 'e',
'\u1EBD': 'e',
'\u0113': 'e',
'\u1E15': 'e',
'\u1E17': 'e',
'\u0115': 'e',
'\u0117': 'e',
'\u00EB': 'e',
'\u1EBB': 'e',
'\u011B': 'e',
'\u0205': 'e',
'\u0207': 'e',
'\u1EB9': 'e',
'\u1EC7': 'e',
'\u0229': 'e',
'\u1E1D': 'e',
'\u0119': 'e',
'\u1E19': 'e',
'\u1E1B': 'e',
'\u0247': 'e',
'\u025B': 'e',
'\u01DD': 'e',
'\u24D5': 'f',
'\uFF46': 'f',
'\u1E1F': 'f',
'\u0192': 'f',
'\uA77C': 'f',
'\u24D6': 'g',
'\uFF47': 'g',
'\u01F5': 'g',
'\u011D': 'g',
'\u1E21': 'g',
'\u011F': 'g',
'\u0121': 'g',
'\u01E7': 'g',
'\u0123': 'g',
'\u01E5': 'g',
'\u0260': 'g',
'\uA7A1': 'g',
'\u1D79': 'g',
'\uA77F': 'g',
'\u24D7': 'h',
'\uFF48': 'h',
'\u0125': 'h',
'\u1E23': 'h',
'\u1E27': 'h',
'\u021F': 'h',
'\u1E25': 'h',
'\u1E29': 'h',
'\u1E2B': 'h',
'\u1E96': 'h',
'\u0127': 'h',
'\u2C68': 'h',
'\u2C76': 'h',
'\u0265': 'h',
'\u0195': 'hv',
'\u24D8': 'i',
'\uFF49': 'i',
'\u00EC': 'i',
'\u00ED': 'i',
'\u00EE': 'i',
'\u0129': 'i',
'\u012B': 'i',
'\u012D': 'i',
'\u00EF': 'i',
'\u1E2F': 'i',
'\u1EC9': 'i',
'\u01D0': 'i',
'\u0209': 'i',
'\u020B': 'i',
'\u1ECB': 'i',
'\u012F': 'i',
'\u1E2D': 'i',
'\u0268': 'i',
'\u0131': 'i',
'\u24D9': 'j',
'\uFF4A': 'j',
'\u0135': 'j',
'\u01F0': 'j',
'\u0249': 'j',
'\u24DA': 'k',
'\uFF4B': 'k',
'\u1E31': 'k',
'\u01E9': 'k',
'\u1E33': 'k',
'\u0137': 'k',
'\u1E35': 'k',
'\u0199': 'k',
'\u2C6A': 'k',
'\uA741': 'k',
'\uA743': 'k',
'\uA745': 'k',
'\uA7A3': 'k',
'\u24DB': 'l',
'\uFF4C': 'l',
'\u0140': 'l',
'\u013A': 'l',
'\u013E': 'l',
'\u1E37': 'l',
'\u1E39': 'l',
'\u013C': 'l',
'\u1E3D': 'l',
'\u1E3B': 'l',
'\u017F': 'l',
'\u0142': 'l',
'\u019A': 'l',
'\u026B': 'l',
'\u2C61': 'l',
'\uA749': 'l',
'\uA781': 'l',
'\uA747': 'l',
'\u01C9': 'lj',
'\u24DC': 'm',
'\uFF4D': 'm',
'\u1E3F': 'm',
'\u1E41': 'm',
'\u1E43': 'm',
'\u0271': 'm',
'\u026F': 'm',
'\u24DD': 'n',
'\uFF4E': 'n',
'\u01F9': 'n',
'\u0144': 'n',
'\u00F1': 'n',
'\u1E45': 'n',
'\u0148': 'n',
'\u1E47': 'n',
'\u0146': 'n',
'\u1E4B': 'n',
'\u1E49': 'n',
'\u019E': 'n',
'\u0272': 'n',
'\u0149': 'n',
'\uA791': 'n',
'\uA7A5': 'n',
'\u01CC': 'nj',
'\u24DE': 'o',
'\uFF4F': 'o',
'\u00F2': 'o',
'\u00F3': 'o',
'\u00F4': 'o',
'\u1ED3': 'o',
'\u1ED1': 'o',
'\u1ED7': 'o',
'\u1ED5': 'o',
'\u00F5': 'o',
'\u1E4D': 'o',
'\u022D': 'o',
'\u1E4F': 'o',
'\u014D': 'o',
'\u1E51': 'o',
'\u1E53': 'o',
'\u014F': 'o',
'\u022F': 'o',
'\u0231': 'o',
'\u00F6': 'o',
'\u022B': 'o',
'\u1ECF': 'o',
'\u0151': 'o',
'\u01D2': 'o',
'\u020D': 'o',
'\u020F': 'o',
'\u01A1': 'o',
'\u1EDD': 'o',
'\u1EDB': 'o',
'\u1EE1': 'o',
'\u1EDF': 'o',
'\u1EE3': 'o',
'\u1ECD': 'o',
'\u1ED9': 'o',
'\u01EB': 'o',
'\u01ED': 'o',
'\u00F8': 'o',
'\u01FF': 'o',
'\u0254': 'o',
'\uA74B': 'o',
'\uA74D': 'o',
'\u0275': 'o',
'\u0153': 'oe',
'\u01A3': 'oi',
'\u0223': 'ou',
'\uA74F': 'oo',
'\u24DF': 'p',
'\uFF50': 'p',
'\u1E55': 'p',
'\u1E57': 'p',
'\u01A5': 'p',
'\u1D7D': 'p',
'\uA751': 'p',
'\uA753': 'p',
'\uA755': 'p',
'\u24E0': 'q',
'\uFF51': 'q',
'\u024B': 'q',
'\uA757': 'q',
'\uA759': 'q',
'\u24E1': 'r',
'\uFF52': 'r',
'\u0155': 'r',
'\u1E59': 'r',
'\u0159': 'r',
'\u0211': 'r',
'\u0213': 'r',
'\u1E5B': 'r',
'\u1E5D': 'r',
'\u0157': 'r',
'\u1E5F': 'r',
'\u024D': 'r',
'\u027D': 'r',
'\uA75B': 'r',
'\uA7A7': 'r',
'\uA783': 'r',
'\u24E2': 's',
'\uFF53': 's',
'\u00DF': 's',
'\u015B': 's',
'\u1E65': 's',
'\u015D': 's',
'\u1E61': 's',
'\u0161': 's',
'\u1E67': 's',
'\u1E63': 's',
'\u1E69': 's',
'\u0219': 's',
'\u015F': 's',
'\u023F': 's',
'\uA7A9': 's',
'\uA785': 's',
'\u1E9B': 's',
'\u24E3': 't',
'\uFF54': 't',
'\u1E6B': 't',
'\u1E97': 't',
'\u0165': 't',
'\u1E6D': 't',
'\u021B': 't',
'\u0163': 't',
'\u1E71': 't',
'\u1E6F': 't',
'\u0167': 't',
'\u01AD': 't',
'\u0288': 't',
'\u2C66': 't',
'\uA787': 't',
'\uA729': 'tz',
'\u24E4': 'u',
'\uFF55': 'u',
'\u00F9': 'u',
'\u00FA': 'u',
'\u00FB': 'u',
'\u0169': 'u',
'\u1E79': 'u',
'\u016B': 'u',
'\u1E7B': 'u',
'\u016D': 'u',
'\u00FC': 'u',
'\u01DC': 'u',
'\u01D8': 'u',
'\u01D6': 'u',
'\u01DA': 'u',
'\u1EE7': 'u',
'\u016F': 'u',
'\u0171': 'u',
'\u01D4': 'u',
'\u0215': 'u',
'\u0217': 'u',
'\u01B0': 'u',
'\u1EEB': 'u',
'\u1EE9': 'u',
'\u1EEF': 'u',
'\u1EED': 'u',
'\u1EF1': 'u',
'\u1EE5': 'u',
'\u1E73': 'u',
'\u0173': 'u',
'\u1E77': 'u',
'\u1E75': 'u',
'\u0289': 'u',
'\u24E5': 'v',
'\uFF56': 'v',
'\u1E7D': 'v',
'\u1E7F': 'v',
'\u028B': 'v',
'\uA75F': 'v',
'\u028C': 'v',
'\uA761': 'vy',
'\u24E6': 'w',
'\uFF57': 'w',
'\u1E81': 'w',
'\u1E83': 'w',
'\u0175': 'w',
'\u1E87': 'w',
'\u1E85': 'w',
'\u1E98': 'w',
'\u1E89': 'w',
'\u2C73': 'w',
'\u24E7': 'x',
'\uFF58': 'x',
'\u1E8B': 'x',
'\u1E8D': 'x',
'\u24E8': 'y',
'\uFF59': 'y',
'\u1EF3': 'y',
'\u00FD': 'y',
'\u0177': 'y',
'\u1EF9': 'y',
'\u0233': 'y',
'\u1E8F': 'y',
'\u00FF': 'y',
'\u1EF7': 'y',
'\u1E99': 'y',
'\u1EF5': 'y',
'\u01B4': 'y',
'\u024F': 'y',
'\u1EFF': 'y',
'\u24E9': 'z',
'\uFF5A': 'z',
'\u017A': 'z',
'\u1E91': 'z',
'\u017C': 'z',
'\u017E': 'z',
'\u1E93': 'z',
'\u1E95': 'z',
'\u01B6': 'z',
'\u0225': 'z',
'\u0240': 'z',
'\u2C6C': 'z',
'\uA763': 'z',
'\u0386': '\u0391',
'\u0388': '\u0395',
'\u0389': '\u0397',
'\u038A': '\u0399',
'\u03AA': '\u0399',
'\u038C': '\u039F',
'\u038E': '\u03A5',
'\u03AB': '\u03A5',
'\u038F': '\u03A9',
'\u03AC': '\u03B1',
'\u03AD': '\u03B5',
'\u03AE': '\u03B7',
'\u03AF': '\u03B9',
'\u03CA': '\u03B9',
'\u0390': '\u03B9',
'\u03CC': '\u03BF',
'\u03CD': '\u03C5',
'\u03CB': '\u03C5',
'\u03B0': '\u03C5',
'\u03CE': '\u03C9',
'\u03C2': '\u03C3',
'\u2019': '\''
};
return diacritics;
});
S2.define('select2/data/base', [
'../utils'
], function(Utils) {
function BaseAdapter($element, options) {
BaseAdapter.__super__.constructor.call(this);
}
Utils.Extend(BaseAdapter, Utils.Observable);
BaseAdapter.prototype.current = function(callback) {
throw new Error('The `current` method must be defined in child classes.');
};
BaseAdapter.prototype.query = function(params, callback) {
throw new Error('The `query` method must be defined in child classes.');
};
BaseAdapter.prototype.bind = function(container, $container) {
// Can be implemented in subclasses
};
BaseAdapter.prototype.destroy = function() {
// Can be implemented in subclasses
};
BaseAdapter.prototype.generateResultId = function(container, data) {
var id = container.id + '-result-';
id += Utils.generateChars(4);
if (data.id != null) {
id += '-' + data.id.toString();
} else {
id += '-' + Utils.generateChars(4);
}
return id;
};
return BaseAdapter;
});
S2.define('select2/data/select', [
'./base',
'../utils',
'jquery'
], function(BaseAdapter, Utils, $) {
function SelectAdapter($element, options) {
this.$element = $element;
this.options = options;
SelectAdapter.__super__.constructor.call(this);
}
Utils.Extend(SelectAdapter, BaseAdapter);
SelectAdapter.prototype.current = function(callback) {
var data = [];
var self = this;
this.$element.find(':selected').each(function() {
var $option = $(this);
var option = self.item($option);
data.push(option);
});
callback(data);
};
SelectAdapter.prototype.select = function(data) {
var self = this;
data.selected = true;
// If data.element is a DOM node, use it instead
if ($(data.element).is('option')) {
data.element.selected = true;
this.$element.trigger('input').trigger('change');
return;
}
if (this.$element.prop('multiple')) {
this.current(function(currentData) {
var val = [];
data = [data];
data.push.apply(data, currentData);
for (var d = 0; d < data.length; d++) {
var id = data[d].id;
if ($.inArray(id, val) === -1) {
val.push(id);
}
}
self.$element.val(val);
self.$element.trigger('input').trigger('change');
});
} else {
var val = data.id;
this.$element.val(val);
this.$element.trigger('input').trigger('change');
}
};
SelectAdapter.prototype.unselect = function(data) {
var self = this;
if (!this.$element.prop('multiple')) {
return;
}
data.selected = false;
if ($(data.element).is('option')) {
data.element.selected = false;
this.$element.trigger('input').trigger('change');
return;
}
this.current(function(currentData) {
var val = [];
for (var d = 0; d < currentData.length; d++) {
var id = currentData[d].id;
if (id !== data.id && $.inArray(id, val) === -1) {
val.push(id);
}
}
self.$element.val(val);
self.$element.trigger('input').trigger('change');
});
};
SelectAdapter.prototype.bind = function(container, $container) {
var self = this;
this.container = container;
container.on('select', function(params) {
self.select(params.data);
});
container.on('unselect', function(params) {
self.unselect(params.data);
});
};
SelectAdapter.prototype.destroy = function() {
// Remove anything added to child elements
this.$element.find('*').each(function() {
// Remove any custom data set by Select2
Utils.RemoveData(this);
});
};
SelectAdapter.prototype.query = function(params, callback) {
var data = [];
var self = this;
var $options = this.$element.children();
$options.each(function() {
var $option = $(this);
if (!$option.is('option') && !$option.is('optgroup')) {
return;
}
var option = self.item($option);
var matches = self.matches(params, option);
if (matches !== null) {
data.push(matches);
}
});
callback({
results: data
});
};
SelectAdapter.prototype.addOptions = function($options) {
Utils.appendMany(this.$element, $options);
};
SelectAdapter.prototype.option = function(data) {
var option;
if (data.children) {
option = document.createElement('optgroup');
option.label = data.text;
} else {
option = document.createElement('option');
if (option.textContent !== undefined) {
option.textContent = data.text;
} else {
option.innerText = data.text;
}
}
if (data.id !== undefined) {
option.value = data.id;
}
if (data.disabled) {
option.disabled = true;
}
if (data.selected) {
option.selected = true;
}
if (data.title) {
option.title = data.title;
}
var $option = $(option);
var normalizedData = this._normalizeItem(data);
normalizedData.element = option;
// Override the option's data with the combined data
Utils.StoreData(option, 'data', normalizedData);
return $option;
};
SelectAdapter.prototype.item = function($option) {
var data = {};
data = Utils.GetData($option[0], 'data');
if (data != null) {
return data;
}
if ($option.is('option')) {
data = {
id: $option.val(),
text: $option.text(),
disabled: $option.prop('disabled'),
selected: $option.prop('selected'),
title: $option.prop('title')
};
} else if ($option.is('optgroup')) {
data = {
text: $option.prop('label'),
children: [],
title: $option.prop('title')
};
var $children = $option.children('option');
var children = [];
for (var c = 0; c < $children.length; c++) {
var $child = $($children[c]);
var child = this.item($child);
children.push(child);
}
data.children = children;
}
data = this._normalizeItem(data);
data.element = $option[0];
Utils.StoreData($option[0], 'data', data);
return data;
};
SelectAdapter.prototype._normalizeItem = function(item) {
if (item !== Object(item)) {
item = {
id: item,
text: item
};
}
item = $.extend({}, {
text: ''
}, item);
var defaults = {
selected: false,
disabled: false
};
if (item.id != null) {
item.id = item.id.toString();
}
if (item.text != null) {
item.text = item.text.toString();
}
if (item._resultId == null && item.id && this.container != null) {
item._resultId = this.generateResultId(this.container, item);
}
return $.extend({}, defaults, item);
};
SelectAdapter.prototype.matches = function(params, data) {
var matcher = this.options.get('matcher');
return matcher(params, data);
};
return SelectAdapter;
});
S2.define('select2/data/array', [
'./select',
'../utils',
'jquery'
], function(SelectAdapter, Utils, $) {
function ArrayAdapter($element, options) {
this._dataToConvert = options.get('data') || [];
ArrayAdapter.__super__.constructor.call(this, $element, options);
}
Utils.Extend(ArrayAdapter, SelectAdapter);
ArrayAdapter.prototype.bind = function(container, $container) {
ArrayAdapter.__super__.bind.call(this, container, $container);
this.addOptions(this.convertToOptions(this._dataToConvert));
};
ArrayAdapter.prototype.select = function(data) {
var $option = this.$element.find('option').filter(function(i, elm) {
return elm.value == data.id.toString();
});
if ($option.length === 0) {
$option = this.option(data);
this.addOptions($option);
}
ArrayAdapter.__super__.select.call(this, data);
};
ArrayAdapter.prototype.convertToOptions = function(data) {
var self = this;
var $existing = this.$element.find('option');
var existingIds = $existing.map(function() {
return self.item($(this)).id;
}).get();
var $options = [];
// Filter out all items except for the one passed in the argument
function onlyItem(item) {
return function() {
return $(this).val() == item.id;
};
}
for (var d = 0; d < data.length; d++) {
var item = this._normalizeItem(data[d]);
// Skip items which were pre-loaded, only merge the data
if ($.inArray(item.id, existingIds) >= 0) {
var $existingOption = $existing.filter(onlyItem(item));
var existingData = this.item($existingOption);
var newData = $.extend(true, {}, item, existingData);
var $newOption = this.option(newData);
$existingOption.replaceWith($newOption);
continue;
}
var $option = this.option(item);
if (item.children) {
var $children = this.convertToOptions(item.children);
Utils.appendMany($option, $children);
}
$options.push($option);
}
return $options;
};
return ArrayAdapter;
});
S2.define('select2/data/ajax', [
'./array',
'../utils',
'jquery'
], function(ArrayAdapter, Utils, $) {
function AjaxAdapter($element, options) {
this.ajaxOptions = this._applyDefaults(options.get('ajax'));
if (this.ajaxOptions.processResults != null) {
this.processResults = this.ajaxOptions.processResults;
}
AjaxAdapter.__super__.constructor.call(this, $element, options);
}
Utils.Extend(AjaxAdapter, ArrayAdapter);
AjaxAdapter.prototype._applyDefaults = function(options) {
var defaults = {
data: function(params) {
return $.extend({}, params, {
q: params.term
});
},
transport: function(params, success, failure) {
var $request = $.ajax(params);
$request.then(success);
$request.fail(failure);
return $request;
}
};
return $.extend({}, defaults, options, true);
};
AjaxAdapter.prototype.processResults = function(results) {
return results;
};
AjaxAdapter.prototype.query = function(params, callback) {
var matches = [];
var self = this;
if (this._request != null) {
// JSONP requests cannot always be aborted
if ($.isFunction(this._request.abort)) {
this._request.abort();
}
this._request = null;
}
var options = $.extend({
type: 'GET'
}, this.ajaxOptions);
if (typeof options.url === 'function') {
options.url = options.url.call(this.$element, params);
}
if (typeof options.data === 'function') {
options.data = options.data.call(this.$element, params);
}
function request() {
var $request = options.transport(options, function(data) {
var results = self.processResults(data, params);
if (self.options.get('debug') && window.console && console.error) {
// Check to make sure that the response included a `results` key.
if (!results || !results.results || !$.isArray(results.results)) {
console.error(
'Select2: The AJAX results did not return an array in the ' +
'`results` key of the response.'
);
}
}
callback(results);
}, function() {
// Attempt to detect if a request was aborted
// Only works if the transport exposes a status property
if ('status' in $request &&
($request.status === 0 || $request.status === '0')) {
return;
}
self.trigger('results:message', {
message: 'errorLoading'
});
});
self._request = $request;
}
if (this.ajaxOptions.delay && params.term != null) {
if (this._queryTimeout) {
window.clearTimeout(this._queryTimeout);
}
this._queryTimeout = window.setTimeout(request, this.ajaxOptions.delay);
} else {
request();
}
};
return AjaxAdapter;
});
S2.define('select2/data/tags', [
'jquery'
], function($) {
function Tags(decorated, $element, options) {
var tags = options.get('tags');
var createTag = options.get('createTag');
if (createTag !== undefined) {
this.createTag = createTag;
}
var insertTag = options.get('insertTag');
if (insertTag !== undefined) {
this.insertTag = insertTag;
}
decorated.call(this, $element, options);
if ($.isArray(tags)) {
for (var t = 0; t < tags.length; t++) {
var tag = tags[t];
var item = this._normalizeItem(tag);
var $option = this.option(item);
this.$element.append($option);
}
}
}
Tags.prototype.query = function(decorated, params, callback) {
var self = this;
this._removeOldTags();
if (params.term == null || params.page != null) {
decorated.call(this, params, callback);
return;
}
function wrapper(obj, child) {
var data = obj.results;
for (var i = 0; i < data.length; i++) {
var option = data[i];
var checkChildren = (
option.children != null &&
!wrapper({
results: option.children
}, true)
);
var optionText = (option.text || '').toUpperCase();
var paramsTerm = (params.term || '').toUpperCase();
var checkText = optionText === paramsTerm;
if (checkText || checkChildren) {
if (child) {
return false;
}
obj.data = data;
callback(obj);
return;
}
}
if (child) {
return true;
}
var tag = self.createTag(params);
if (tag != null) {
var $option = self.option(tag);
$option.attr('data-select-tag', true);
self.addOptions([$option]);
self.insertTag(data, tag);
}
obj.results = data;
callback(obj);
}
decorated.call(this, params, wrapper);
};
Tags.prototype.createTag = function(decorated, params) {
var term = $.trim(params.term);
if (term === '') {
return null;
}
return {
id: term,
text: term
};
};
Tags.prototype.insertTag = function(_, data, tag) {
data.unshift(tag);
};
Tags.prototype._removeOldTags = function(_) {
var $options = this.$element.find('option[data-select-tag]');
$options.each(function() {
if (this.selected) {
return;
}
$(this).remove();
});
};
return Tags;
});
S2.define('select2/data/tokenizer', [
'jquery'
], function($) {
function Tokenizer(decorated, $element, options) {
var tokenizer = options.get('tokenizer');
if (tokenizer !== undefined) {
this.tokenizer = tokenizer;
}
decorated.call(this, $element, options);
}
Tokenizer.prototype.bind = function(decorated, container, $container) {
decorated.call(this, container, $container);
this.$search = container.dropdown.$search || container.selection.$search ||
$container.find('.select2-search-field');
};
Tokenizer.prototype.query = function(decorated, params, callback) {
var self = this;
function createAndSelect(data) {
// Normalize the data object so we can use it for checks
var item = self._normalizeItem(data);
// Check if the data object already exists as a tag
// Select it if it doesn't
var $existingOptions = self.$element.find('option').filter(function() {
return $(this).val() === item.id;
});
// If an existing option wasn't found for it, create the option
if (!$existingOptions.length) {
var $option = self.option(item);
$option.attr('data-select-tag', true);
self._removeOldTags();
self.addOptions([$option]);
}
// Select the item, now that we know there is an option for it
select(item);
}
function select(data) {
self.trigger('select', {
data: data
});
}
params.term = params.term || '';
var tokenData = this.tokenizer(params, this.options, createAndSelect);
if (tokenData.term !== params.term) {
// Replace the search term if we have the search box
if (this.$search.length) {
this.$search.val(tokenData.term);
this.$search.trigger('focus');
}
params.term = tokenData.term;
}
decorated.call(this, params, callback);
};
Tokenizer.prototype.tokenizer = function(_, params, options, callback) {
var separators = options.get('tokenSeparators') || [];
var term = params.term;
var i = 0;
var createTag = this.createTag || function(params) {
return {
id: params.term,
text: params.term
};
};
while (i < term.length) {
var termChar = term[i];
if ($.inArray(termChar, separators) === -1) {
i++;
continue;
}
var part = term.substr(0, i);
var partParams = $.extend({}, params, {
term: part
});
var data = createTag(partParams);
if (data == null) {
i++;
continue;
}
callback(data);
// Reset the term to not include the tokenized portion
term = term.substr(i + 1) || '';
i = 0;
}
return {
term: term
};
};
return Tokenizer;
});
S2.define('select2/data/minimumInputLength', [
], function() {
function MinimumInputLength(decorated, $e, options) {
this.minimumInputLength = options.get('minimumInputLength');
decorated.call(this, $e, options);
}
MinimumInputLength.prototype.query = function(decorated, params, callback) {
params.term = params.term || '';
if (params.term.length < this.minimumInputLength) {
this.trigger('results:message', {
message: 'inputTooShort',
args: {
minimum: this.minimumInputLength,
input: params.term,
params: params
}
});
return;
}
decorated.call(this, params, callback);
};
return MinimumInputLength;
});
S2.define('select2/data/maximumInputLength', [
], function() {
function MaximumInputLength(decorated, $e, options) {
this.maximumInputLength = options.get('maximumInputLength');
decorated.call(this, $e, options);
}
MaximumInputLength.prototype.query = function(decorated, params, callback) {
params.term = params.term || '';
if (this.maximumInputLength > 0 &&
params.term.length > this.maximumInputLength) {
this.trigger('results:message', {
message: 'inputTooLong',
args: {
maximum: this.maximumInputLength,
input: params.term,
params: params
}
});
return;
}
decorated.call(this, params, callback);
};
return MaximumInputLength;
});
S2.define('select2/data/maximumSelectionLength', [
], function() {
function MaximumSelectionLength(decorated, $e, options) {
this.maximumSelectionLength = options.get('maximumSelectionLength');
decorated.call(this, $e, options);
}
MaximumSelectionLength.prototype.bind =
function(decorated, container, $container) {
var self = this;
decorated.call(this, container, $container);
container.on('select', function() {
self._checkIfMaximumSelected();
});
};
MaximumSelectionLength.prototype.query =
function(decorated, params, callback) {
var self = this;
this._checkIfMaximumSelected(function() {
decorated.call(self, params, callback);
});
};
MaximumSelectionLength.prototype._checkIfMaximumSelected =
function(_, successCallback) {
var self = this;
this.current(function(currentData) {
var count = currentData != null ? currentData.length : 0;
if (self.maximumSelectionLength > 0 &&
count >= self.maximumSelectionLength) {
self.trigger('results:message', {
message: 'maximumSelected',
args: {
maximum: self.maximumSelectionLength
}
});
return;
}
if (successCallback) {
successCallback();
}
});
};
return MaximumSelectionLength;
});
S2.define('select2/dropdown', [
'jquery',
'./utils'
], function($, Utils) {
function Dropdown($element, options) {
this.$element = $element;
this.options = options;
Dropdown.__super__.constructor.call(this);
}
Utils.Extend(Dropdown, Utils.Observable);
Dropdown.prototype.render = function() {
var $dropdown = $(
'' +
'' +
''
);
$dropdown.attr('dir', this.options.get('dir'));
this.$dropdown = $dropdown;
return $dropdown;
};
Dropdown.prototype.bind = function() {
// Should be implemented in subclasses
};
Dropdown.prototype.position = function($dropdown, $container) {
// Should be implemented in subclasses
};
Dropdown.prototype.destroy = function() {
// Remove the dropdown from the DOM
this.$dropdown.remove();
};
return Dropdown;
});
S2.define('select2/dropdown/search', [
'jquery',
'../utils'
], function($, Utils) {
function Search() {}
Search.prototype.render = function(decorated) {
var $rendered = decorated.call(this);
var $search = $(
'' +
'' +
''
); //AXUI
this.$searchContainer = $search;
this.$search = $search.find('input');
$rendered.prepend($search);
return $rendered;
};
Search.prototype.bind = function(decorated, container, $container) {
var self = this;
var resultsId = container.id + '-results';
decorated.call(this, container, $container);
this.$search.on('keydown', function(evt) {
self.trigger('keypress', evt);
self._keyUpPrevented = evt.isDefaultPrevented();
});
// Workaround for browsers which do not support the `input` event
// This will prevent double-triggering of events for browsers which support
// both the `keyup` and `input` events.
this.$search.on('input', function(evt) {
// Unbind the duplicated `keyup` event
$(this).off('keyup');
});
this.$search.on('keyup input', function(evt) {
self.handleSearch(evt);
});
container.on('open', function() {
self.$search.attr('tabindex', 0);
self.$search.attr('aria-controls', resultsId);
self.$search.trigger('focus');
window.setTimeout(function() {
self.$search.trigger('focus');
}, 0);
});
container.on('close', function() {
self.$search.attr('tabindex', -1);
self.$search.removeAttr('aria-controls');
self.$search.removeAttr('aria-activedescendant');
self.$search.val('');
self.$search.trigger('blur');
});
container.on('focus', function() {
if (!container.isOpen()) {
self.$search.trigger('focus');
}
});
container.on('results:all', function(params) {
if (params.query.term == null || params.query.term === '') {
var showSearch = self.showSearch(params);
if (showSearch) {
self.$searchContainer.removeClass('select2-search-hide');
} else {
self.$searchContainer.addClass('select2-search-hide');
}
}
});
container.on('results:focus', function(params) {
if (params.data._resultId) {
self.$search.attr('aria-activedescendant', params.data._resultId);
} else {
self.$search.removeAttr('aria-activedescendant');
}
});
};
Search.prototype.handleSearch = function(evt) {
if (!this._keyUpPrevented) {
var input = this.$search.val();
this.trigger('query', {
term: input
});
}
this._keyUpPrevented = false;
};
Search.prototype.showSearch = function(_, params) {
return true;
};
return Search;
});
S2.define('select2/dropdown/hidePlaceholder', [
], function() {
function HidePlaceholder(decorated, $element, options, dataAdapter) {
this.placeholder = this.normalizePlaceholder(options.get('placeholder'));
decorated.call(this, $element, options, dataAdapter);
}
HidePlaceholder.prototype.append = function(decorated, data) {
data.results = this.removePlaceholder(data.results);
decorated.call(this, data);
};
HidePlaceholder.prototype.normalizePlaceholder = function(_, placeholder) {
if (typeof placeholder === 'string') {
placeholder = {
id: '',
text: placeholder
};
}
return placeholder;
};
HidePlaceholder.prototype.removePlaceholder = function(_, data) {
var modifiedData = data.slice(0);
for (var d = data.length - 1; d >= 0; d--) {
var item = data[d];
if (this.placeholder.id === item.id) {
modifiedData.splice(d, 1);
}
}
return modifiedData;
};
return HidePlaceholder;
});
S2.define('select2/dropdown/infiniteScroll', [
'jquery'
], function($) {
function InfiniteScroll(decorated, $element, options, dataAdapter) {
this.lastParams = {};
decorated.call(this, $element, options, dataAdapter);
this.$loadingMore = this.createLoadingMore();
this.loading = false;
}
InfiniteScroll.prototype.append = function(decorated, data) {
this.$loadingMore.remove();
this.loading = false;
decorated.call(this, data);
if (this.showLoadingMore(data)) {
this.$results.append(this.$loadingMore);
this.loadMoreIfNeeded();
}
};
InfiniteScroll.prototype.bind = function(decorated, container, $container) {
var self = this;
decorated.call(this, container, $container);
container.on('query', function(params) {
self.lastParams = params;
self.loading = true;
});
container.on('query:append', function(params) {
self.lastParams = params;
self.loading = true;
});
this.$results.on('scroll', this.loadMoreIfNeeded.bind(this));
};
InfiniteScroll.prototype.loadMoreIfNeeded = function() {
var isLoadMoreVisible = $.contains(
document.documentElement,
this.$loadingMore[0]
);
if (this.loading || !isLoadMoreVisible) {
return;
}
var currentOffset = this.$results.offset().top +
this.$results.outerHeight(false);
var loadingMoreOffset = this.$loadingMore.offset().top +
this.$loadingMore.outerHeight(false);
if (currentOffset + 50 >= loadingMoreOffset) {
this.loadMore();
}
};
InfiniteScroll.prototype.loadMore = function() {
this.loading = true;
var params = $.extend({}, { page: 1 }, this.lastParams);
params.page++;
this.trigger('query:append', params);
};
InfiniteScroll.prototype.showLoadingMore = function(_, data) {
return data.pagination && data.pagination.more;
};
InfiniteScroll.prototype.createLoadingMore = function() {
var $option = $(
''
);
var message = this.options.get('translations').get('loadingMore');
$option.html(message(this.lastParams));
return $option;
};
return InfiniteScroll;
});
S2.define('select2/dropdown/attachBody', [
'jquery',
'../utils'
], function($, Utils) {
function AttachBody(decorated, $element, options) {
this.$dropdownParent = $(options.get('dropdownParent') || document.body);
decorated.call(this, $element, options);
}
AttachBody.prototype.bind = function(decorated, container, $container) {
var self = this;
decorated.call(this, container, $container);
container.on('open', function() {
self._showDropdown();
self._attachPositioningHandler(container);
// Must bind after the results handlers to ensure correct sizing
self._bindContainerResultHandlers(container);
});
container.on('close', function() {
self._hideDropdown();
self._detachPositioningHandler(container);
});
this.$dropdownContainer.on('mousedown', function(evt) {
evt.stopPropagation();
});
};
AttachBody.prototype.destroy = function(decorated) {
decorated.call(this);
this.$dropdownContainer.remove();
};
AttachBody.prototype.position = function(decorated, $dropdown, $container) {
// Clone all of the container classes
$dropdown.attr('class', $container.attr('class'));
$dropdown.removeClass('select2');
$dropdown.addClass('select-box-open');
$dropdown.css({
position: 'absolute',
top: -999999
});
this.$container = $container;
};
AttachBody.prototype.render = function(decorated) {
var $container = $('');
var $dropdown = decorated.call(this);
$container.append($dropdown);
this.$dropdownContainer = $container;
return $container;
};
AttachBody.prototype._hideDropdown = function(decorated) {
this.$dropdownContainer.detach();
};
AttachBody.prototype._bindContainerResultHandlers =
function(decorated, container) {
// These should only be bound once
if (this._containerResultsHandlersBound) {
return;
}
var self = this;
container.on('results:all', function() {
self._positionDropdown();
self._resizeDropdown();
});
container.on('results:append', function() {
self._positionDropdown();
self._resizeDropdown();
});
container.on('results:message', function() {
self._positionDropdown();
self._resizeDropdown();
});
container.on('select', function() {
self._positionDropdown();
self._resizeDropdown();
});
container.on('unselect', function() {
self._positionDropdown();
self._resizeDropdown();
});
this._containerResultsHandlersBound = true;
};
AttachBody.prototype._attachPositioningHandler =
function(decorated, container) {
var self = this;
var scrollEvent = 'scroll.select2.' + container.id;
var resizeEvent = 'resize.select2.' + container.id;
var orientationEvent = 'orientationchange.select2.' + container.id;
var $watchers = this.$container.parents().filter(Utils.hasScroll);
$watchers.each(function() {
Utils.StoreData(this, 'select2-scroll-position', {
x: $(this).scrollLeft(),
y: $(this).scrollTop()
});
});
$watchers.on(scrollEvent, function(ev) {
var position = Utils.GetData(this, 'select2-scroll-position');
$(this).scrollTop(position.y);
});
$(window).on(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent,
function(e) {
self._positionDropdown();
self._resizeDropdown();
});
};
AttachBody.prototype._detachPositioningHandler =
function(decorated, container) {
var scrollEvent = 'scroll.select2.' + container.id;
var resizeEvent = 'resize.select2.' + container.id;
var orientationEvent = 'orientationchange.select2.' + container.id;
var $watchers = this.$container.parents().filter(Utils.hasScroll);
$watchers.off(scrollEvent);
$(window).off(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent);
};
AttachBody.prototype._positionDropdown = function() {
var $window = $(window);
var isCurrentlyAbove = this.$dropdown.hasClass('select2-dropdown-above');
var isCurrentlyBelow = this.$dropdown.hasClass('select2-dropdown-below');
var newDirection = null;
var offset = this.$container.offset();
offset.bottom = offset.top + this.$container.outerHeight(false);
var container = {
height: this.$container.outerHeight(false)
};
container.top = offset.top;
container.bottom = offset.top + container.height;
var dropdown = {
height: this.$dropdown.outerHeight(false)
};
var viewport = {
top: $window.scrollTop(),
bottom: $window.scrollTop() + $window.height()
};
var enoughRoomAbove = viewport.top < (offset.top - dropdown.height);
var enoughRoomBelow = viewport.bottom > (offset.bottom + dropdown.height);
var css = {
left: offset.left,
top: container.bottom
};
// Determine what the parent element is to use for calculating the offset
var $offsetParent = this.$dropdownParent;
// For statically positioned elements, we need to get the element
// that is determining the offset
if ($offsetParent.css('position') === 'static') {
$offsetParent = $offsetParent.offsetParent();
}
var parentOffset = {
top: 0,
left: 0
};
if (
$.contains(document.body, $offsetParent[0]) ||
$offsetParent[0].isConnected
) {
parentOffset = $offsetParent.offset();
}
css.top -= parentOffset.top;
css.left -= parentOffset.left;
if (!isCurrentlyAbove && !isCurrentlyBelow) {
newDirection = 'below';
}
if (!enoughRoomBelow && enoughRoomAbove && !isCurrentlyAbove) {
newDirection = 'above';
} else if (!enoughRoomAbove && enoughRoomBelow && isCurrentlyAbove) {
newDirection = 'below';
}
if (newDirection == 'above' ||
(isCurrentlyAbove && newDirection !== 'below')) {
css.top = container.top - parentOffset.top - dropdown.height;
}
if (newDirection != null) {
this.$dropdown
.removeClass('select2-dropdown-below select2-dropdown-above')
.addClass('select2-dropdown-' + newDirection);
this.$container
.removeClass('select-box-below select-box-above')
.addClass('select-box-' + newDirection);
}
this.$dropdownContainer.css(css);
};
AttachBody.prototype._resizeDropdown = function() {
var css = {
width: this.$container.outerWidth(false) + 'px'
};
if (this.options.get('dropdownAutoWidth')) {
css.minWidth = css.width;
css.position = 'relative';
css.width = 'auto';
}
this.$dropdown.css(css);
};
AttachBody.prototype._showDropdown = function(decorated) {
this.$dropdownContainer.appendTo(this.$dropdownParent);
this._positionDropdown();
this._resizeDropdown();
};
return AttachBody;
});
S2.define('select2/dropdown/minimumResultsForSearch', [
], function() {
function countResults(data) {
var count = 0;
for (var d = 0; d < data.length; d++) {
var item = data[d];
if (item.children) {
count += countResults(item.children);
} else {
count++;
}
}
return count;
}
function MinimumResultsForSearch(decorated, $element, options, dataAdapter) {
this.minimumResultsForSearch = options.get('minimumResultsForSearch');
if (this.minimumResultsForSearch < 0) {
this.minimumResultsForSearch = Infinity;
}
decorated.call(this, $element, options, dataAdapter);
}
MinimumResultsForSearch.prototype.showSearch = function(decorated, params) {
if (countResults(params.data.results) < this.minimumResultsForSearch) {
return false;
}
return decorated.call(this, params);
};
return MinimumResultsForSearch;
});
S2.define('select2/dropdown/selectOnClose', [
'../utils'
], function(Utils) {
function SelectOnClose() {}
SelectOnClose.prototype.bind = function(decorated, container, $container) {
var self = this;
decorated.call(this, container, $container);
container.on('close', function(params) {
self._handleSelectOnClose(params);
});
};
SelectOnClose.prototype._handleSelectOnClose = function(_, params) {
if (params && params.originalSelect2Event != null) {
var event = params.originalSelect2Event;
// Don't select an item if the close event was triggered from a select or
// unselect event
if (event._type === 'select' || event._type === 'unselect') {
return;
}
}
var $highlightedResults = this.getHighlightedResults();
// Only select highlighted results
if ($highlightedResults.length < 1) {
return;
}
var data = Utils.GetData($highlightedResults[0], 'data');
// Don't re-select already selected resulte
if (
(data.element != null && data.element.selected) ||
(data.element == null && data.selected)
) {
return;
}
this.trigger('select', {
data: data
});
};
return SelectOnClose;
});
S2.define('select2/dropdown/closeOnSelect', [
], function() {
function CloseOnSelect() {}
CloseOnSelect.prototype.bind = function(decorated, container, $container) {
var self = this;
decorated.call(this, container, $container);
container.on('select', function(evt) {
self._selectTriggered(evt);
});
container.on('unselect', function(evt) {
self._selectTriggered(evt);
});
};
CloseOnSelect.prototype._selectTriggered = function(_, evt) {
var originalEvent = evt.originalEvent;
// Don't close if the control key is being held
if (originalEvent && (originalEvent.ctrlKey || originalEvent.metaKey)) {
return;
}
this.trigger('close', {
originalEvent: originalEvent,
originalSelect2Event: evt
});
};
return CloseOnSelect;
});
S2.define('select2/i18n/en', [], function() {
// English
return {
errorLoading: function() {
return '无法载入结果。'; //AXUI
},
inputTooLong: function(args) {
var overChars = args.input.length - args.maximum;
var message = '请删除' + overChars + '个字符。'; //AXUI
if (overChars != 1) {
message += 's';
}
return message;
},
inputTooShort: function(args) {
var remainingChars = args.minimum - args.input.length;
var message = '请输入' + remainingChars + '个或更多字符。'; //AXUI
return message;
},
loadingMore: function() {
return '加载中...'; //AXUI
},
maximumSelected: function(args) {
var message = '最多只能选择' + args.maximum + '个项目。'; //AXUI
if (args.maximum != 1) {
message += 's';
}
return message;
},
noResults: function() {
return '未找到结果。'; //AXUI
},
searching: function() {
return '搜索中...'; //AXUI
},
removeAllItems: function() {
return '清除全部。'; //AXUI
}
};
});
S2.define('select2/defaults', [
'jquery',
'require',
'./results',
'./selection/single',
'./selection/multiple',
'./selection/placeholder',
'./selection/allowClear',
'./selection/search',
'./selection/eventRelay',
'./utils',
'./translation',
'./diacritics',
'./data/select',
'./data/array',
'./data/ajax',
'./data/tags',
'./data/tokenizer',
'./data/minimumInputLength',
'./data/maximumInputLength',
'./data/maximumSelectionLength',
'./dropdown',
'./dropdown/search',
'./dropdown/hidePlaceholder',
'./dropdown/infiniteScroll',
'./dropdown/attachBody',
'./dropdown/minimumResultsForSearch',
'./dropdown/selectOnClose',
'./dropdown/closeOnSelect',
'./i18n/en'
], function($, require,
ResultsList,
SingleSelection, MultipleSelection, Placeholder, AllowClear,
SelectionSearch, EventRelay,
Utils, Translation, DIACRITICS,
SelectData, ArrayData, AjaxData, Tags, Tokenizer,
MinimumInputLength, MaximumInputLength, MaximumSelectionLength,
Dropdown, DropdownSearch, HidePlaceholder, InfiniteScroll,
AttachBody, MinimumResultsForSearch, SelectOnClose, CloseOnSelect,
EnglishTranslation) {
function Defaults() {
this.reset();
}
Defaults.prototype.apply = function(options) {
options = $.extend(true, {}, this.defaults, options);
if (options.dataAdapter == null) {
if (options.ajax != null) {
options.dataAdapter = AjaxData;
} else if (options.data != null) {
options.dataAdapter = ArrayData;
} else {
options.dataAdapter = SelectData;
}
if (options.minimumInputLength > 0) {
options.dataAdapter = Utils.Decorate(
options.dataAdapter,
MinimumInputLength
);
}
if (options.maximumInputLength > 0) {
options.dataAdapter = Utils.Decorate(
options.dataAdapter,
MaximumInputLength
);
}
if (options.maximumSelectionLength > 0) {
options.dataAdapter = Utils.Decorate(
options.dataAdapter,
MaximumSelectionLength
);
}
if (options.tags) {
options.dataAdapter = Utils.Decorate(options.dataAdapter, Tags);
}
if (options.tokenSeparators != null || options.tokenizer != null) {
options.dataAdapter = Utils.Decorate(
options.dataAdapter,
Tokenizer
);
}
if (options.query != null) {
var Query = require(options.amdBase + 'compat/query');
options.dataAdapter = Utils.Decorate(
options.dataAdapter,
Query
);
}
if (options.initSelection != null) {
var InitSelection = require(options.amdBase + 'compat/initSelection');
options.dataAdapter = Utils.Decorate(
options.dataAdapter,
InitSelection
);
}
}
if (options.resultsAdapter == null) {
options.resultsAdapter = ResultsList;
if (options.ajax != null) {
options.resultsAdapter = Utils.Decorate(
options.resultsAdapter,
InfiniteScroll
);
}
if (options.placeholder != null) {
options.resultsAdapter = Utils.Decorate(
options.resultsAdapter,
HidePlaceholder
);
}
if (options.selectOnClose) {
options.resultsAdapter = Utils.Decorate(
options.resultsAdapter,
SelectOnClose
);
}
}
if (options.dropdownAdapter == null) {
if (options.multiple) {
options.dropdownAdapter = Dropdown;
} else {
var SearchableDropdown = Utils.Decorate(Dropdown, DropdownSearch);
options.dropdownAdapter = SearchableDropdown;
}
if (options.minimumResultsForSearch !== 0) {
options.dropdownAdapter = Utils.Decorate(
options.dropdownAdapter,
MinimumResultsForSearch
);
}
if (options.closeOnSelect) {
options.dropdownAdapter = Utils.Decorate(
options.dropdownAdapter,
CloseOnSelect
);
}
if (
options.dropdownCssClass != null ||
options.dropdownCss != null ||
options.adaptDropdownCssClass != null
) {
var DropdownCSS = require(options.amdBase + 'compat/dropdownCss');
options.dropdownAdapter = Utils.Decorate(
options.dropdownAdapter,
DropdownCSS
);
}
options.dropdownAdapter = Utils.Decorate(
options.dropdownAdapter,
AttachBody
);
}
if (options.selectionAdapter == null) {
if (options.multiple) {
options.selectionAdapter = MultipleSelection;
} else {
options.selectionAdapter = SingleSelection;
}
// Add the placeholder mixin if a placeholder was specified
if (options.placeholder != null) {
options.selectionAdapter = Utils.Decorate(
options.selectionAdapter,
Placeholder
);
}
if (options.allowClear) {
options.selectionAdapter = Utils.Decorate(
options.selectionAdapter,
AllowClear
);
}
if (options.multiple) {
options.selectionAdapter = Utils.Decorate(
options.selectionAdapter,
SelectionSearch
);
}
if (
options.containerCssClass != null ||
options.containerCss != null ||
options.adaptContainerCssClass != null
) {
var ContainerCSS = require(options.amdBase + 'compat/containerCss');
options.selectionAdapter = Utils.Decorate(
options.selectionAdapter,
ContainerCSS
);
}
options.selectionAdapter = Utils.Decorate(
options.selectionAdapter,
EventRelay
);
}
// If the defaults were not previously applied from an element, it is
// possible for the language option to have not been resolved
options.language = this._resolveLanguage(options.language);
// Always fall back to English since it will always be complete
options.language.push('en');
var uniqueLanguages = [];
for (var l = 0; l < options.language.length; l++) {
var language = options.language[l];
if (uniqueLanguages.indexOf(language) === -1) {
uniqueLanguages.push(language);
}
}
options.language = uniqueLanguages;
options.translations = this._processTranslations(
options.language,
options.debug
);
return options;
};
Defaults.prototype.reset = function() {
function stripDiacritics(text) {
// Used 'uni range + named function' from http://jsperf.com/diacritics/18
function match(a) {
return DIACRITICS[a] || a;
}
return text.replace(/[^\u0000-\u007E]/g, match);
}
function matcher(params, data) {
// Always return the object if there is nothing to compare
if ($.trim(params.term) === '') {
return data;
}
// Do a recursive check for options with children
if (data.children && data.children.length > 0) {
// Clone the data object if there are children
// This is required as we modify the object to remove any non-matches
var match = $.extend(true, {}, data);
// Check each child of the option
for (var c = data.children.length - 1; c >= 0; c--) {
var child = data.children[c];
var matches = matcher(params, child);
// If there wasn't a match, remove the object in the array
if (matches == null) {
match.children.splice(c, 1);
}
}
// If any children matched, return the new object
if (match.children.length > 0) {
return match;
}
// If there were no matching children, check just the plain object
return matcher(params, match);
}
var original = stripDiacritics(data.text).toUpperCase();
var term = stripDiacritics(params.term).toUpperCase();
// Check if the text contains the term
if (original.indexOf(term) > -1) {
return data;
}
// If it doesn't contain the term, don't return anything
return null;
}
this.defaults = {
amdBase: './',
amdLanguageBase: './i18n/',
closeOnSelect: true,
debug: false,
dropdownAutoWidth: false,
escapeMarkup: Utils.escapeMarkup,
language: 'zh-CN', //AXUI
matcher: matcher,
minimumInputLength: 0,
maximumInputLength: 0,
maximumSelectionLength: 0,
minimumResultsForSearch: -1, //AXUI
selectOnClose: false,
scrollAfterSelect: false,
sorter: function(data) {
return data;
},
templateResult: function(result) {
return result.text;
},
templateSelection: function(selection) {
return selection.text;
},
theme: 'ax', //AXUI
width: 'resolve'
};
};
Defaults.prototype.applyFromElement = function(options, $element) {
var optionLanguage = options.language;
var defaultLanguage = this.defaults.language;
var elementLanguage = $element.prop('lang');
var parentLanguage = $element.closest('[lang]').prop('lang');
var languages = Array.prototype.concat.call(
this._resolveLanguage(elementLanguage),
this._resolveLanguage(optionLanguage),
this._resolveLanguage(defaultLanguage),
this._resolveLanguage(parentLanguage)
);
options.language = languages;
return options;
};
Defaults.prototype._resolveLanguage = function(language) {
if (!language) {
return [];
}
if ($.isEmptyObject(language)) {
return [];
}
if ($.isPlainObject(language)) {
return [language];
}
var languages;
if (!$.isArray(language)) {
languages = [language];
} else {
languages = language;
}
var resolvedLanguages = [];
for (var l = 0; l < languages.length; l++) {
resolvedLanguages.push(languages[l]);
if (typeof languages[l] === 'string' && languages[l].indexOf('-') > 0) {
// Extract the region information if it is included
var languageParts = languages[l].split('-');
var baseLanguage = languageParts[0];
resolvedLanguages.push(baseLanguage);
}
}
return resolvedLanguages;
};
Defaults.prototype._processTranslations = function(languages, debug) {
var translations = new Translation();
for (var l = 0; l < languages.length; l++) {
var languageData = new Translation();
var language = languages[l];
if (typeof language === 'string') {
try {
// Try to load it with the original name
languageData = Translation.loadPath(language);
} catch (e) {
try {
// If we couldn't load it, check if it wasn't the full path
language = this.defaults.amdLanguageBase + language;
languageData = Translation.loadPath(language);
} catch (ex) {
// The translation could not be loaded at all. Sometimes this is
// because of a configuration problem, other times this can be
// because of how Select2 helps load all possible translation files
if (debug && window.console && console.warn) {
console.warn(
'Select2: The language file for "' + language + '" could ' +
'not be automatically loaded. A fallback will be used instead.'
);
}
}
}
} else if ($.isPlainObject(language)) {
languageData = new Translation(language);
} else {
languageData = language;
}
translations.extend(languageData);
}
return translations;
};
Defaults.prototype.set = function(key, value) {
var camelKey = $.camelCase(key);
var data = {};
data[camelKey] = value;
var convertedData = Utils._convertData(data);
$.extend(true, this.defaults, convertedData);
};
var defaults = new Defaults();
return defaults;
});
S2.define('select2/options', [
'require',
'jquery',
'./defaults',
'./utils'
], function(require, $, Defaults, Utils) {
function Options(options, $element) {
this.options = options;
if ($element != null) {
this.fromElement($element);
}
if ($element != null) {
this.options = Defaults.applyFromElement(this.options, $element);
}
this.options = Defaults.apply(this.options);
if ($element && $element.is('input')) {
var InputCompat = require(this.get('amdBase') + 'compat/inputData');
this.options.dataAdapter = Utils.Decorate(
this.options.dataAdapter,
InputCompat
);
}
}
Options.prototype.fromElement = function($e) {
var excludedData = ['select2'];
if (this.options.multiple == null) {
this.options.multiple = $e.prop('multiple');
}
if (this.options.disabled == null) {
this.options.disabled = $e.prop('disabled');
}
if (this.options.dir == null) {
if ($e.prop('dir')) {
this.options.dir = $e.prop('dir');
} else if ($e.closest('[dir]').prop('dir')) {
this.options.dir = $e.closest('[dir]').prop('dir');
} else {
this.options.dir = 'ltr';
}
}
$e.prop('disabled', this.options.disabled);
$e.prop('multiple', this.options.multiple);
if (Utils.GetData($e[0], 'select2Tags')) {
if (this.options.debug && window.console && console.warn) {
console.warn(
'Select2: The `data-select-tags` attribute has been changed to ' +
'use the `data-data` and `data-tags="true"` attributes and will be ' +
'removed in future versions of Select2.'
);
}
Utils.StoreData($e[0], 'data', Utils.GetData($e[0], 'select2Tags'));
Utils.StoreData($e[0], 'tags', true);
}
if (Utils.GetData($e[0], 'ajaxUrl')) {
if (this.options.debug && window.console && console.warn) {
console.warn(
'Select2: The `data-ajax-url` attribute has been changed to ' +
'`data-ajax-url` and support for the old attribute will be removed' +
' in future versions of Select2.'
);
}
$e.attr('ajax-url', Utils.GetData($e[0], 'ajaxUrl'));
Utils.StoreData($e[0], 'ajax-Url', Utils.GetData($e[0], 'ajaxUrl'));
}
var dataset = {};
function upperCaseLetter(_, letter) {
return letter.toUpperCase();
}
// Pre-load all of the attributes which are prefixed with `data-`
for (var attr = 0; attr < $e[0].attributes.length; attr++) {
var attributeName = $e[0].attributes[attr].name;
var prefix = 'data-';
if (attributeName.substr(0, prefix.length) == prefix) {
// Get the contents of the attribute after `data-`
var dataName = attributeName.substring(prefix.length);
// Get the data contents from the consistent source
// This is more than likely the jQuery data helper
var dataValue = Utils.GetData($e[0], dataName);
// camelCase the attribute name to match the spec
var camelDataName = dataName.replace(/-([a-z])/g, upperCaseLetter);
// Store the data attribute contents into the dataset since
dataset[camelDataName] = dataValue;
}
}
// Prefer the element's `dataset` attribute if it exists
// jQuery 1.x does not correctly handle data attributes with multiple dashes
if ($.fn.jquery && $.fn.jquery.substr(0, 2) == '1.' && $e[0].dataset) {
dataset = $.extend(true, {}, $e[0].dataset, dataset);
}
// Prefer our internal data cache if it exists
var data = $.extend(true, {}, Utils.GetData($e[0]), dataset);
data = Utils._convertData(data);
for (var key in data) {
if ($.inArray(key, excludedData) > -1) {
continue;
}
if ($.isPlainObject(this.options[key])) {
$.extend(this.options[key], data[key]);
} else {
this.options[key] = data[key];
}
}
return this;
};
Options.prototype.get = function(key) {
return this.options[key];
};
Options.prototype.set = function(key, val) {
this.options[key] = val;
};
return Options;
});
S2.define('select2/core', [
'jquery',
'./options',
'./utils',
'./keys'
], function($, Options, Utils, KEYS) {
var Select2 = function($element, options) {
if (Utils.GetData($element[0], 'select2') != null) {
Utils.GetData($element[0], 'select2').destroy();
}
this.$element = $element;
this.id = this._generateId($element);
options = options || {};
this.options = new Options(options, $element);
Select2.__super__.constructor.call(this);
// Set up the tabindex
var tabindex = $element.attr('tabindex') || 0;
Utils.StoreData($element[0], 'old-tabindex', tabindex);
$element.attr('tabindex', '-1');
// Set up containers and adapters
var DataAdapter = this.options.get('dataAdapter');
this.dataAdapter = new DataAdapter($element, this.options);
var $container = this.render();
this._placeContainer($container);
var SelectionAdapter = this.options.get('selectionAdapter');
this.selection = new SelectionAdapter($element, this.options);
this.$selection = this.selection.render();
this.selection.position(this.$selection, $container);
var DropdownAdapter = this.options.get('dropdownAdapter');
this.dropdown = new DropdownAdapter($element, this.options);
this.$dropdown = this.dropdown.render();
this.dropdown.position(this.$dropdown, $container);
var ResultsAdapter = this.options.get('resultsAdapter');
this.results = new ResultsAdapter($element, this.options, this.dataAdapter);
this.$results = this.results.render();
this.results.position(this.$results, this.$dropdown);
// Bind events
var self = this;
// Bind the container to all of the adapters
this._bindAdapters();
// Register any DOM event handlers
this._registerDomEvents();
// Register any internal event handlers
this._registerDataEvents();
this._registerSelectionEvents();
this._registerDropdownEvents();
this._registerResultsEvents();
this._registerEvents();
// Set the initial state
this.dataAdapter.current(function(initialData) {
self.trigger('selection:update', {
data: initialData
});
});
// Hide the original select
$element.addClass('select2-hidden-accessible');
$element.attr('aria-hidden', 'true');
// Synchronize any monitored attributes
this._syncAttributes();
Utils.StoreData($element[0], 'select2', this);
// Ensure backwards compatibility with $element.data('select2').
$element.data('select2', this);
};
Utils.Extend(Select2, Utils.Observable);
Select2.prototype._generateId = function($element) {
var id = '';
if ($element.attr('id') != null) {
id = $element.attr('id');
} else if ($element.attr('name') != null) {
id = $element.attr('name') + '-' + Utils.generateChars(2);
} else {
id = Utils.generateChars(4);
}
id = id.replace(/(:|\.|\[|\]|,)/g, '');
id = 'select2-' + id;
return id;
};
Select2.prototype._placeContainer = function($container) {
$container.insertAfter(this.$element);
var width = this._resolveWidth(this.$element, this.options.get('width'));
if (width != null) {
$container.css('width', width);
}
};
Select2.prototype._resolveWidth = function($element, method) {
var WIDTH = /^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;
if (method == 'resolve') {
var styleWidth = this._resolveWidth($element, 'style');
if (styleWidth != null) {
return styleWidth;
}
return this._resolveWidth($element, 'element');
}
if (method == 'element') {
var elementWidth = $element.outerWidth(false);
if (elementWidth <= 0) {
return 'auto';
}
return elementWidth + 'px';
}
if (method == 'style') {
var style = $element.attr('style');
if (typeof(style) !== 'string') {
return null;
}
var attrs = style.split(';');
for (var i = 0, l = attrs.length; i < l; i = i + 1) {
var attr = attrs[i].replace(/\s/g, '');
var matches = attr.match(WIDTH);
if (matches !== null && matches.length >= 1) {
return matches[1];
}
}
return null;
}
if (method == 'computedstyle') {
var computedStyle = window.getComputedStyle($element[0]);
return computedStyle.width;
}
return method;
};
Select2.prototype._bindAdapters = function() {
this.dataAdapter.bind(this, this.$container);
this.selection.bind(this, this.$container);
this.dropdown.bind(this, this.$container);
this.results.bind(this, this.$container);
};
Select2.prototype._registerDomEvents = function() {
var self = this;
this.$element.on('change.select2', function() {
self.dataAdapter.current(function(data) {
self.trigger('selection:update', {
data: data
});
});
});
this.$element.on('focus.select2', function(evt) {
self.trigger('focus', evt);
});
this._syncA = Utils.bind(this._syncAttributes, this);
this._syncS = Utils.bind(this._syncSubtree, this);
if (this.$element[0].attachEvent) {
this.$element[0].attachEvent('onpropertychange', this._syncA);
}
var observer = window.MutationObserver ||
window.WebKitMutationObserver ||
window.MozMutationObserver;
if (observer != null) {
this._observer = new observer(function(mutations) {
self._syncA();
self._syncS(null, mutations);
});
this._observer.observe(this.$element[0], {
attributes: true,
childList: true,
subtree: false
});
} else if (this.$element[0].addEventListener) {
this.$element[0].addEventListener(
'DOMAttrModified',
self._syncA,
false
);
this.$element[0].addEventListener(
'DOMNodeInserted',
self._syncS,
false
);
this.$element[0].addEventListener(
'DOMNodeRemoved',
self._syncS,
false
);
}
};
Select2.prototype._registerDataEvents = function() {
var self = this;
this.dataAdapter.on('*', function(name, params) {
self.trigger(name, params);
});
};
Select2.prototype._registerSelectionEvents = function() {
var self = this;
var nonRelayEvents = ['toggle', 'focus'];
this.selection.on('toggle', function() {
self.toggleDropdown();
});
this.selection.on('focus', function(params) {
self.focus(params);
});
this.selection.on('*', function(name, params) {
if ($.inArray(name, nonRelayEvents) !== -1) {
return;
}
self.trigger(name, params);
});
};
Select2.prototype._registerDropdownEvents = function() {
var self = this;
this.dropdown.on('*', function(name, params) {
self.trigger(name, params);
});
};
Select2.prototype._registerResultsEvents = function() {
var self = this;
this.results.on('*', function(name, params) {
self.trigger(name, params);
});
};
Select2.prototype._registerEvents = function() {
var self = this;
this.on('open', function() {
self.$container.addClass('select-box-open');
});
this.on('close', function() {
self.$container.removeClass('select-box-open');
});
this.on('enable', function() {
self.$container.removeClass('select-box-disabled');
});
this.on('disable', function() {
self.$container.addClass('select-box-disabled');
});
this.on('blur', function() {
self.$container.removeClass('select-box-focus');
});
this.on('query', function(params) {
if (!self.isOpen()) {
self.trigger('open', {});
}
this.dataAdapter.query(params, function(data) {
self.trigger('results:all', {
data: data,
query: params
});
});
});
this.on('query:append', function(params) {
this.dataAdapter.query(params, function(data) {
self.trigger('results:append', {
data: data,
query: params
});
});
});
this.on('keypress', function(evt) {
var key = evt.which;
if (self.isOpen()) {
if (key === KEYS.ESC || key === KEYS.TAB ||
(key === KEYS.UP && evt.altKey)) {
self.close(evt);
evt.preventDefault();
} else if (key === KEYS.ENTER) {
self.trigger('results:select', {});
evt.preventDefault();
} else if ((key === KEYS.SPACE && evt.ctrlKey)) {
self.trigger('results:toggle', {});
evt.preventDefault();
} else if (key === KEYS.UP) {
self.trigger('results:previous', {});
evt.preventDefault();
} else if (key === KEYS.DOWN) {
self.trigger('results:next', {});
evt.preventDefault();
}
} else {
if (key === KEYS.ENTER || key === KEYS.SPACE ||
(key === KEYS.DOWN && evt.altKey)) {
self.open();
evt.preventDefault();
}
}
});
};
Select2.prototype._syncAttributes = function() {
this.options.set('disabled', this.$element.prop('disabled'));
if (this.isDisabled()) {
if (this.isOpen()) {
this.close();
}
this.trigger('disable', {});
} else {
this.trigger('enable', {});
}
};
Select2.prototype._isChangeMutation = function(evt, mutations) {
var changed = false;
var self = this;
// Ignore any mutation events raised for elements that aren't options or
// optgroups. This handles the case when the select element is destroyed
if (
evt && evt.target && (
evt.target.nodeName !== 'OPTION' && evt.target.nodeName !== 'OPTGROUP'
)
) {
return;
}
if (!mutations) {
// If mutation events aren't supported, then we can only assume that the
// change affected the selections
changed = true;
} else if (mutations.addedNodes && mutations.addedNodes.length > 0) {
for (var n = 0; n < mutations.addedNodes.length; n++) {
var node = mutations.addedNodes[n];
if (node.selected) {
changed = true;
}
}
} else if (mutations.removedNodes && mutations.removedNodes.length > 0) {
changed = true;
} else if ($.isArray(mutations)) {
$.each(mutations, function(evt, mutation) {
if (self._isChangeMutation(evt, mutation)) {
// We've found a change mutation.
// Let's escape from the loop and continue
changed = true;
return false;
}
});
}
return changed;
};
Select2.prototype._syncSubtree = function(evt, mutations) {
var changed = this._isChangeMutation(evt, mutations);
var self = this;
// Only re-pull the data if we think there is a change
if (changed) {
this.dataAdapter.current(function(currentData) {
self.trigger('selection:update', {
data: currentData
});
});
}
};
/**
* Override the trigger method to automatically trigger pre-events when
* there are events that can be prevented.
*/
Select2.prototype.trigger = function(name, args) {
var actualTrigger = Select2.__super__.trigger;
var preTriggerMap = {
'open': 'opening',
'close': 'closing',
'select': 'selecting',
'unselect': 'unselecting',
'clear': 'clearing'
};
if (args === undefined) {
args = {};
}
if (name in preTriggerMap) {
var preTriggerName = preTriggerMap[name];
var preTriggerArgs = {
prevented: false,
name: name,
args: args
};
actualTrigger.call(this, preTriggerName, preTriggerArgs);
if (preTriggerArgs.prevented) {
args.prevented = true;
return;
}
}
actualTrigger.call(this, name, args);
};
Select2.prototype.toggleDropdown = function() {
if (this.isDisabled()) {
return;
}
if (this.isOpen()) {
this.close();
} else {
this.open();
}
};
Select2.prototype.open = function() {
if (this.isOpen()) {
return;
}
if (this.isDisabled()) {
return;
}
this.trigger('query', {});
};
Select2.prototype.close = function(evt) {
if (!this.isOpen()) {
return;
}
this.trigger('close', { originalEvent: evt });
};
/**
* Helper method to abstract the "enabled" (not "disabled") state of this
* object.
*
* @return {true} if the instance is not disabled.
* @return {false} if the instance is disabled.
*/
Select2.prototype.isEnabled = function() {
return !this.isDisabled();
};
/**
* Helper method to abstract the "disabled" state of this object.
*
* @return {true} if the disabled option is true.
* @return {false} if the disabled option is false.
*/
Select2.prototype.isDisabled = function() {
return this.options.get('disabled');
};
Select2.prototype.isOpen = function() {
return this.$container.hasClass('select-box-open');
};
Select2.prototype.hasFocus = function() {
return this.$container.hasClass('select-box-focus');
};
Select2.prototype.focus = function(data) {
// No need to re-trigger focus events if we are already focused
if (this.hasFocus()) {
return;
}
this.$container.addClass('select-box-focus');
this.trigger('focus', {});
};
Select2.prototype.enable = function(args) {
if (this.options.get('debug') && window.console && console.warn) {
console.warn(
'Select2: The `select2("enable")` method has been deprecated and will' +
' be removed in later Select2 versions. Use $element.prop("disabled")' +
' instead.'
);
}
if (args == null || args.length === 0) {
args = [true];
}
var disabled = !args[0];
this.$element.prop('disabled', disabled);
};
Select2.prototype.data = function() {
if (this.options.get('debug') &&
arguments.length > 0 && window.console && console.warn) {
console.warn(
'Select2: Data can no longer be set using `select2("data")`. You ' +
'should consider setting the value instead using `$element.val()`.'
);
}
var data = [];
this.dataAdapter.current(function(currentData) {
data = currentData;
});
return data;
};
Select2.prototype.val = function(args) {
if (this.options.get('debug') && window.console && console.warn) {
console.warn(
'Select2: The `select2("val")` method has been deprecated and will be' +
' removed in later Select2 versions. Use $element.val() instead.'
);
}
if (args == null || args.length === 0) {
return this.$element.val();
}
var newVal = args[0];
if ($.isArray(newVal)) {
newVal = $.map(newVal, function(obj) {
return obj.toString();
});
}
this.$element.val(newVal).trigger('input').trigger('change');
};
Select2.prototype.destroy = function() {
this.$container.remove();
if (this.$element[0].detachEvent) {
this.$element[0].detachEvent('onpropertychange', this._syncA);
}
if (this._observer != null) {
this._observer.disconnect();
this._observer = null;
} else if (this.$element[0].removeEventListener) {
this.$element[0]
.removeEventListener('DOMAttrModified', this._syncA, false);
this.$element[0]
.removeEventListener('DOMNodeInserted', this._syncS, false);
this.$element[0]
.removeEventListener('DOMNodeRemoved', this._syncS, false);
}
this._syncA = null;
this._syncS = null;
this.$element.off('.select2');
this.$element.attr('tabindex',
Utils.GetData(this.$element[0], 'old-tabindex'));
this.$element.removeClass('select2-hidden-accessible');
this.$element.attr('aria-hidden', 'false');
Utils.RemoveData(this.$element[0]);
this.$element.removeData('select2');
this.dataAdapter.destroy();
this.selection.destroy();
this.dropdown.destroy();
this.results.destroy();
this.dataAdapter = null;
this.selection = null;
this.dropdown = null;
this.results = null;
};
Select2.prototype.render = function() {
var $container = $(
'' +
'' +
'' +
''
);
$container.attr('dir', this.options.get('dir'));
this.$container = $container;
this.$container.addClass('select-box-' + this.options.get('theme'));
Utils.StoreData($container[0], 'element', this.$element);
return $container;
};
return Select2;
});
S2.define('select2/compat/utils', [
'jquery'
], function($) {
function syncCssClasses($dest, $src, adapter) {
var classes, replacements = [],
adapted;
classes = $.trim($dest.attr('class'));
if (classes) {
classes = '' + classes; // for IE which returns object
$(classes.split(/\s+/)).each(function() {
// Save all Select2 classes
if (this.indexOf('select2-') === 0) {
replacements.push(this);
}
});
}
classes = $.trim($src.attr('class'));
if (classes) {
classes = '' + classes; // for IE which returns object
$(classes.split(/\s+/)).each(function() {
// Only adapt non-Select2 classes
if (this.indexOf('select2-') !== 0) {
adapted = adapter(this);
if (adapted != null) {
replacements.push(adapted);
}
}
});
}
$dest.attr('class', replacements.join(' '));
}
return {
syncCssClasses: syncCssClasses
};
});
S2.define('select2/compat/containerCss', [
'jquery',
'./utils'
], function($, CompatUtils) {
// No-op CSS adapter that discards all classes by default
function _containerAdapter(clazz) {
return null;
}
function ContainerCSS() {}
ContainerCSS.prototype.render = function(decorated) {
var $container = decorated.call(this);
var containerCssClass = this.options.get('containerCssClass') || '';
if ($.isFunction(containerCssClass)) {
containerCssClass = containerCssClass(this.$element);
}
var containerCssAdapter = this.options.get('adaptContainerCssClass');
containerCssAdapter = containerCssAdapter || _containerAdapter;
if (containerCssClass.indexOf(':all:') !== -1) {
containerCssClass = containerCssClass.replace(':all:', '');
var _cssAdapter = containerCssAdapter;
containerCssAdapter = function(clazz) {
var adapted = _cssAdapter(clazz);
if (adapted != null) {
// Append the old one along with the adapted one
return adapted + ' ' + clazz;
}
return clazz;
};
}
var containerCss = this.options.get('containerCss') || {};
if ($.isFunction(containerCss)) {
containerCss = containerCss(this.$element);
}
CompatUtils.syncCssClasses($container, this.$element, containerCssAdapter);
$container.css(containerCss);
$container.addClass(containerCssClass);
return $container;
};
return ContainerCSS;
});
S2.define('select2/compat/dropdownCss', [
'jquery',
'./utils'
], function($, CompatUtils) {
// No-op CSS adapter that discards all classes by default
function _dropdownAdapter(clazz) {
return null;
}
function DropdownCSS() {}
DropdownCSS.prototype.render = function(decorated) {
var $dropdown = decorated.call(this);
var dropdownCssClass = this.options.get('dropdownCssClass') || '';
if ($.isFunction(dropdownCssClass)) {
dropdownCssClass = dropdownCssClass(this.$element);
}
var dropdownCssAdapter = this.options.get('adaptDropdownCssClass');
dropdownCssAdapter = dropdownCssAdapter || _dropdownAdapter;
if (dropdownCssClass.indexOf(':all:') !== -1) {
dropdownCssClass = dropdownCssClass.replace(':all:', '');
var _cssAdapter = dropdownCssAdapter;
dropdownCssAdapter = function(clazz) {
var adapted = _cssAdapter(clazz);
if (adapted != null) {
// Append the old one along with the adapted one
return adapted + ' ' + clazz;
}
return clazz;
};
}
var dropdownCss = this.options.get('dropdownCss') || {};
if ($.isFunction(dropdownCss)) {
dropdownCss = dropdownCss(this.$element);
}
CompatUtils.syncCssClasses($dropdown, this.$element, dropdownCssAdapter);
$dropdown.css(dropdownCss);
$dropdown.addClass(dropdownCssClass);
return $dropdown;
};
return DropdownCSS;
});
S2.define('select2/compat/initSelection', [
'jquery'
], function($) {
function InitSelection(decorated, $element, options) {
if (options.get('debug') && window.console && console.warn) {
console.warn(
'Select2: The `initSelection` option has been deprecated in favor' +
' of a custom data adapter that overrides the `current` method. ' +
'This method is now called multiple times instead of a single ' +
'time when the instance is initialized. Support will be removed ' +
'for the `initSelection` option in future versions of Select2'
);
}
this.initSelection = options.get('initSelection');
this._isInitialized = false;
decorated.call(this, $element, options);
}
InitSelection.prototype.current = function(decorated, callback) {
var self = this;
if (this._isInitialized) {
decorated.call(this, callback);
return;
}
this.initSelection.call(null, this.$element, function(data) {
self._isInitialized = true;
if (!$.isArray(data)) {
data = [data];
}
callback(data);
});
};
return InitSelection;
});
S2.define('select2/compat/inputData', [
'jquery',
'../utils'
], function($, Utils) {
function InputData(decorated, $element, options) {
this._currentData = [];
this._valueSeparator = options.get('valueSeparator') || ',';
if ($element.prop('type') === 'hidden') {
if (options.get('debug') && console && console.warn) {
console.warn(
'Select2: Using a hidden input with Select2 is no longer ' +
'supported and may stop working in the future. It is recommended ' +
'to use a `